| // Copyright 2017-2020 The Verible Authors. |
| // |
| // Licensed under the Apache License, Version 2.0 (the "License"); |
| // you may not use this file except in compliance with the License. |
| // You may obtain a copy of the License at |
| // |
| // http://www.apache.org/licenses/LICENSE-2.0 |
| // |
| // Unless required by applicable law or agreed to in writing, software |
| // distributed under the License is distributed on an "AS IS" BASIS, |
| // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| // See the License for the specific language governing permissions and |
| // limitations under the License. |
| |
| #include "verilog/analysis/symbol_table.h" |
| |
| #include <algorithm> |
| #include <functional> |
| #include <iostream> |
| #include <memory> |
| #include <sstream> |
| #include <vector> |
| |
| #include "absl/base/attributes.h" |
| #include "absl/status/status.h" |
| #include "absl/strings/string_view.h" |
| #include "common/text/symbol.h" |
| #include "common/text/tree_utils.h" |
| #include "common/util/file_util.h" |
| #include "common/util/logging.h" |
| #include "common/util/range.h" |
| #include "common/util/tree_operations.h" |
| #include "gmock/gmock.h" |
| #include "gtest/gtest.h" |
| #include "verilog/analysis/verilog_project.h" |
| |
| namespace verilog { |
| |
| // Directly test some SymbolTable internals. |
| class SymbolTable::Tester : public SymbolTable { |
| public: |
| explicit Tester(VerilogProject* project) : SymbolTable(project) {} |
| |
| using SymbolTable::MutableRoot; |
| }; |
| |
| namespace { |
| |
| using testing::ElementsAreArray; |
| using testing::HasSubstr; |
| using verible::file::Basename; |
| using verible::file::CreateDir; |
| using verible::file::JoinPath; |
| using verible::file::testing::ScopedTestFile; |
| |
| // An in-memory source file that doesn't require file-system access, |
| // nor create temporary files. |
| using TestVerilogSourceFile = InMemoryVerilogSourceFile; |
| |
| struct ScopePathPrinter { |
| const SymbolTableNode& node; |
| }; |
| |
| static std::ostream& operator<<(std::ostream& stream, |
| const ScopePathPrinter& p) { |
| return SymbolTableNodeFullPath(stream, p.node); |
| } |
| |
| // Assert that map/set element exists at 'key', and assigns it to 'dest' |
| // 'key' must be printable for failure diagnostic message. |
| // Defined as a macro for meaningful line numbers on failure. |
| #define ASSIGN_MUST_FIND(dest, map, key) \ |
| const auto found_##dest(map.find(key)); /* iterator */ \ |
| ASSERT_NE(found_##dest, map.end()) \ |
| << "No element at \"" << key << "\" in " #map; \ |
| const auto& dest ABSL_ATTRIBUTE_UNUSED( \ |
| found_##dest->second); /* mapped_type */ |
| |
| // Assert that container is not empty, and reference its first element. |
| // Works on any container type with .begin(). |
| // Defined as a macro for meaningful line numbers on failure. |
| #define ASSIGN_MUST_HAVE_FIRST_ELEMENT(dest, container) \ |
| ASSERT_FALSE(container.empty()); \ |
| const auto& dest(*container.begin()); |
| |
| // Assert that container has exactly one-element, and reference it. |
| // Works on any container with .size() and .begin(). |
| // Defined as a macro for meaningful line numbers on failure. |
| #define ASSIGN_MUST_HAVE_UNIQUE(dest, container) \ |
| ASSERT_EQ(container.size(), 1); \ |
| const auto& dest(*container.begin()); |
| |
| // Shorthand for asserting that a symbol table lookup from |
| // (const SymbolTableNode& scope) using (absl::string_view key) must succeed, |
| // and is captured as (const SymbolTableNode& dest). |
| // Most of the time, the tester is not interested in the found_* iterator. |
| // This also defines 'dest##_info' as the SymbolInfo value attached to the |
| // 'dest' SymbolTableNode. Defined as a macro so that failure gives meaningful |
| // line numbers, and this allows ASSERT_NE to early exit. |
| #define MUST_ASSIGN_LOOKUP_SYMBOL(dest, scope, key) \ |
| const auto found_##dest = (scope).Find(key); \ |
| ASSERT_NE(found_##dest, (scope).end()) \ |
| << "No symbol at \"" << key << "\" in " << ScopePathPrinter{scope}; \ |
| EXPECT_EQ(found_##dest->first, key); \ |
| const SymbolTableNode& dest(found_##dest->second); \ |
| const SymbolInfo& dest##_info ABSL_ATTRIBUTE_UNUSED(dest.Value()) |
| |
| // For SymbolInfo::references_map_view_type only: Assert that there is exactly |
| // one element at 'key' in 'map' and assign it to 'dest' (DependentReferences). |
| // 'map' should come from SymbolInfo::LocalReferencesMapViewForTesting(). |
| #define ASSIGN_MUST_FIND_EXACTLY_ONE_REF(dest, map, key) \ |
| ASSIGN_MUST_FIND(dest##_candidates, map, key); /* set of candidates */ \ |
| ASSIGN_MUST_HAVE_UNIQUE(dest, dest##_candidates); |
| |
| // Expect sequence of statuses to be empty, or print first (non-ok) status. |
| #define EXPECT_EMPTY_STATUSES(diagnostics) \ |
| EXPECT_EQ(diagnostics.size(), 0) << "First unexpected diagnostic:\n" \ |
| << diagnostics.front().message() |
| |
| TEST(SymbolMetaTypePrintTest, Print) { |
| std::ostringstream stream; |
| stream << SymbolMetaType::kClass; |
| EXPECT_EQ(stream.str(), "class"); |
| } |
| |
| TEST(SymbolTableNodeFullPathTest, Print) { |
| typedef SymbolTableNode::key_value_type KV; |
| const SymbolTableNode root( |
| SymbolInfo{}, |
| KV("AA", SymbolTableNode(SymbolInfo{}, KV("BB", SymbolTableNode{})))); |
| { |
| std::ostringstream stream; |
| SymbolTableNodeFullPath(stream, root); |
| EXPECT_EQ(stream.str(), "$root"); |
| } |
| { |
| std::ostringstream stream; |
| SymbolTableNodeFullPath(stream, root.begin()->second); |
| EXPECT_EQ(stream.str(), "$root::AA"); |
| } |
| { |
| std::ostringstream stream; |
| SymbolTableNodeFullPath(stream, root.begin()->second.begin()->second); |
| EXPECT_EQ(stream.str(), "$root::AA::BB"); |
| } |
| } |
| |
| TEST(ReferenceComponentTest, MatchesMetatypeTest) { |
| { // kUnspecified matches all metatypes |
| const ReferenceComponent component{ |
| .identifier = "", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kUnspecified}; |
| for (const auto& other : |
| {SymbolMetaType::kUnspecified, SymbolMetaType::kParameter, |
| SymbolMetaType::kFunction, SymbolMetaType::kTask}) { |
| const auto status = component.MatchesMetatype(other); |
| EXPECT_TRUE(status.ok()) << status.message(); |
| } |
| } |
| { // kCallable matches only kFunction and kTask |
| const ReferenceComponent component{ |
| .identifier = "", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kCallable}; |
| for (const auto& other : |
| {SymbolMetaType::kFunction, SymbolMetaType::kTask}) { |
| const auto status = component.MatchesMetatype(other); |
| EXPECT_TRUE(status.ok()) << status.message(); |
| } |
| for (const auto& other : {SymbolMetaType::kModule, SymbolMetaType::kPackage, |
| SymbolMetaType::kClass}) { |
| const auto status = component.MatchesMetatype(other); |
| EXPECT_FALSE(status.ok()) |
| << component.required_metatype << " vs. " << other; |
| } |
| } |
| { // kClass matches only kClass and kTypeAlias |
| const ReferenceComponent component{ |
| .identifier = "", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kClass}; |
| for (const auto& other : |
| {SymbolMetaType::kClass, SymbolMetaType::kTypeAlias}) { |
| const auto status = component.MatchesMetatype(other); |
| EXPECT_TRUE(status.ok()) << status.message(); |
| } |
| for (const auto& other : |
| {SymbolMetaType::kModule, SymbolMetaType::kPackage, |
| SymbolMetaType::kFunction, SymbolMetaType::kTask}) { |
| const auto status = component.MatchesMetatype(other); |
| EXPECT_FALSE(status.ok()) |
| << component.required_metatype << " vs. " << other; |
| } |
| } |
| { // all other types must be matched exactly |
| const ReferenceComponent component{ |
| .identifier = "", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kFunction}; |
| |
| for (const auto& other : |
| {SymbolMetaType::kUnspecified, SymbolMetaType::kParameter, |
| SymbolMetaType::kModule, SymbolMetaType::kTask, |
| SymbolMetaType::kClass}) { |
| const auto status = component.MatchesMetatype(other); |
| EXPECT_FALSE(status.ok()) |
| << component.required_metatype << " vs. " << other; |
| } |
| } |
| } |
| |
| TEST(ReferenceNodeFullPathTest, Print) { |
| typedef ReferenceComponentNode Node; |
| typedef ReferenceComponent Data; |
| const Node root( |
| Data{.identifier = "xx", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kClass}, |
| Node(Data{.identifier = "yy", .ref_type = ReferenceType::kDirectMember}, |
| Node(Data{.identifier = "zz", |
| .ref_type = ReferenceType::kMemberOfTypeOfParent}))); |
| { |
| std::ostringstream stream; |
| ReferenceNodeFullPath(stream, root); |
| EXPECT_EQ(stream.str(), "@xx[class]"); |
| } |
| { |
| std::ostringstream stream; |
| ReferenceNodeFullPath(stream, root.Children().front()); |
| EXPECT_EQ(stream.str(), "@xx[class]::yy"); |
| } |
| { |
| std::ostringstream stream; |
| ReferenceNodeFullPath(stream, root.Children().front().Children().front()); |
| EXPECT_EQ(stream.str(), "@xx[class]::yy.zz"); |
| } |
| } |
| |
| TEST(DependentReferencesTest, PrintEmpty) { |
| DependentReferences dep_refs; |
| std::ostringstream stream; |
| stream << dep_refs; |
| EXPECT_EQ(stream.str(), "(empty-ref)"); |
| } |
| |
| TEST(DependentReferencesTest, PrintOnlyRootNodeUnresolved) { |
| const DependentReferences dep_refs{std::make_unique<ReferenceComponentNode>( |
| ReferenceComponent{.identifier = "foo", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kUnspecified, |
| .resolved_symbol = nullptr})}; |
| std::ostringstream stream; |
| stream << dep_refs; |
| EXPECT_EQ(stream.str(), "{ (@foo -> <unresolved>) }"); |
| } |
| |
| TEST(DependentReferencesTest, PrintNonRootResolved) { |
| // Synthesize a symbol table. |
| typedef SymbolTableNode::key_value_type KV; |
| SymbolTableNode root( |
| SymbolInfo{SymbolMetaType::kRoot}, |
| KV{"p_pkg", |
| SymbolTableNode(SymbolInfo{SymbolMetaType::kPackage}, |
| KV{"c_class", SymbolTableNode(SymbolInfo{ |
| SymbolMetaType::kClass})})}); |
| |
| // Bookmark symbol table nodes. |
| MUST_ASSIGN_LOOKUP_SYMBOL(p_pkg, root, "p_pkg"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(c_class, p_pkg, "c_class"); |
| |
| // Construct references already resolved to above nodes. |
| const DependentReferences dep_refs{std::make_unique<ReferenceComponentNode>( |
| ReferenceComponent{.identifier = "p_pkg", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kPackage, |
| .resolved_symbol = &p_pkg}, |
| ReferenceComponentNode( |
| ReferenceComponent{.identifier = "c_class", |
| .ref_type = ReferenceType::kDirectMember, |
| .required_metatype = SymbolMetaType::kClass, |
| .resolved_symbol = &c_class}))}; |
| |
| // Print and compare. |
| std::ostringstream stream; |
| stream << dep_refs; |
| EXPECT_EQ(stream.str(), |
| R"({ (@p_pkg[package] -> $root::p_pkg) |
| { (::c_class[class] -> $root::p_pkg::c_class) } |
| })"); |
| } |
| |
| TEST(SymbolTablePrintTest, PrintClass) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module ss;\n" |
| "endmodule\n" |
| "module tt;\n" |
| " ss qq();\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()); |
| SymbolTable symbol_table(nullptr); |
| EXPECT_EQ(symbol_table.Project(), nullptr); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| { |
| std::ostringstream stream; |
| symbol_table.PrintSymbolDefinitions(stream); |
| EXPECT_EQ(stream.str(), R"({ ( |
| metatype: <root> |
| ) |
| ss: { ( |
| metatype: module |
| file: foobar.sv |
| ) } |
| tt: { ( |
| metatype: module |
| file: foobar.sv |
| ) |
| qq: { ( |
| metatype: data/net/var/instance |
| file: foobar.sv |
| type-info { source: "ss", type ref: { (@ss -> <unresolved>) } } |
| ) } |
| } |
| })"); |
| } |
| { |
| std::ostringstream stream; |
| symbol_table.PrintSymbolReferences(stream); |
| EXPECT_EQ(stream.str(), R"({ (refs: ) |
| ss: { (refs: ) } |
| tt: { (refs: |
| { (@ss -> <unresolved>) } |
| { (@qq[data/net/var/instance] -> $root::tt::qq) } |
| ) |
| qq: { (refs: ) } |
| } |
| })"); |
| } |
| |
| { // Resolve symbols. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| { // <unresolved> should now become "$root::ss" |
| std::ostringstream stream; |
| symbol_table.PrintSymbolDefinitions(stream); |
| EXPECT_EQ(stream.str(), R"({ ( |
| metatype: <root> |
| ) |
| ss: { ( |
| metatype: module |
| file: foobar.sv |
| ) } |
| tt: { ( |
| metatype: module |
| file: foobar.sv |
| ) |
| qq: { ( |
| metatype: data/net/var/instance |
| file: foobar.sv |
| type-info { source: "ss", type ref: { (@ss -> $root::ss) } } |
| ) } |
| } |
| })"); |
| } |
| { // <unresolved> should now become "$root::ss" |
| std::ostringstream stream; |
| symbol_table.PrintSymbolReferences(stream); |
| EXPECT_EQ(stream.str(), R"({ (refs: ) |
| ss: { (refs: ) } |
| tt: { (refs: |
| { (@ss -> $root::ss) } |
| { (@qq[data/net/var/instance] -> $root::tt::qq) } |
| ) |
| qq: { (refs: ) } |
| } |
| })"); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, IntegrityCheckResolvedSymbol) { |
| const auto test_func = []() { |
| SymbolTable::Tester symbol_table_1(nullptr), symbol_table_2(nullptr); |
| SymbolTableNode& root1(symbol_table_1.MutableRoot()); |
| SymbolTableNode& root2(symbol_table_2.MutableRoot()); |
| // Deliberately point from one symbol table to the other. |
| // To avoid an use-after-free AddressSanitizer error, |
| // mind the destruction ordering here: |
| // symbol_table1 will outlive symbol_table_2, so give symbol_table_2 a |
| // pointer to symbol_table_1. |
| root2.Value().local_references_to_bind.push_back(DependentReferences{ |
| std::make_unique<ReferenceComponentNode>(ReferenceComponent{ |
| .identifier = "foo", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kUnspecified, |
| .resolved_symbol = &root1})}); |
| // CheckIntegrity() will fail on destruction of symbol_table_2. |
| }; |
| EXPECT_DEATH(test_func(), |
| "Resolved symbols must point to a node in the same SymbolTable"); |
| } |
| |
| TEST(BuildSymbolTableTest, IntegrityCheckDeclaredType) { |
| const auto test_func = []() { |
| SymbolTable::Tester symbol_table_1(nullptr), symbol_table_2(nullptr); |
| SymbolTableNode& root1(symbol_table_1.MutableRoot()); |
| SymbolTableNode& root2(symbol_table_2.MutableRoot()); |
| // Deliberately point from one symbol table to the other. |
| // To avoid an use-after-free AddressSanitizer error, |
| // mind the destruction ordering here: |
| // symbol_table1 will outlive symbol_table_2, so give symbol_table_2 a |
| // pointer to symbol_table_1. |
| root1.Value().local_references_to_bind.push_back(DependentReferences{ |
| std::make_unique<ReferenceComponentNode>(ReferenceComponent{ |
| .identifier = "foo", |
| .ref_type = ReferenceType::kUnqualified, |
| .required_metatype = SymbolMetaType::kUnspecified, |
| .resolved_symbol = &root1})}); |
| root2.Value().declared_type.user_defined_type = |
| root1.Value().local_references_to_bind.front().components.get(); |
| // CheckIntegrity() will fail on destruction of symbol_table_2. |
| }; |
| EXPECT_DEATH(test_func(), |
| "Resolved symbols must point to a node in the same SymbolTable"); |
| } |
| |
| TEST(BuildSymbolTableTest, InvalidSyntax) { |
| constexpr absl::string_view invalid_codes[] = { |
| "module;\nendmodule\n", |
| }; |
| for (const auto& code : invalid_codes) { |
| TestVerilogSourceFile src("foobar.sv", code); |
| const auto status = src.Parse(); |
| EXPECT_FALSE(status.ok()); |
| SymbolTable symbol_table(nullptr); |
| EXPECT_EQ(symbol_table.Project(), nullptr); |
| |
| { // Attempt to build symbol table after parse failure. |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| |
| EXPECT_TRUE(symbol_table.Root().Children().empty()); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| } |
| { // Attempt to resolve empty symbol table and references. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AvoidCrashFromFuzzer) { |
| // All that matters is that these test cases do not trigger crashes. |
| constexpr absl::string_view codes[] = { |
| // some of these test cases come from fuzz testing |
| // and may contain syntax errors |
| "`e(C*C);\n", // expect two distinct reference trees |
| "`e(C::D * C.m + 12);\n", // expect two reference trees |
| "n#7;\n", |
| "c#1;;=P;\n", |
| }; |
| for (const auto& code : codes) { |
| TestVerilogSourceFile src("foobar.sv", code); |
| const auto status = src.Parse(); // don't care if code is valid or not |
| SymbolTable symbol_table(nullptr); |
| EXPECT_EQ(symbol_table.Project(), nullptr); |
| |
| { // Attempt to build symbol table. |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| // don't care about diagnostics |
| } |
| { // Attempt to resolve empty symbol table and references. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| // don't care about diagnostics |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationSingleEmpty) { |
| TestVerilogSourceFile src("foobar.sv", "module m;\nendmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "m"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationLocalNetsVariables) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m;\n" |
| " wire w1, w2;\n" |
| " logic l1, l2;\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "m"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| static constexpr absl::string_view members[] = {"w1", "w2", "l1", "l2"}; |
| for (const auto& member : members) { |
| MUST_ASSIGN_LOOKUP_SYMBOL(member_node, module_node, member); |
| EXPECT_EQ(member_node_info.metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(member_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationLocalDuplicateNets) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m;\n" |
| " wire y1;\n" |
| " logic y1;\n" // y1 already declared |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "m"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err_status, build_diagnostics); |
| EXPECT_EQ(err_status.code(), absl::StatusCode::kAlreadyExists); |
| EXPECT_THAT(err_status.message(), |
| HasSubstr("\"y1\" is already defined in the $root::m scope")); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationConditionalGenerateAnonymous) { |
| constexpr absl::string_view source_variants[] = { |
| // with begin/end |
| "module m;\n" |
| " if (1) begin\n" |
| " wire x;\n" |
| " end else if (2) begin\n" |
| " wire y;\n" |
| " end else begin\n" |
| " wire z;\n" |
| " end\n" |
| "endmodule\n", |
| // without begin/end |
| "module m;\n" |
| " if (1)\n" |
| " wire x;\n" |
| " else if (2)\n" |
| " wire y;\n" |
| " else\n" |
| " wire z;\n" |
| "endmodule\n", |
| }; |
| for (const auto& code : source_variants) { |
| TestVerilogSourceFile src("foobar.sv", code); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "m"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| ASSERT_EQ(module_node.Children().size(), 3); |
| auto iter = module_node.Children().begin(); |
| { |
| const SymbolTableNode& gen_block(iter->second); // anonymous "...-0" |
| const SymbolInfo& gen_block_info(gen_block.Value()); |
| EXPECT_EQ(gen_block_info.metatype, SymbolMetaType::kGenerate); |
| MUST_ASSIGN_LOOKUP_SYMBOL(wire_x, gen_block, "x"); |
| EXPECT_EQ(wire_x_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ++iter; |
| } |
| { |
| const SymbolTableNode& gen_block(iter->second); // anonymous "...-1" |
| const SymbolInfo& gen_block_info(gen_block.Value()); |
| EXPECT_EQ(gen_block_info.metatype, SymbolMetaType::kGenerate); |
| MUST_ASSIGN_LOOKUP_SYMBOL(wire_y, gen_block, "y"); |
| EXPECT_EQ(wire_y_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ++iter; |
| } |
| { |
| const SymbolTableNode& gen_block(iter->second); // anonymous "...-2" |
| const SymbolInfo& gen_block_info(gen_block.Value()); |
| EXPECT_EQ(gen_block_info.metatype, SymbolMetaType::kGenerate); |
| MUST_ASSIGN_LOOKUP_SYMBOL(wire_z, gen_block, "z"); |
| EXPECT_EQ(wire_z_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ++iter; |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationConditionalGenerateLabeled) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m;\n" |
| " if (1) begin : cc\n" |
| " wire x;\n" |
| " end else if (2) begin : bb\n" |
| " wire y;\n" |
| " end else begin : aa\n" |
| " wire z;\n" |
| " end\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "m"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| ASSERT_EQ(module_node.Children().size(), 3); |
| { |
| MUST_ASSIGN_LOOKUP_SYMBOL(gen_block, module_node, "aa"); |
| EXPECT_EQ(gen_block_info.metatype, SymbolMetaType::kGenerate); |
| MUST_ASSIGN_LOOKUP_SYMBOL(wire_z, gen_block, "z"); |
| EXPECT_EQ(wire_z_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| } |
| { |
| MUST_ASSIGN_LOOKUP_SYMBOL(gen_block, module_node, "bb"); |
| EXPECT_EQ(gen_block_info.metatype, SymbolMetaType::kGenerate); |
| MUST_ASSIGN_LOOKUP_SYMBOL(wire_y, gen_block, "y"); |
| EXPECT_EQ(wire_y_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| } |
| { |
| MUST_ASSIGN_LOOKUP_SYMBOL(gen_block, module_node, "cc"); |
| EXPECT_EQ(gen_block_info.metatype, SymbolMetaType::kGenerate); |
| MUST_ASSIGN_LOOKUP_SYMBOL(wire_x, gen_block, "x"); |
| EXPECT_EQ(wire_x_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationWithPorts) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m (\n" |
| " input wire clk,\n" |
| " output reg q\n" |
| ");\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "m"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| static constexpr absl::string_view members[] = {"clk", "q"}; |
| for (const auto& member : members) { |
| MUST_ASSIGN_LOOKUP_SYMBOL(member_node, module_node, member); |
| EXPECT_EQ(member_node_info.metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(member_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationMultiple) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m1;\nendmodule\n" |
| "module m2;\nendmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| const absl::string_view expected_modules[] = {"m1", "m2"}; |
| for (const auto& expected_module : expected_modules) { |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, expected_module); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationDuplicate) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module mm;\nendmodule\n" |
| "module mm;\nendmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "mm"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kAlreadyExists); |
| EXPECT_THAT(err.message(), |
| HasSubstr("\"mm\" is already defined in the $root scope")); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationNested) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m_outer;\n" |
| " module m_inner;\n" |
| " endmodule\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(outer_module_node, root_symbol, "m_outer"); |
| { |
| EXPECT_EQ(outer_module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(outer_module_node_info.file_origin, &src); |
| EXPECT_EQ(outer_module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| } |
| { |
| MUST_ASSIGN_LOOKUP_SYMBOL(inner_module_node, outer_module_node, "m_inner"); |
| EXPECT_EQ(inner_module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(inner_module_node_info.file_origin, &src); |
| EXPECT_EQ(inner_module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| } |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationNestedDuplicate) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module outer;\n" |
| " module mm;\nendmodule\n" |
| " module mm;\nendmodule\n" // dupe |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "outer"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kAlreadyExists); |
| EXPECT_THAT(err.message(), |
| HasSubstr("\"mm\" is already defined in the $root::outer scope")); |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstance) { |
| // The following code variants should yield the same symbol table results: |
| static constexpr absl::string_view source_variants[] = { |
| // pp defined earlier in file |
| "module pp;\n" |
| "endmodule\n" |
| "module qq;\n" |
| " pp rr();\n" // instance |
| "endmodule\n", |
| // pp defined later in file |
| "module qq;\n" |
| " pp rr();\n" // instance |
| "endmodule\n" |
| "module pp;\n" |
| "endmodule\n", |
| }; |
| for (const auto& code : source_variants) { |
| VLOG(1) << "code:\n" << code; |
| TestVerilogSourceFile src("foobar.sv", code); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Goal: resolve the reference of "pp" to this definition node. |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| |
| // "rr" is an instance of type "pp" |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr, qq, "rr"); |
| |
| { |
| EXPECT_EQ(qq_info.file_origin, &src); |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 2); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "rr" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(rr_self_ref, ref_map, "rr"); |
| EXPECT_TRUE(is_leaf(*rr_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(rr_self_ref->components->Value().resolved_symbol, &rr); |
| } |
| } |
| |
| EXPECT_TRUE(rr_info.local_references_to_bind.empty()); |
| EXPECT_NE(rr_info.declared_type.user_defined_type, nullptr); |
| { |
| const ReferenceComponent& pp_type( |
| rr_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| } |
| EXPECT_EQ(rr_info.file_origin, &src); |
| |
| // Resolve symbols. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Verify that typeof(rr) successfully resolved to module pp. |
| EXPECT_EQ(rr_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &pp); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceUndefined) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module qq;\n" |
| " pp rr();\n" // instance, pp undefined |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| { |
| EXPECT_EQ(qq_info.file_origin, &src); |
| // There is only one reference to the "pp" module type. |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 2); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| { // verify that a reference to "pp" was established |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| } |
| |
| // "rr" is an instance of type "pp" (which is undefined) |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr, qq, "rr"); |
| EXPECT_TRUE(rr_info.local_references_to_bind.empty()); |
| EXPECT_NE(rr_info.declared_type.user_defined_type, nullptr); |
| { |
| const ReferenceComponent& pp_type( |
| rr_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| } |
| EXPECT_EQ(rr_info.file_origin, &src); |
| |
| { |
| // Resolve symbols. Expect one unresolved symbol. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err_status, resolve_diagnostics); |
| EXPECT_EQ(err_status.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT(err_status.message(), |
| HasSubstr("Unable to resolve symbol \"pp\"")); |
| // Verify that typeof(rr) failed to resolve "pp". |
| EXPECT_EQ(rr_info.declared_type.user_defined_type->Value().resolved_symbol, |
| nullptr); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceTwoInSameDecl) { |
| static constexpr absl::string_view source_variants[] = { |
| // The following all yield equivalent symbol tables bindings. |
| "module pp;\n" |
| "endmodule\n" |
| "module qq;\n" |
| " pp r1(), r2();\n" // instances |
| "endmodule\n", |
| "module qq;\n" |
| " pp r1(), r2();\n" // instances |
| "endmodule\n" |
| "module pp;\n" |
| "endmodule\n", |
| // swap r1, r2 order |
| "module pp;\n" |
| "endmodule\n" |
| "module qq;\n" |
| " pp r2(), r1();\n" // instances |
| "endmodule\n", |
| "module qq;\n" |
| " pp r2(), r1();\n" // instances |
| "endmodule\n" |
| "module pp;\n" |
| "endmodule\n", |
| }; |
| for (const auto& code : source_variants) { |
| TestVerilogSourceFile src("foobar.sv", code); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| { |
| EXPECT_EQ(qq_info.file_origin, &src); |
| // There is only one type reference of interest, the "pp" module type. |
| // The other two are instance self-references. |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 3); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| |
| // "r1" and "r2" are both instances of type "pp" |
| static constexpr absl::string_view pp_instances[] = {"r1", "r2"}; |
| for (const auto& pp_inst : pp_instances) { |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr, qq, pp_inst); |
| EXPECT_TRUE(rr_info.local_references_to_bind.empty()); |
| EXPECT_NE(rr_info.declared_type.user_defined_type, nullptr); |
| { |
| const ReferenceComponent& pp_type( |
| rr_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| } |
| EXPECT_EQ(rr_info.file_origin, &src); |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| for (const auto& pp_inst : pp_instances) { |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr, qq, pp_inst); |
| EXPECT_TRUE(rr_info.local_references_to_bind.empty()); |
| // Verify that typeof(r1,r2) successfully resolved to module pp. |
| EXPECT_EQ( |
| rr_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &pp); |
| } |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstancePositionalPortConnection) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m (\n" |
| " input wire clk,\n" |
| " output reg q\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " wire c, d;\n" |
| " m m_inst(c, d);" |
| // one type reference, two net references |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(clk_node, m_node, "clk"); |
| EXPECT_EQ(clk_node_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(clk_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(q_node, m_node, "q"); |
| EXPECT_EQ(q_node_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(q_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| |
| // Inspect local references to wires "c" and "d". |
| ASSERT_EQ(rr_node_info.local_references_to_bind.size(), 4); |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(c_ref, ref_map, "c"); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(d_ref, ref_map, "d"); |
| EXPECT_EQ(c_ref->LastLeaf()->Value().identifier, "c"); |
| EXPECT_EQ(c_ref->LastLeaf()->Value().resolved_symbol, nullptr); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().identifier, "d"); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().resolved_symbol, nullptr); |
| |
| // Get the local symbol definitions for wires "c" and "d". |
| MUST_ASSIGN_LOOKUP_SYMBOL(c_node, rr_node, "c"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(d_node, rr_node, "d"); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Expect to resolve local references to wires "c" and "d". |
| EXPECT_EQ(c_ref->LastLeaf()->Value().resolved_symbol, &c_node); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().resolved_symbol, &d_node); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceNamedPortConnection) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m (\n" |
| " input wire clk,\n" |
| " output reg q\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " wire c, d;\n" |
| " m m_inst(.clk(c), .q(d));" |
| // one type reference, two local net references |
| // two named port references |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(clk_node, m_node, "clk"); |
| EXPECT_EQ(clk_node_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(clk_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(q_node, m_node, "q"); |
| EXPECT_EQ(q_node_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(q_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| |
| // Inspect local references to wires "c" and "d". |
| ASSERT_EQ(rr_node_info.local_references_to_bind.size(), 4); |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(c_ref, ref_map, "c"); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(d_ref, ref_map, "d"); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_inst_ref, ref_map, "m_inst"); |
| EXPECT_EQ(c_ref->LastLeaf()->Value().identifier, "c"); |
| EXPECT_EQ(c_ref->LastLeaf()->Value().resolved_symbol, nullptr); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().identifier, "d"); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().resolved_symbol, nullptr); |
| |
| const ReferenceComponentNode& m_inst_ref_root(*m_inst_ref->components); |
| ASSERT_EQ(m_inst_ref_root.Children().size(), 2); |
| const ReferenceComponentMap port_refs( |
| ReferenceComponentNodeMapView(m_inst_ref_root)); |
| |
| ASSIGN_MUST_FIND(clk_ref, port_refs, "clk"); |
| const ReferenceComponent& clk_ref_comp(clk_ref->Value()); |
| EXPECT_EQ(clk_ref_comp.identifier, "clk"); |
| EXPECT_EQ(clk_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(clk_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| ASSIGN_MUST_FIND(q_ref, port_refs, "q"); |
| const ReferenceComponent& q_ref_comp(q_ref->Value()); |
| EXPECT_EQ(q_ref_comp.identifier, "q"); |
| EXPECT_EQ(q_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(q_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(q_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| // Get the local symbol definitions for wires "c" and "d". |
| MUST_ASSIGN_LOOKUP_SYMBOL(c_node, rr_node, "c"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(d_node, rr_node, "d"); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Expect to resolve local references to wires c and d |
| EXPECT_EQ(c_ref->LastLeaf()->Value().resolved_symbol, &c_node); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().resolved_symbol, &d_node); |
| |
| // Expect to resolved named port references to "clk" and "q". |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, &clk_node); |
| EXPECT_EQ(q_ref_comp.resolved_symbol, &q_node); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, |
| ModuleInstanceNamedPortConnectionResolveLocallyOnly) { |
| // Similar to ModuleInstanceNamedPortConnection, but will not resolve |
| // non-local references. |
| TestVerilogSourceFile src("foobar.sv", |
| "module m (\n" |
| " input wire clk,\n" |
| " output reg q\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " wire c, d;\n" |
| " m m_inst(.clk(c), .q(d));" |
| // one type reference, two local net references |
| // two named port references |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(clk_node, m_node, "clk"); |
| EXPECT_EQ(clk_node_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(clk_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(q_node, m_node, "q"); |
| EXPECT_EQ(q_node_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(q_node_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| |
| // Inspect local references to wires "c" and "d". |
| ASSERT_EQ(rr_node_info.local_references_to_bind.size(), 4); |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(c_ref, ref_map, "c"); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(d_ref, ref_map, "d"); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_inst_ref, ref_map, "m_inst"); |
| // Initially not resolved, but will be resolved below. |
| EXPECT_EQ(c_ref->LastLeaf()->Value().identifier, "c"); |
| EXPECT_EQ(c_ref->LastLeaf()->Value().resolved_symbol, nullptr); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().identifier, "d"); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().resolved_symbol, nullptr); |
| |
| const ReferenceComponentNode& m_inst_ref_root(*m_inst_ref->components); |
| ASSERT_EQ(m_inst_ref_root.Children().size(), 2); |
| const ReferenceComponentMap port_refs( |
| ReferenceComponentNodeMapView(m_inst_ref_root)); |
| |
| ASSIGN_MUST_FIND(clk_ref, port_refs, "clk"); |
| const ReferenceComponent& clk_ref_comp(clk_ref->Value()); |
| EXPECT_EQ(clk_ref_comp.identifier, "clk"); |
| EXPECT_EQ(clk_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(clk_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| // "clk" is a non-local reference that will not even be resolved below |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND(q_ref, port_refs, "q"); |
| const ReferenceComponent& q_ref_comp(q_ref->Value()); |
| EXPECT_EQ(q_ref_comp.identifier, "q"); |
| EXPECT_EQ(q_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(q_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| // "q" is a non-local reference that will not even be resolved below |
| EXPECT_EQ(q_ref_comp.resolved_symbol, nullptr); |
| |
| // Get the local symbol definitions for wires "c" and "d". |
| MUST_ASSIGN_LOOKUP_SYMBOL(c_node, rr_node, "c"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(d_node, rr_node, "d"); |
| |
| // Running this twice changes nothing and is safe. |
| for (int i = 0; i < 2; ++i) { |
| symbol_table.ResolveLocallyOnly(); |
| |
| // Expect to resolve local references to wires c and d |
| EXPECT_EQ(c_ref->LastLeaf()->Value().resolved_symbol, &c_node); |
| EXPECT_EQ(d_ref->LastLeaf()->Value().resolved_symbol, &d_node); |
| |
| // Expect to named port references to "clk" and "q" to remain unresolved. |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, nullptr); |
| EXPECT_EQ(q_ref_comp.resolved_symbol, nullptr); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstancePositionalParameterAssignment) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m #(\n" |
| " int N = 1\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " m #(3) m_inst();" |
| // one type reference to "m" |
| // one instance self-reference |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_param, m_node, "N"); |
| EXPECT_EQ(n_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(n_param_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_inst_node, rr_node, "m_inst"); |
| |
| // Inspect local references to "m" and "m_inst". |
| ASSERT_EQ(rr_node_info.local_references_to_bind.size(), 2); |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_ref, ref_map, "m"); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_inst_ref, ref_map, "m_inst"); |
| EXPECT_EQ(m_ref->LastLeaf()->Value().identifier, "m"); |
| EXPECT_EQ(m_ref->LastLeaf()->Value().resolved_symbol, nullptr); |
| EXPECT_EQ(m_inst_ref->LastLeaf()->Value().identifier, "m_inst"); |
| EXPECT_EQ(m_inst_ref->LastLeaf()->Value().resolved_symbol, &m_inst_node); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Expect to resolve local references to "m" and "m_inst". |
| EXPECT_EQ(m_ref->LastLeaf()->Value().resolved_symbol, &m_node); |
| EXPECT_EQ(m_inst_ref->LastLeaf()->Value().resolved_symbol, &m_inst_node); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceNamedParameterAssignment) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m #(\n" |
| " int N = 0,\n" |
| " int P = 1\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " m #(.N(2), .P(3)) m_inst();" |
| // one type reference, one instance self-reference |
| // two named param rereference |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_param, m_node, "N"); |
| EXPECT_EQ(n_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(n_param_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(p_param, m_node, "P"); |
| EXPECT_EQ(p_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(p_param_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_inst_node, rr_node, "m_inst"); |
| |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_type_ref, ref_map, "m"); |
| |
| const ReferenceComponentNode& m_type_ref_root(*m_type_ref->components); |
| ASSERT_EQ(m_type_ref_root.Children().size(), 2); |
| const ReferenceComponentMap param_refs( |
| ReferenceComponentNodeMapView(m_type_ref_root)); |
| |
| ASSIGN_MUST_FIND(n_ref, param_refs, "N"); |
| const ReferenceComponent& n_ref_comp(n_ref->Value()); |
| EXPECT_EQ(n_ref_comp.identifier, "N"); |
| EXPECT_EQ(n_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(n_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(n_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| ASSIGN_MUST_FIND(p_ref, param_refs, "P"); |
| const ReferenceComponent& p_ref_comp(p_ref->Value()); |
| EXPECT_EQ(p_ref_comp.identifier, "P"); |
| EXPECT_EQ(p_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(p_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(p_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Expect ".N" and ".P" to resolve to formal parameters of "m". |
| EXPECT_EQ(n_ref_comp.resolved_symbol, &n_param); |
| EXPECT_EQ(p_ref_comp.resolved_symbol, &p_param); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TimerAsModuleNameRegressionIssue917) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module foo;\n" |
| " timer #(.N(1)) t;\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_node, root_symbol, "foo"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(timer_instance_node, foo_node, "t"); |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceNamedPortIsParameter) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m #(\n" |
| " int N = 0\n" |
| ") (\n" |
| " input wire clk\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " m #(.clk(2)) m_inst();" |
| // error: clk is a net-port, not parameter |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_param, m_node, "N"); |
| EXPECT_EQ(n_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(n_param_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(clk_port, m_node, "clk"); |
| EXPECT_EQ(clk_port_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(clk_port_info.declared_type.user_defined_type, |
| nullptr); // type is primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_inst_node, rr_node, "m_inst"); |
| |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_type_ref, ref_map, "m"); |
| |
| const ReferenceComponentNode& m_type_ref_root(*m_type_ref->components); |
| ASSERT_EQ(m_type_ref_root.Children().size(), 1); |
| const ReferenceComponentMap param_refs( |
| ReferenceComponentNodeMapView(m_type_ref_root)); |
| |
| ASSIGN_MUST_FIND(clk_ref, param_refs, "clk"); |
| const ReferenceComponent& clk_ref_comp(clk_ref->Value()); |
| EXPECT_EQ(clk_ref_comp.identifier, "clk"); |
| EXPECT_EQ(clk_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(clk_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| // Expect ".clk" to fail to resolve. |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), |
| HasSubstr("Expecting reference \"clk\" to resolve to a " |
| "parameter, but found a data/net/var/instance")); |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, nullptr); // still unresolved |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceNamedParameterIsPort) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m #(\n" |
| " int N = 0\n" |
| ") (\n" |
| " input wire clk\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " m m_inst(.N(1));" |
| // error: N is a parameter, not net-port |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_param, m_node, "N"); |
| EXPECT_EQ(n_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(n_param_info.declared_type.user_defined_type, |
| nullptr); // type is primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(clk_port, m_node, "clk"); |
| EXPECT_EQ(clk_port_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(clk_port_info.declared_type.user_defined_type, |
| nullptr); // type is primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_inst_node, rr_node, "m_inst"); |
| |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_inst_ref, ref_map, "m_inst"); |
| |
| const ReferenceComponentNode& m_inst_ref_root(*m_inst_ref->components); |
| ASSERT_EQ(m_inst_ref_root.Children().size(), 1); |
| const ReferenceComponentMap port_refs( |
| ReferenceComponentNodeMapView(m_inst_ref_root)); |
| |
| ASSIGN_MUST_FIND(n_ref, port_refs, "N"); |
| const ReferenceComponent& n_ref_comp(n_ref->Value()); |
| EXPECT_EQ(n_ref_comp.identifier, "N"); |
| EXPECT_EQ(n_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(n_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(n_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| // Expect ".N" to fail to resolve. |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), |
| HasSubstr("Expecting reference \"N\" to resolve to a " |
| "data/net/var/instance, but found a parameter")); |
| EXPECT_EQ(n_ref_comp.resolved_symbol, nullptr); // still unresolved |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceNamedPortConnectionNonexistentPort) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m (\n" |
| " input wire clk,\n" |
| " output reg q\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " wire c;\n" |
| " m m_inst(.clk(c), .p(c));" |
| // one type reference, two local net references |
| // two named port references, "p" does not exist |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(clk_node, m_node, "clk"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(q_node, m_node, "q"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_inst_ref, ref_map, "m_inst"); |
| ASSERT_NE(m_inst_ref, nullptr); |
| |
| const ReferenceComponentNode& m_inst_ref_root(*m_inst_ref->components); |
| ASSERT_EQ(m_inst_ref_root.Children().size(), 2); |
| const ReferenceComponentMap port_refs( |
| ReferenceComponentNodeMapView(m_inst_ref_root)); |
| |
| ASSIGN_MUST_FIND(clk_ref, port_refs, "clk"); |
| const ReferenceComponent& clk_ref_comp(clk_ref->Value()); |
| EXPECT_EQ(clk_ref_comp.identifier, "clk"); |
| EXPECT_EQ(clk_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(clk_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| ASSIGN_MUST_FIND(p_ref, port_refs, "p"); |
| const ReferenceComponent& p_ref_comp(p_ref->Value()); |
| EXPECT_EQ(p_ref_comp.identifier, "p"); |
| EXPECT_EQ(p_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(p_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(p_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| // Get the local symbol definitions for wire "c". |
| MUST_ASSIGN_LOOKUP_SYMBOL(c_node, rr_node, "c"); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("No member symbol \"p\" in parent scope (module) m.")); |
| |
| // Expect to resolved named port reference to "clk", but not "p". |
| EXPECT_EQ(clk_ref_comp.resolved_symbol, &clk_node); |
| EXPECT_EQ(p_ref_comp.resolved_symbol, nullptr); // failed to resolve |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstanceNamedParameterNonexistentError) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m #(\n" |
| " int N = 0,\n" |
| " int P = 1\n" |
| ");\n" |
| "endmodule\n" |
| "module rr;\n" |
| " m #(.N(2), .Q(3)) m_inst();" |
| // one type reference, one instance self-reference |
| // two named param rereference (one error) |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_node, root_symbol, "m"); |
| EXPECT_EQ(m_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(m_node_info.file_origin, &src); |
| EXPECT_EQ(m_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_param, m_node, "N"); |
| EXPECT_EQ(n_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(n_param_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(p_param, m_node, "P"); |
| EXPECT_EQ(p_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(p_param_info.declared_type.user_defined_type, |
| nullptr); // types are primitive |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(rr_node, root_symbol, "rr"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(m_inst_node, rr_node, "m_inst"); |
| |
| const auto ref_map(rr_node_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(m_type_ref, ref_map, "m"); |
| |
| const ReferenceComponentNode& m_type_ref_root(*m_type_ref->components); |
| ASSERT_EQ(m_type_ref_root.Children().size(), 2); |
| const ReferenceComponentMap param_refs( |
| ReferenceComponentNodeMapView(m_type_ref_root)); |
| |
| ASSIGN_MUST_FIND(n_ref, param_refs, "N"); |
| const ReferenceComponent& n_ref_comp(n_ref->Value()); |
| EXPECT_EQ(n_ref_comp.identifier, "N"); |
| EXPECT_EQ(n_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(n_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(n_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| ASSIGN_MUST_FIND(q_ref, param_refs, "Q"); |
| const ReferenceComponent& q_ref_comp(q_ref->Value()); |
| EXPECT_EQ(q_ref_comp.identifier, "Q"); |
| EXPECT_EQ(q_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(q_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(q_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| |
| // Expect only ".N" to resolve to formal parameters of "m". |
| EXPECT_EQ(n_ref_comp.resolved_symbol, &n_param); |
| EXPECT_EQ(q_ref_comp.resolved_symbol, nullptr); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, OneGlobalIntParameter) { |
| TestVerilogSourceFile src("foobar.sv", "localparam int mint = 1;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(mint_param, root_symbol, "mint"); |
| EXPECT_EQ(mint_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(mint_param_info.file_origin, &src); |
| ASSERT_NE(mint_param_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*mint_param_info.declared_type.syntax_origin), |
| "int"); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, OneGlobalUndefinedTypeParameter) { |
| TestVerilogSourceFile src("foobar.sv", "localparam foo_t gun = 1;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(gun_param, root_symbol, "gun"); |
| EXPECT_EQ(gun_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(gun_param_info.file_origin, &src); |
| ASSERT_NE(gun_param_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*gun_param_info.declared_type.syntax_origin), |
| "foo_t"); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err_status, resolve_diagnostics); |
| EXPECT_EQ(err_status.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT(err_status.message(), |
| HasSubstr("Unable to resolve symbol \"foo_t\"")); |
| EXPECT_EQ( |
| gun_param_info.declared_type.user_defined_type->Value().resolved_symbol, |
| nullptr); // not resolved |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ReferenceOneParameterExpression) { |
| TestVerilogSourceFile src("foobar.sv", |
| "localparam int mint = 1;\n" |
| "localparam int tea = mint;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(tea, root_symbol, "tea"); |
| EXPECT_EQ(tea_info.metatype, SymbolMetaType::kParameter); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(mint, root_symbol, "mint"); |
| EXPECT_EQ(mint_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(mint_info.file_origin, &src); |
| ASSERT_NE(mint_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol(*mint_info.declared_type.syntax_origin), |
| "int"); |
| |
| // There should be one reference: "mint" (line 2) |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(ref, ref_map, "mint"); |
| const ReferenceComponent& ref_comp(ref->components->Value()); |
| EXPECT_TRUE(is_leaf(*ref->components)); |
| EXPECT_EQ(ref_comp.identifier, "mint"); |
| EXPECT_EQ(ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref_comp.resolved_symbol, |
| nullptr); // have not tried to resolve yet |
| |
| { // resolve symbols |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(ref_comp.resolved_symbol, &mint); // resolved |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, OneUnresolvedReferenceInExpression) { |
| TestVerilogSourceFile src("foobar.sv", "localparam int mint = spice;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(mint, root_symbol, "mint"); |
| EXPECT_EQ(mint_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(mint_info.file_origin, &src); |
| ASSERT_NE(mint_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol(*mint_info.declared_type.syntax_origin), |
| "int"); |
| |
| // There should be one reference: "spice" (line 2) |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(ref, ref_map, "spice"); |
| const ReferenceComponent& ref_comp(ref->components->Value()); |
| EXPECT_TRUE(is_leaf(*ref->components)); |
| EXPECT_EQ(ref_comp.identifier, "spice"); |
| EXPECT_EQ(ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref_comp.resolved_symbol, |
| nullptr); // have not tried to resolve yet |
| |
| { // resolve symbols |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err_status, resolve_diagnostics); |
| EXPECT_EQ(err_status.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT(err_status.message(), |
| HasSubstr("Unable to resolve symbol \"spice\"")); |
| EXPECT_EQ(ref_comp.resolved_symbol, nullptr); // still resolved |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, PackageDeclarationSingle) { |
| TestVerilogSourceFile src("foobar.sv", "package my_pkg;\nendpackage\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(my_pkg, root_symbol, "my_pkg"); |
| EXPECT_EQ(my_pkg_info.metatype, SymbolMetaType::kPackage); |
| EXPECT_EQ(my_pkg_info.file_origin, &src); |
| EXPECT_EQ(my_pkg_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ReferenceOneParameterFromPackageToRoot) { |
| TestVerilogSourceFile src("foobar.sv", |
| "localparam int mint = 1;\n" |
| "package p;\n" |
| "localparam int tea = mint;\n" // reference |
| "endpackage\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(p_pkg, root_symbol, "p"); |
| EXPECT_EQ(p_pkg_info.metatype, SymbolMetaType::kPackage); |
| |
| ASSERT_EQ(p_pkg_info.local_references_to_bind.size(), 1); |
| const auto ref_map(p_pkg_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(ref, ref_map, "mint"); |
| const ReferenceComponent& mint_ref(ref->components->Value()); |
| EXPECT_EQ(mint_ref.identifier, "mint"); |
| EXPECT_EQ(mint_ref.resolved_symbol, nullptr); // not yet resolved |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(tea, p_pkg, "tea"); // p::tea |
| EXPECT_EQ(tea_info.metatype, SymbolMetaType::kParameter); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(mint, root_symbol, "mint"); |
| EXPECT_EQ(mint_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(mint_info.file_origin, &src); |
| ASSERT_NE(mint_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol(*mint_info.declared_type.syntax_origin), |
| "int"); |
| |
| { // resolve symbols |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(mint_ref.resolved_symbol, &mint); // resolved "mint" |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ReferenceOneParameterFromRootToPackage) { |
| TestVerilogSourceFile src( |
| "foobar.sv", |
| "package p;\n" |
| "localparam int mint = 1;\n" |
| "endpackage\n" |
| "localparam int tea = p::mint;\n" // qualified reference |
| ); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(p_pkg, root_symbol, "p"); |
| EXPECT_EQ(p_pkg_info.metatype, SymbolMetaType::kPackage); |
| |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| // p_mint_ref is the reference chain for "p::mint". |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(p_mint_ref, ref_map, "p"); |
| const ReferenceComponent& p_ref(p_mint_ref->components->Value()); |
| EXPECT_EQ(p_ref.identifier, "p"); |
| EXPECT_EQ(p_ref.resolved_symbol, nullptr); // not yet resolved |
| const ReferenceComponent& mint_ref(p_mint_ref->LastLeaf()->Value()); |
| EXPECT_EQ(mint_ref.identifier, "mint"); |
| EXPECT_EQ(mint_ref.resolved_symbol, nullptr); // not yet resolved |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(tea, root_symbol, "tea"); |
| EXPECT_EQ(tea_info.metatype, SymbolMetaType::kParameter); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(mint, p_pkg, "mint"); // p::mint |
| EXPECT_EQ(mint_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(mint_info.file_origin, &src); |
| ASSERT_NE(mint_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol(*mint_info.declared_type.syntax_origin), |
| "int"); |
| |
| { // resolve symbols |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(p_ref.resolved_symbol, &p_pkg); // resolved "p" |
| EXPECT_EQ(mint_ref.resolved_symbol, &mint); // resolved "p::mint" |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ReferenceOneParameterFromRootToPackageNoSuchMember) { |
| TestVerilogSourceFile src("foobar.sv", |
| "package p;\n" |
| "localparam int mint = 1;\n" |
| "endpackage\n" |
| "localparam int tea = p::zzz;\n" // expect fail |
| ); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(p_pkg, root_symbol, "p"); |
| EXPECT_EQ(p_pkg_info.metatype, SymbolMetaType::kPackage); |
| |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| // p_mint_ref is the reference chain for "p::mint". |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(p_mint_ref, ref_map, "p"); |
| const ReferenceComponent& p_ref(p_mint_ref->components->Value()); |
| EXPECT_EQ(p_ref.identifier, "p"); |
| EXPECT_EQ(p_ref.resolved_symbol, nullptr); // not yet resolved |
| const ReferenceComponent& zzz_ref(p_mint_ref->LastLeaf()->Value()); |
| EXPECT_EQ(zzz_ref.identifier, "zzz"); |
| EXPECT_EQ(zzz_ref.resolved_symbol, nullptr); // not yet resolved |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(tea, root_symbol, "tea"); |
| EXPECT_EQ(tea_info.metatype, SymbolMetaType::kParameter); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(mint, p_pkg, "mint"); |
| EXPECT_EQ(mint_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(mint_info.file_origin, &src); |
| ASSERT_NE(mint_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol(*mint_info.declared_type.syntax_origin), |
| "int"); |
| |
| // resolving twice should not change results |
| for (int i = 0; i < 2; ++i) { // resolve symbols |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(err_status, resolve_diagnostics); |
| EXPECT_EQ(err_status.code(), absl::StatusCode::kNotFound); |
| EXPECT_EQ(p_ref.resolved_symbol, &p_pkg); // resolved "p" |
| EXPECT_EQ(zzz_ref.resolved_symbol, nullptr); // unresolved "p::zzz" |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationWithParameters) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m #(\n" |
| " int W = 2,\n" |
| " bar B = W\n" |
| ");\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_node, root_symbol, "m"); |
| EXPECT_EQ(module_node_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_node_info.file_origin, &src); |
| EXPECT_EQ(module_node_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(w_param, module_node, "W"); |
| EXPECT_EQ(w_param_info.metatype, SymbolMetaType::kParameter); |
| const ReferenceComponentNode* w_type_ref = |
| w_param_info.declared_type.user_defined_type; |
| EXPECT_EQ(w_type_ref, nullptr); // int is primitive type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(b_param, module_node, "B"); |
| EXPECT_EQ(b_param_info.metatype, SymbolMetaType::kParameter); |
| const ReferenceComponentNode* b_type_ref = |
| b_param_info.declared_type.user_defined_type; |
| ASSERT_NE(b_type_ref, nullptr); |
| const ReferenceComponent& b_type_ref_comp(b_type_ref->Value()); |
| EXPECT_EQ(b_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(b_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(b_type_ref_comp.identifier, "bar"); |
| |
| ASSERT_EQ(module_node_info.local_references_to_bind.size(), 2); |
| const auto ref_map(module_node_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(w_ref, ref_map, "W"); |
| const ReferenceComponent& w_ref_comp(w_ref->components->Value()); |
| EXPECT_EQ(w_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(w_ref_comp.identifier, "W"); |
| EXPECT_EQ(w_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(bar_ref, ref_map, "bar"); |
| const ReferenceComponent& bar_ref_comp(bar_ref->components->Value()); |
| EXPECT_EQ(bar_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(bar_ref_comp.identifier, "bar"); |
| EXPECT_EQ(bar_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(error, resolve_diagnostics); |
| // type reference 'bar' is unresolved |
| EXPECT_EQ(error.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT(error.message(), HasSubstr("Unable to resolve symbol \"bar\"")); |
| |
| EXPECT_EQ(w_ref_comp.resolved_symbol, &w_param); // resolved successfully |
| EXPECT_EQ(bar_ref_comp.resolved_symbol, nullptr); // failed to resolve |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleDeclarationLocalsDependOnParameter) { |
| TestVerilogSourceFile src("foobar.sv", |
| "module m #(\n" |
| " parameter int N = 2\n" |
| ") (\n" |
| " input logic [N-1:0] ins,\n" // ref |
| " output reg [0:N-1] outs\n" // ref |
| ");\n" |
| " wire [N][N] arr[N][N];\n" // 4 refs |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_m, root_symbol, "m"); |
| EXPECT_EQ(module_m_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_m_info.file_origin, &src); |
| EXPECT_EQ(module_m_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_param, module_m, "N"); |
| EXPECT_EQ(n_param_info.metatype, SymbolMetaType::kParameter); |
| const ReferenceComponentNode* n_type_ref = |
| n_param_info.declared_type.user_defined_type; |
| EXPECT_EQ(n_type_ref, nullptr); // int is primitive type |
| |
| EXPECT_EQ(module_m_info.local_references_to_bind.size(), 6); |
| const auto ref_map(module_m_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(n_refs, ref_map, "N"); |
| ASSERT_EQ(n_refs.size(), 6); // all references to "N" parameter |
| for (const auto& n_ref : n_refs) { |
| const ReferenceComponent& n_ref_comp(n_ref->components->Value()); |
| EXPECT_EQ(n_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(n_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(n_ref_comp.identifier, "N"); |
| EXPECT_EQ(n_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // All references to "N" resolved. |
| for (const auto& n_ref : n_refs) { |
| const ReferenceComponent& n_ref_comp(n_ref->components->Value()); |
| EXPECT_EQ(n_ref_comp.resolved_symbol, &n_param); // resolved successfully |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleSingleImplicitDeclaration) { |
| TestVerilogSourceFile src("foo.sv", |
| "module m;" |
| "assign a = 1'b0;" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_m, root_symbol, "m"); |
| EXPECT_EQ(module_m_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_m_info.file_origin, &src); |
| EXPECT_EQ(module_m_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(a_variable, module_m, "a"); |
| EXPECT_EQ(a_variable_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* a_type_ref = |
| a_variable_info.declared_type.user_defined_type; |
| EXPECT_EQ(a_type_ref, nullptr); // implicit type is primitive type |
| EXPECT_TRUE(a_variable_info.declared_type.implicit); |
| |
| EXPECT_EQ(module_m_info.local_references_to_bind.size(), 1); |
| const auto ref_map(module_m_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(a_refs, ref_map, "a"); |
| ASSERT_EQ(a_refs.size(), 1); // all references to "a" parameter |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, &a_variable); // pre-resolved |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| // Resolve mustn't break anything |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // All references to "a" resolved. |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, |
| &a_variable); // resolved successfully |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleReferenceToImplicitDeclaration) { |
| TestVerilogSourceFile src("foo.sv", |
| "module m;" |
| "assign a = 1'b0;" |
| "assign a = 1'b1;" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_m, root_symbol, "m"); |
| EXPECT_EQ(module_m_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_m_info.file_origin, &src); |
| EXPECT_EQ(module_m_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(a_variable, module_m, "a"); |
| EXPECT_EQ(a_variable_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* a_type_ref = |
| a_variable_info.declared_type.user_defined_type; |
| EXPECT_EQ(a_type_ref, nullptr); // implicit type is primitive type |
| EXPECT_TRUE(a_variable_info.declared_type.implicit); |
| |
| EXPECT_EQ(module_m_info.local_references_to_bind.size(), 2); |
| const auto ref_map(module_m_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(a_refs, ref_map, "a"); |
| ASSERT_EQ(a_refs.size(), 2); // all references to "a" parameter |
| { |
| const auto& a_ref = *a_refs.begin(); |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, &a_variable); // pre-resolved |
| } |
| { |
| const auto& a_ref = *std::next(a_refs.begin()); |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, nullptr); // pre-resolved |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // All references to "a" resolved. |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, |
| &a_variable); // resolved successfully |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleReferenceToImplicitDeclarationInSubScope) { |
| TestVerilogSourceFile src("foo.sv", |
| "module m;" |
| " assign a = 1'b0;" |
| " module n;" |
| " assign a = 1'b1;" |
| " endmodule;" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_m, root_symbol, "m"); |
| EXPECT_EQ(module_m_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_m_info.file_origin, &src); |
| EXPECT_EQ(module_m_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(a_variable, module_m, "a"); |
| EXPECT_EQ(a_variable_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* a_type_ref = |
| a_variable_info.declared_type.user_defined_type; |
| EXPECT_EQ(a_type_ref, nullptr); // implicit type is primitive type |
| EXPECT_TRUE(a_variable_info.declared_type.implicit); |
| |
| EXPECT_EQ(module_m_info.local_references_to_bind.size(), 1); |
| const auto ref_map(module_m_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(a_refs, ref_map, "a"); |
| ASSERT_EQ(a_refs.size(), 1); // all references to "a" parameter |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, &a_variable); // pre-resolved |
| } |
| |
| // Submodule "n" |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_n, module_m, "n"); |
| EXPECT_EQ(module_n_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_n_info.file_origin, &src); |
| EXPECT_EQ(module_n_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(module_n_info.local_references_to_bind.size(), 1); |
| const auto n_ref_map(module_n_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(n_a_refs, n_ref_map, "a"); |
| ASSERT_EQ(n_a_refs.size(), 1); // references to "a" net in "n" module |
| for (const auto& n_a_ref : n_a_refs) { |
| const ReferenceComponent& n_a_ref_comp(n_a_ref->components->Value()); |
| EXPECT_EQ(n_a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(n_a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(n_a_ref_comp.identifier, "a"); |
| EXPECT_EQ(n_a_ref_comp.resolved_symbol, |
| nullptr); // resolving only in same scope |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| // Resolve mustn't break anything |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // All references to "a" resolved. |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, |
| &a_variable); // resolved successfully |
| } |
| |
| for (const auto& n_a_ref : n_a_refs) { |
| const ReferenceComponent& n_a_ref_comp(n_a_ref->components->Value()); |
| EXPECT_EQ(n_a_ref_comp.resolved_symbol, |
| &a_variable); // resolved successfully |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleExplicitDeclarationInSubScope) { |
| TestVerilogSourceFile src("foo.sv", |
| "module m;" |
| " assign a = 1'b0;" |
| " module n;" |
| " wire a;" |
| " assign a = 1'b1;" |
| " endmodule;" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_m, root_symbol, "m"); |
| EXPECT_EQ(module_m_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_m_info.file_origin, &src); |
| EXPECT_EQ(module_m_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(a_variable, module_m, "a"); |
| EXPECT_EQ(a_variable_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* a_type_ref = |
| a_variable_info.declared_type.user_defined_type; |
| EXPECT_EQ(a_type_ref, nullptr); // implicit type is primitive type |
| EXPECT_TRUE(a_variable_info.declared_type.implicit); |
| |
| EXPECT_EQ(module_m_info.local_references_to_bind.size(), 1); |
| const auto ref_map(module_m_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(a_refs, ref_map, "a"); |
| ASSERT_EQ(a_refs.size(), 1); // all references to "a" parameter |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, &a_variable); // pre-resolved |
| } |
| |
| // Submodule "n" |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_n, module_m, "n"); |
| EXPECT_EQ(module_n_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_n_info.file_origin, &src); |
| EXPECT_EQ(module_n_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_a_variable, module_n, "a"); |
| EXPECT_EQ(n_a_variable_info.metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* n_a_type_ref = |
| n_a_variable_info.declared_type.user_defined_type; |
| EXPECT_EQ(n_a_type_ref, nullptr); |
| EXPECT_FALSE(n_a_variable_info.declared_type.implicit); |
| |
| EXPECT_EQ(module_n_info.local_references_to_bind.size(), 1); |
| const auto n_ref_map(module_n_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(n_a_refs, n_ref_map, "a"); |
| ASSERT_EQ(n_a_refs.size(), 1); // references to "a" net in "n" module |
| for (const auto& n_a_ref : n_a_refs) { |
| const ReferenceComponent& n_a_ref_comp(n_a_ref->components->Value()); |
| EXPECT_EQ(n_a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(n_a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(n_a_ref_comp.identifier, "a"); |
| EXPECT_EQ(n_a_ref_comp.resolved_symbol, |
| nullptr); // resolving only in same scope |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| // Resolve mustn't break anything |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // All references to "a" resolved. |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, |
| &a_variable); // resolved successfully |
| } |
| |
| for (const auto& n_a_ref : n_a_refs) { |
| const ReferenceComponent& n_a_ref_comp(n_a_ref->components->Value()); |
| EXPECT_EQ(n_a_ref_comp.resolved_symbol, |
| &n_a_variable); // resolved successfully |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleExplicitAndImplicitDeclarations) { |
| TestVerilogSourceFile src("foo.sv", |
| "module m;" |
| "wire b;" |
| "assign a = 1'b0;" |
| "assign b = 1'b1;" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_m, root_symbol, "m"); |
| EXPECT_EQ(module_m_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_m_info.file_origin, &src); |
| EXPECT_EQ(module_m_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(a_variable, module_m, "a"); |
| EXPECT_EQ(a_variable_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* a_type_ref = |
| a_variable_info.declared_type.user_defined_type; |
| EXPECT_EQ(a_type_ref, nullptr); // implicit type is primitive type |
| EXPECT_TRUE(a_variable_info.declared_type.implicit); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(b_variable, module_m, "b"); |
| EXPECT_EQ(b_variable_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* b_type_ref = |
| b_variable_info.declared_type.user_defined_type; |
| EXPECT_EQ(b_type_ref, nullptr); |
| EXPECT_FALSE(b_variable_info.declared_type.implicit); |
| |
| EXPECT_EQ(module_m_info.local_references_to_bind.size(), 2); |
| const auto ref_map(module_m_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(a_refs, ref_map, "a"); |
| ASSERT_EQ(a_refs.size(), 1); // all references to "a" parameter |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(a_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, &a_variable); // pre-resolved |
| } |
| |
| ASSIGN_MUST_FIND(b_refs, ref_map, "b"); |
| ASSERT_EQ(b_refs.size(), 1); |
| for (const auto& b_ref : b_refs) { |
| const ReferenceComponent& b_ref_comp(b_ref->components->Value()); |
| EXPECT_EQ(b_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(b_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(b_ref_comp.identifier, "b"); |
| EXPECT_EQ(b_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| // Resolve mustn't break anything |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // All references to "a" resolved. |
| for (const auto& a_ref : a_refs) { |
| const ReferenceComponent& a_ref_comp(a_ref->components->Value()); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, |
| &a_variable); // resolved successfully |
| } |
| |
| // All references to "b" resolved. |
| for (const auto& b_ref : b_refs) { |
| const ReferenceComponent& b_ref_comp(b_ref->components->Value()); |
| EXPECT_EQ(b_ref_comp.resolved_symbol, |
| &b_variable); // resolved successfully |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleImplicitRedeclared) { |
| TestVerilogSourceFile src("foo.sv", |
| "module m;\n" |
| "assign a = 1'b0;\n" |
| "wire a;\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EQ(build_diagnostics.size(), 1); |
| EXPECT_FALSE(build_diagnostics.front().ok()); |
| EXPECT_EQ(build_diagnostics.front().message(), |
| "foo.sv:3:6: Symbol \"a\" is already defined in the $root::m scope " |
| "at 2:8:"); |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationSingle) { |
| TestVerilogSourceFile src("foobar.sv", "class ccc;\nendclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ccc, root_symbol, "ccc"); |
| EXPECT_EQ(ccc_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(ccc_info.file_origin, &src); |
| EXPECT_EQ(ccc_info.declared_type.syntax_origin, |
| nullptr); // there is no module meta-type |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationNested) { |
| TestVerilogSourceFile src("foobar.sv", |
| "package pp;\n" |
| " class c_outer;\n" |
| " class c_inner;\n" |
| " endclass\n" |
| " endclass\n" |
| "endpackage\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| EXPECT_EQ(pp_info.metatype, SymbolMetaType::kPackage); |
| EXPECT_EQ(pp_info.file_origin, &src); |
| EXPECT_EQ(pp_info.declared_type.syntax_origin, |
| nullptr); // there is no package meta-type |
| { |
| MUST_ASSIGN_LOOKUP_SYMBOL(c_outer, pp, "c_outer"); |
| EXPECT_EQ(c_outer_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(c_outer_info.file_origin, &src); |
| EXPECT_EQ(c_outer_info.declared_type.syntax_origin, |
| nullptr); // there is no class meta-type |
| { |
| MUST_ASSIGN_LOOKUP_SYMBOL(c_inner, c_outer, "c_inner"); |
| EXPECT_EQ(c_inner_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(c_inner_info.file_origin, &src); |
| EXPECT_EQ(c_inner_info.declared_type.syntax_origin, |
| nullptr); // there is no class meta-type |
| } |
| } |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); // nothing to resolve |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationWithParameter) { |
| TestVerilogSourceFile src("foobar.sv", |
| "class cc #(\n" |
| " int N = 2\n" |
| ");\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(class_cc_info.file_origin, &src); |
| EXPECT_EQ(class_cc_info.declared_type.syntax_origin, |
| nullptr); // there is no class meta-type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(n_param, class_cc, "N"); |
| EXPECT_EQ(n_param_info.metatype, SymbolMetaType::kParameter); |
| const ReferenceComponentNode* n_type_ref = |
| n_param_info.declared_type.user_defined_type; |
| EXPECT_EQ(n_type_ref, nullptr); // int is primitive type |
| |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationDataMember) { |
| TestVerilogSourceFile src("member_accessor.sv", |
| "class cc;\n" |
| " int size;\n" |
| " int count = 0;\n" // with initializer |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(class_cc_info.file_origin, &src); |
| EXPECT_EQ(class_cc_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(size_field, class_cc, "size"); |
| EXPECT_EQ(size_field_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* size_type_ref = |
| size_field_info.declared_type.user_defined_type; |
| EXPECT_EQ(size_type_ref, nullptr); // int is primitive type |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*size_field_info.declared_type.syntax_origin), |
| "int"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(count_field, class_cc, "count"); |
| EXPECT_EQ(count_field_info.metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* count_type_ref = |
| count_field_info.declared_type.user_defined_type; |
| EXPECT_EQ(count_type_ref, nullptr); // int is primitive type |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *count_field_info.declared_type.syntax_origin), |
| "int"); |
| |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| |
| { // No references. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationDataMemberMultiDeclaration) { |
| TestVerilogSourceFile src("member_accessor.sv", |
| "class cc;\n" |
| " real height, width;\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(class_cc_info.file_origin, &src); |
| EXPECT_EQ(class_cc_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(height_field, class_cc, "height"); |
| EXPECT_EQ(height_field_info.metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* height_type_ref = |
| height_field_info.declared_type.user_defined_type; |
| EXPECT_EQ(height_type_ref, nullptr); // int is primitive type |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *height_field_info.declared_type.syntax_origin), |
| "real"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(width_field, class_cc, "width"); |
| EXPECT_EQ(width_field_info.metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* width_type_ref = |
| width_field_info.declared_type.user_defined_type; |
| EXPECT_EQ(width_type_ref, nullptr); // int is primitive type |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *width_field_info.declared_type.syntax_origin), |
| "real"); |
| |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| |
| { // No references. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationDataMemberAccessedFromMethod) { |
| TestVerilogSourceFile src("member_accessor.sv", |
| "class cc;\n" |
| " int size;\n" |
| " function int get_size();\n" |
| " return size;\n" |
| " endfunction\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(class_cc_info.file_origin, &src); |
| EXPECT_EQ(class_cc_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(size_field, class_cc, "size"); |
| EXPECT_EQ(size_field_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* size_type_ref = |
| size_field_info.declared_type.user_defined_type; |
| EXPECT_EQ(size_type_ref, nullptr); // int is primitive type |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*size_field_info.declared_type.syntax_origin), |
| "int"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_size, class_cc, "get_size"); |
| EXPECT_EQ(get_size_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(get_size_info.file_origin, &src); |
| const auto ref_map(get_size_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(size_ref, ref_map, "size"); |
| const ReferenceComponent& size_ref_comp(size_ref->components->Value()); |
| EXPECT_EQ(size_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(size_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(size_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // "size" resolved to class data member |
| EXPECT_EQ(size_ref_comp.resolved_symbol, &size_field); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDataMemberAccessedDirectly) { |
| TestVerilogSourceFile src("member_accessor.sv", |
| "class cc;\n" |
| " int size;\n" |
| "endclass\n" |
| "function int get_size();\n" |
| " cc cc_data;\n" |
| " return cc_data.size;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(class_cc_info.file_origin, &src); |
| EXPECT_EQ(class_cc_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(size_field, class_cc, "size"); |
| EXPECT_EQ(size_field_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| const ReferenceComponentNode* size_type_ref = |
| size_field_info.declared_type.user_defined_type; |
| EXPECT_EQ(size_type_ref, nullptr); // int is primitive type |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*size_field_info.declared_type.syntax_origin), |
| "int"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_size, root_symbol, "get_size"); |
| EXPECT_EQ(get_size_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(get_size_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_data, get_size, "cc_data"); |
| EXPECT_EQ(cc_data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| |
| const auto ref_map(get_size_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_data_ref, ref_map, "cc_data"); |
| const ReferenceComponent& cc_data_ref_comp(cc_data_ref->components->Value()); |
| EXPECT_EQ(cc_data_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_data_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_data_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(cc_data_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& size_ref( |
| cc_data_ref->components->Children().front()); |
| const ReferenceComponent& size_ref_comp(size_ref.Value()); |
| EXPECT_EQ(size_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(size_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(size_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // "size" resolved to class data member |
| EXPECT_EQ(size_ref_comp.resolved_symbol, &size_field); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationSingleInheritance) { |
| TestVerilogSourceFile src("member_accessor.sv", |
| "class base;\n" |
| "endclass\n" |
| "class derived extends base;\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, root_symbol, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| // "base" is referenced from the scope that contains "derived" |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(base_ref, ref_map, "base"); |
| const ReferenceComponent& base_ref_comp(base_ref->components->Value()); |
| EXPECT_EQ(base_ref_comp.identifier, "base"); |
| EXPECT_EQ(base_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(base_ref_comp.required_metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "base" reference is linked from the "derived" class. |
| ASSERT_EQ( |
| derived_class_info.parent_type.user_defined_type, |
| root_symbol.Value().local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "base" type reference to the "base" class. |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationSingleInheritanceAcrossPackage) { |
| TestVerilogSourceFile src("member_accessor.sv", |
| "package pp;\n" |
| " class base;\n" |
| " endclass\n" |
| "endpackage\n" |
| "class derived extends pp::base;\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_pp, root_symbol, "pp"); |
| EXPECT_EQ(package_pp_info.metatype, SymbolMetaType::kPackage); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, package_pp, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| // "pp::base" is referenced from the scope that contains "derived" |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_ref, ref_map, "pp"); |
| const ReferenceComponent& pp_ref_comp(pp_ref->components->Value()); |
| EXPECT_EQ(pp_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(pp_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& base_ref( |
| pp_ref->components->Children().front()); |
| const ReferenceComponent& base_ref_comp(base_ref.Value()); |
| EXPECT_EQ(base_ref_comp.identifier, "base"); |
| EXPECT_EQ(base_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(base_ref_comp.required_metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "pp::base" reference is linked from the "derived" class. |
| ASSERT_EQ( |
| derived_class_info.parent_type.user_defined_type, |
| root_symbol.Value().local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "pp::base" type reference to the "pp::base" class. |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, &package_pp); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, &base_class); |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationSingleInheritancePackageToPackage) { |
| TestVerilogSourceFile src("member_accessor.sv", |
| "package pp;\n" |
| " class base;\n" |
| " endclass\n" |
| "endpackage\n" |
| "package qq;\n" |
| " class derived extends pp::base;\n" |
| " endclass\n" |
| "endpackage\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_pp, root_symbol, "pp"); |
| EXPECT_EQ(package_pp_info.metatype, SymbolMetaType::kPackage); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, package_pp, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_qq, root_symbol, "qq"); |
| EXPECT_EQ(package_qq_info.metatype, SymbolMetaType::kPackage); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, package_qq, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| // "pp::base" is referenced from the scope that contains "derived", |
| // which is package "qq". |
| EXPECT_EQ(package_qq_info.local_references_to_bind.size(), 1); |
| const auto ref_map(package_qq_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_ref, ref_map, "pp"); |
| const ReferenceComponent& pp_ref_comp(pp_ref->components->Value()); |
| EXPECT_EQ(pp_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(pp_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& base_ref( |
| pp_ref->components->Children().front()); |
| const ReferenceComponent& base_ref_comp(base_ref.Value()); |
| EXPECT_EQ(base_ref_comp.identifier, "base"); |
| EXPECT_EQ(base_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(base_ref_comp.required_metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "pp::base" reference is linked from the "qq::derived" class. |
| ASSERT_EQ( |
| derived_class_info.parent_type.user_defined_type, |
| package_qq_info.local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "pp::base" type reference to the "pp::base" class. |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, &package_pp); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, &base_class); |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationInheritanceFromNestedClass) { |
| TestVerilogSourceFile src("classilicious.sv", |
| "class pp;\n" |
| " class base;\n" |
| " endclass\n" |
| "endclass\n" |
| "class qq;\n" |
| " class derived extends pp::base;\n" |
| " endclass\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_pp, root_symbol, "pp"); |
| EXPECT_EQ(class_pp_info.metatype, SymbolMetaType::kClass); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, class_pp, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_qq, root_symbol, "qq"); |
| EXPECT_EQ(class_qq_info.metatype, SymbolMetaType::kClass); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, class_qq, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| // "pp::base" is referenced from the scope that contains "derived", |
| // which is package "qq". |
| EXPECT_EQ(class_qq_info.local_references_to_bind.size(), 1); |
| const auto ref_map(class_qq_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_ref, ref_map, "pp"); |
| const ReferenceComponent& pp_ref_comp(pp_ref->components->Value()); |
| EXPECT_EQ(pp_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(pp_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& base_ref( |
| pp_ref->components->Children().front()); |
| const ReferenceComponent& base_ref_comp(base_ref.Value()); |
| EXPECT_EQ(base_ref_comp.identifier, "base"); |
| EXPECT_EQ(base_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(base_ref_comp.required_metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "pp::base" reference is linked from the "qq::derived" class. |
| ASSERT_EQ(derived_class_info.parent_type.user_defined_type, |
| class_qq_info.local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "pp::base" type reference to the "pp::base" class. |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, &class_pp); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, &base_class); |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationInLineConstructorDefinition) { |
| TestVerilogSourceFile src("ctor.sv", |
| "class C;\n" |
| " function new();\n" |
| " endfunction\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_c, root_symbol, "C"); |
| EXPECT_EQ(class_c_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(class_c_info.file_origin, &src); |
| EXPECT_EQ(class_c_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ctor, class_c, "new"); |
| EXPECT_EQ(ctor_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(ctor_info.file_origin, &src); |
| EXPECT_NE(ctor_info.syntax_origin, nullptr); |
| EXPECT_NE(ctor_info.declared_type.syntax_origin, nullptr); // points to "new" |
| // constructor is already known to "return" its class type |
| EXPECT_EQ(ctor_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &class_c); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationOutOfLineConstructorDefinition) { |
| TestVerilogSourceFile src("ctor.sv", |
| "class C;\n" |
| " extern function new;\n" |
| "endclass\n" |
| "function C::new ();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_c, root_symbol, "C"); |
| EXPECT_EQ(class_c_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(class_c_info.file_origin, &src); |
| EXPECT_EQ(class_c_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ctor, class_c, "new"); |
| EXPECT_EQ(ctor_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(ctor_info.file_origin, &src); |
| EXPECT_NE(ctor_info.syntax_origin, nullptr); |
| EXPECT_NE(ctor_info.declared_type.syntax_origin, nullptr); // points to "new" |
| // constructor is already known to "return" its class type |
| EXPECT_EQ(ctor_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &class_c); |
| |
| // Expect a "C::new" reference from the out-of-line definition. |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(class_c_ref, ref_map, "C"); |
| const ReferenceComponent& c_ref_comp(class_c_ref->components->Value()); |
| EXPECT_EQ(c_ref_comp.identifier, "C"); |
| EXPECT_EQ(c_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(c_ref_comp.required_metatype, SymbolMetaType::kClass); |
| // out-of-line class and method reference must be resolved at build-time |
| EXPECT_NE(c_ref_comp.resolved_symbol, nullptr); |
| const ReferenceComponent& ctor_ref_comp(class_c_ref->LastLeaf()->Value()); |
| EXPECT_EQ(ctor_ref_comp.identifier, "new"); |
| EXPECT_EQ(ctor_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(ctor_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_NE(ctor_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(c_ref_comp.resolved_symbol, &class_c); // class C |
| EXPECT_EQ(ctor_ref_comp.resolved_symbol, &ctor); // function C::new |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationReferenceInheritedMemberFromMethod) { |
| TestVerilogSourceFile src("member_from_parent.sv", |
| "class base;\n" |
| " int count;\n" |
| "endclass\n" |
| "class derived extends base;\n" |
| " function int get_count();\n" |
| " return count;\n" |
| " endfunction\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, root_symbol, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_count, base_class, "count"); |
| EXPECT_EQ(int_count_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_count_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, derived_class, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_EQ(get_count_info.local_references_to_bind.size(), 1); |
| |
| // "base::count" is referenced from the "derived::get_count" method |
| EXPECT_EQ(get_count_info.local_references_to_bind.size(), 1); |
| const auto ref_map(get_count_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(count_ref, ref_map, "count"); |
| const ReferenceComponent& count_ref_comp(count_ref->components->Value()); |
| EXPECT_EQ(count_ref_comp.identifier, "count"); |
| EXPECT_EQ(count_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(count_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(count_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "base" reference is linked from the "derived" class. |
| ASSERT_EQ( |
| derived_class_info.parent_type.user_defined_type, |
| root_symbol.Value().local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "base" type reference to the "base" class. |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| // "count" in "get_count" resolved to "base::count" |
| EXPECT_EQ(count_ref_comp.resolved_symbol, &int_count); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationReferenceGrandparentMember) { |
| TestVerilogSourceFile src("member_from_parent.sv", |
| "class base;\n" |
| " int count;\n" |
| "endclass\n" |
| "class derived extends base;\n" |
| "endclass\n" |
| "class more_derived extends derived;\n" |
| " function int get_count();\n" |
| " return count;\n" |
| " endfunction\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, root_symbol, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_count, base_class, "count"); |
| EXPECT_EQ(int_count_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_count_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(more_derived_class, root_symbol, "more_derived"); |
| EXPECT_EQ(more_derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(more_derived_class_info.file_origin, &src); |
| EXPECT_EQ(more_derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(more_derived_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, more_derived_class, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_EQ(get_count_info.local_references_to_bind.size(), 1); |
| |
| // "base::count" is referenced from the "more_derived::get_count" method |
| EXPECT_EQ(get_count_info.local_references_to_bind.size(), 1); |
| const auto ref_map(get_count_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(count_ref, ref_map, "count"); |
| const ReferenceComponent& count_ref_comp(count_ref->components->Value()); |
| EXPECT_EQ(count_ref_comp.identifier, "count"); |
| EXPECT_EQ(count_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(count_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(count_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "base" reference is linked from the "derived" class. |
| // Make sure the "derived" reference is linked from the "more_derived" class. |
| const auto root_refs = root_symbol.Value().LocalReferencesMapViewForTesting(); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(base_ref, root_refs, "base"); |
| const ReferenceComponent& base_ref_comp(base_ref->components->Value()); |
| EXPECT_EQ(base_ref_comp.identifier, "base"); |
| EXPECT_EQ(base_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(base_ref_comp.required_metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(derived_ref, root_refs, "derived"); |
| const ReferenceComponent& derived_ref_comp(derived_ref->components->Value()); |
| EXPECT_EQ(derived_ref_comp.identifier, "derived"); |
| EXPECT_EQ(derived_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(derived_ref_comp.required_metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type, |
| base_ref->LastTypeComponent()); |
| EXPECT_EQ(more_derived_class_info.parent_type.user_defined_type, |
| derived_ref->LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "base" and "derived" type references |
| EXPECT_EQ(base_ref_comp.resolved_symbol, &base_class); |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| EXPECT_EQ(derived_ref_comp.resolved_symbol, &derived_class); |
| EXPECT_EQ(more_derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &derived_class); |
| // "count" in "more_derived::get_count" resolved to "base::count" |
| EXPECT_EQ(count_ref_comp.resolved_symbol, &int_count); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, |
| ClassDeclarationReferenceInheritedMemberDirectAccess) { |
| TestVerilogSourceFile src("member_from_parent.sv", |
| "class base;\n" |
| " int count;\n" |
| "endclass\n" |
| "class derived extends base;\n" |
| "endclass\n" |
| "function int get_count(derived dd);\n" |
| " return dd.count;\n" // direct member access |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, root_symbol, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_count, base_class, "count"); |
| EXPECT_EQ(int_count_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_count_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, root_symbol, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| // references "derived" as a type and "dd" as an argument |
| ASSERT_EQ(get_count_info.local_references_to_bind.size(), 2); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(dd_arg, get_count, "dd"); |
| EXPECT_EQ(dd_arg_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(dd_arg_info.declared_type.user_defined_type, nullptr); |
| EXPECT_EQ(dd_arg_info.declared_type.user_defined_type->Value().identifier, |
| "derived"); |
| EXPECT_EQ( |
| dd_arg_info.declared_type.user_defined_type->Value().resolved_symbol, |
| nullptr); |
| |
| // "base::count" is referenced from the "dd.count" |
| const auto ref_map(get_count_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(derived_type_ref, ref_map, "derived"); |
| const ReferenceComponent& derived_type_ref_comp( |
| derived_type_ref->components->Value()); |
| EXPECT_EQ(derived_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(derived_type_ref_comp.required_metatype, |
| SymbolMetaType::kUnspecified); |
| EXPECT_EQ(derived_type_ref_comp.identifier, "derived"); |
| EXPECT_EQ(derived_type_ref_comp.resolved_symbol, nullptr); |
| // Make sure "derived dd"'s type uses this type reference. |
| EXPECT_EQ(dd_arg_info.declared_type.user_defined_type, |
| derived_type_ref->components.get()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(dd_ref, ref_map, "dd"); |
| const ReferenceComponent& dd_ref_comp(dd_ref->components->Value()); |
| EXPECT_EQ(dd_ref_comp.identifier, "dd"); |
| EXPECT_EQ(dd_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(dd_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(dd_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(dd_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& dd_count_ref( |
| dd_ref->components->Children().front()); |
| const ReferenceComponent& dd_count_ref_comp(dd_count_ref.Value()); |
| EXPECT_EQ(dd_count_ref_comp.identifier, "count"); |
| EXPECT_EQ(dd_count_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(dd_count_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(dd_count_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "base" reference is linked from the "derived" class. |
| ASSERT_EQ( |
| derived_class_info.parent_type.user_defined_type, |
| root_symbol.Value().local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "base" type reference to the "base" class. |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| // "dd"'s type resolved to "derived" |
| EXPECT_EQ( |
| dd_arg_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &derived_class); |
| // "dd" references function parameter |
| EXPECT_EQ(dd_ref_comp.resolved_symbol, &dd_arg); |
| // "count" in "dd.count" resolved to "base::count" |
| EXPECT_EQ(dd_count_ref_comp.resolved_symbol, &int_count); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassDeclarationReferenceInheritedBaseClassMethod) { |
| TestVerilogSourceFile src("member_from_parent.sv", |
| "class base;\n" |
| " function int count();\n" |
| " endfunction\n" |
| "endclass\n" |
| "class derived extends base;\n" |
| " function int get_count();\n" |
| " return count();\n" |
| " endfunction\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, root_symbol, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_count, base_class, "count"); |
| EXPECT_EQ(int_count_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(int_count_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, derived_class, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_EQ(get_count_info.local_references_to_bind.size(), 1); |
| |
| // "base::count" is referenced from the "derived::get_count" method |
| EXPECT_EQ(get_count_info.local_references_to_bind.size(), 1); |
| const auto ref_map(get_count_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(count_ref, ref_map, "count"); |
| const ReferenceComponent& count_ref_comp(count_ref->components->Value()); |
| EXPECT_EQ(count_ref_comp.identifier, "count"); |
| EXPECT_EQ(count_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(count_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(count_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "base" reference is linked from the "derived" class. |
| ASSERT_EQ( |
| derived_class_info.parent_type.user_defined_type, |
| root_symbol.Value().local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "base" type reference to the "base" class. |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| // "count" in "get_count" resolved to "base::count" |
| EXPECT_EQ(count_ref_comp.resolved_symbol, &int_count); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, |
| ClassDeclarationReferenceInheritedBaseMethodFromObject) { |
| TestVerilogSourceFile src("member_from_parent.sv", |
| "class base;\n" |
| " function int count();\n" |
| " endfunction\n" |
| "endclass\n" |
| "class derived extends base;\n" |
| "endclass\n" |
| "function int get_count(derived dd);\n" |
| " return dd.count();\n" // method call |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, root_symbol, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| EXPECT_EQ(base_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(base_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_count, base_class, "count"); |
| EXPECT_EQ(int_count_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(int_count_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| EXPECT_EQ(derived_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(derived_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, root_symbol, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| // references "derived" as a type and "dd" as an argument |
| ASSERT_EQ(get_count_info.local_references_to_bind.size(), 2); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(dd_arg, get_count, "dd"); |
| EXPECT_EQ(dd_arg_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(dd_arg_info.declared_type.user_defined_type, nullptr); |
| EXPECT_EQ(dd_arg_info.declared_type.user_defined_type->Value().identifier, |
| "derived"); |
| EXPECT_EQ( |
| dd_arg_info.declared_type.user_defined_type->Value().resolved_symbol, |
| nullptr); |
| |
| // "base::count" is referenced from the "dd.count" |
| const auto ref_map(get_count_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(derived_type_ref, ref_map, "derived"); |
| const ReferenceComponent& derived_type_ref_comp( |
| derived_type_ref->components->Value()); |
| EXPECT_EQ(derived_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(derived_type_ref_comp.required_metatype, |
| SymbolMetaType::kUnspecified); |
| EXPECT_EQ(derived_type_ref_comp.identifier, "derived"); |
| EXPECT_EQ(derived_type_ref_comp.resolved_symbol, nullptr); |
| // Make sure "derived dd"'s type uses this type reference. |
| EXPECT_EQ(dd_arg_info.declared_type.user_defined_type, |
| derived_type_ref->components.get()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(dd_ref, ref_map, "dd"); |
| const ReferenceComponent& dd_ref_comp(dd_ref->components->Value()); |
| EXPECT_EQ(dd_ref_comp.identifier, "dd"); |
| EXPECT_EQ(dd_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(dd_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(dd_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(dd_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& dd_count_ref( |
| dd_ref->components->Children().front()); |
| const ReferenceComponent& dd_count_ref_comp(dd_count_ref.Value()); |
| EXPECT_EQ(dd_count_ref_comp.identifier, "count"); |
| EXPECT_EQ(dd_count_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(dd_count_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(dd_count_ref_comp.resolved_symbol, nullptr); |
| |
| // Make sure the "base" reference is linked from the "derived" class. |
| ASSERT_EQ( |
| derived_class_info.parent_type.user_defined_type, |
| root_symbol.Value().local_references_to_bind.front().LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve the "base" type reference to the "base" class. |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type->Value() |
| .resolved_symbol, |
| &base_class); |
| // "dd"'s type resolved to "derived" |
| EXPECT_EQ( |
| dd_arg_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &derived_class); |
| // "dd" references function parameter |
| EXPECT_EQ(dd_ref_comp.resolved_symbol, &dd_arg); |
| // "count()" in "dd.count()" resolved to "base::count()" |
| EXPECT_EQ(dd_count_ref_comp.resolved_symbol, &int_count); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypeParameterizedModuleDeclaration) { |
| TestVerilogSourceFile src("camelot_param_alot.sv", |
| "module mm #(parameter type T = bit);\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(mm_module, root_symbol, "mm"); |
| EXPECT_EQ(mm_module_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(mm_module_info.file_origin, &src); |
| EXPECT_EQ(mm_module_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(mm_module_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, mm_module, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| EXPECT_TRUE(root_symbol.Value().local_references_to_bind.empty()); |
| |
| { // No references. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypeParameterizedClassDataDeclarations) { |
| TestVerilogSourceFile src("i_push_the_param_alot.sv", |
| "class cc #(parameter type T = bit);\n" |
| "endclass\n" |
| "cc#(cc#(int)) data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, root_symbol, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| EXPECT_EQ(cc_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(cc_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, cc_class, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 2); |
| |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(cc_refs, ref_map, "cc"); |
| EXPECT_EQ(cc_refs.size(), 2); |
| |
| for (const auto& cc_ref : cc_refs) { |
| const ReferenceComponent& cc_ref_comp(cc_ref->components->Value()); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| // Of the two "cc" type refs, the outer one is the first one, by ordering of |
| // textual position among references that start with the same identifier. |
| const DependentReferences& data_cc_type(**cc_refs.begin()); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| data_cc_type.LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| for (const auto& cc_ref : cc_refs) { |
| const ReferenceComponent& cc_ref_comp(cc_ref->components->Value()); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &cc_class); |
| } |
| // type of "data" is resolved |
| EXPECT_EQ( |
| data_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &cc_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, |
| TypeParameterizedClassDataDeclarationsPackageQualifiedTwoParams) { |
| TestVerilogSourceFile src( |
| "i_eat_ham_and_jam_and_spam_alot.sv", |
| "package pp;\n" |
| " class cc #(\n" |
| " parameter type T1 = bit,\n" |
| " parameter type T2 = bit\n" |
| " );\n" |
| " endclass\n" |
| "endpackage\n" |
| "pp::cc#(pp::cc#(int, bit), pp::cc#(bit, int)) data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_package, root_symbol, "pp"); |
| EXPECT_EQ(pp_package_info.metatype, SymbolMetaType::kPackage); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, pp_package, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| EXPECT_EQ(cc_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(cc_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t1_type_param, cc_class, "T1"); |
| EXPECT_EQ(t1_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t1_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t2_type_param, cc_class, "T2"); |
| EXPECT_EQ(t2_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t2_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 3); |
| |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(pp_refs, ref_map, "pp"); |
| EXPECT_EQ(pp_refs.size(), 3); |
| |
| // all "pp::cc" references have the same structure |
| for (const auto& pp_ref : pp_refs) { |
| const ReferenceComponent& pp_ref_comp(pp_ref->components->Value()); |
| EXPECT_EQ(pp_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(pp_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& cc_ref( |
| pp_ref->components->Children().front()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| // Of all the "pp::cc" type refs, the outer one is the first one, by ordering |
| // of textual position among references that start with the same identifier. |
| const DependentReferences& data_cc_type(**pp_refs.begin()); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| data_cc_type.LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| for (const auto& pp_ref : pp_refs) { |
| const ReferenceComponent& pp_ref_comp(pp_ref->components->Value()); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, &pp_package); |
| |
| const ReferenceComponentNode& cc_ref( |
| pp_ref->components->Children().front()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &cc_class); |
| } |
| // type of "data" is resolved |
| EXPECT_EQ( |
| data_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &cc_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, NestedTypeParameterizedClassDataDeclaration) { |
| TestVerilogSourceFile src( |
| "its_fun_down_here_in_Camelot.sv", |
| "class outer #(parameter type S = int);\n" |
| " class cc #(parameter type T = bit);\n" |
| " endclass\n" |
| "endclass\n" |
| "outer#(outer#(int)::cc#(int))::cc#(outer#(bit)::cc#(bit)) data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(outer_class, root_symbol, "outer"); |
| EXPECT_EQ(outer_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(outer_class_info.file_origin, &src); |
| EXPECT_EQ(outer_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(outer_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(s_type_param, outer_class, "S"); |
| EXPECT_EQ(s_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(s_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, outer_class, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| EXPECT_EQ(cc_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(cc_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, cc_class, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 3); |
| |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(outer_refs, ref_map, "outer"); |
| EXPECT_EQ(outer_refs.size(), 3); |
| |
| // all "pp::cc" references have the same structure |
| for (const auto& outer_ref : outer_refs) { |
| const ReferenceComponent& outer_ref_comp(outer_ref->components->Value()); |
| EXPECT_EQ(outer_ref_comp.identifier, "outer"); |
| EXPECT_EQ(outer_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(outer_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(outer_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(outer_ref->components->Children().size(), 1); |
| const ReferenceComponentNode& cc_ref( |
| outer_ref->components->Children().front()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| // Of all the "outer::cc" type refs, the outer one is the first one, by |
| // ordering of textual position among references that start with the same |
| // identifier. |
| const DependentReferences& data_cc_type(**outer_refs.begin()); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| data_cc_type.LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| for (const auto& outer_ref : outer_refs) { |
| const ReferenceComponent& outer_ref_comp(outer_ref->components->Value()); |
| EXPECT_EQ(outer_ref_comp.resolved_symbol, &outer_class); |
| |
| const ReferenceComponentNode& cc_ref( |
| outer_ref->components->Children().front()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &cc_class); |
| } |
| // type of "data" is resolved |
| EXPECT_EQ( |
| data_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &cc_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, |
| TypeParameterizedClassDataDeclarationNamedParameters) { |
| TestVerilogSourceFile src("its_fun_down_here_in_Camelot.sv", |
| "class cc #(\n" |
| " parameter type S = int,\n" |
| " parameter type T = bit\n" |
| ");\n" |
| "endclass\n" |
| "cc#(.S(int), .T(int)) data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, root_symbol, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| EXPECT_EQ(cc_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(cc_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(s_type_param, cc_class, "S"); |
| EXPECT_EQ(s_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(s_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, cc_class, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(cc_refs, ref_map, "cc"); |
| ASSIGN_MUST_HAVE_UNIQUE(cc_ref, cc_refs); |
| const ReferenceComponent& cc_ref_comp(cc_ref->components->Value()); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentMap param_ref_map( |
| ReferenceComponentNodeMapView(*cc_ref->components)); |
| ASSIGN_MUST_FIND(s_ref, param_ref_map, "S"); |
| const ReferenceComponent& s_ref_comp(s_ref->Value()); |
| EXPECT_EQ(s_ref_comp.identifier, "S"); |
| EXPECT_EQ(s_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(s_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(s_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND(t_ref, param_ref_map, "T"); |
| const ReferenceComponent& t_ref_comp(t_ref->Value()); |
| EXPECT_EQ(t_ref_comp.identifier, "T"); |
| EXPECT_EQ(t_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(t_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_ref_comp.resolved_symbol, nullptr); |
| |
| const DependentReferences& data_cc_type(*cc_ref); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| data_cc_type.components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &cc_class); |
| EXPECT_EQ(s_ref_comp.resolved_symbol, &s_type_param); |
| EXPECT_EQ(t_ref_comp.resolved_symbol, &t_type_param); |
| // type of "data" is resolved |
| EXPECT_EQ( |
| data_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &cc_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, |
| NestedTypeParameterizedClassDataDeclarationNamedParameters) { |
| TestVerilogSourceFile src( |
| "i_need_to_upgrade_my_RAM_alot.sv", |
| "class outer #(parameter type S = int);\n" |
| " class cc #(parameter type T = bit);\n" |
| " endclass\n" |
| "endclass\n" |
| "outer#(.S(outer#(.S(int))::cc#(.T(int))))\n" |
| " ::cc#(.T(outer#(.S(bit))::cc#(.T(bit)))) data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(outer_class, root_symbol, "outer"); |
| EXPECT_EQ(outer_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(outer_class_info.file_origin, &src); |
| EXPECT_EQ(outer_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(outer_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(s_type_param, outer_class, "S"); |
| EXPECT_EQ(s_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(s_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, outer_class, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| EXPECT_EQ(cc_class_info.declared_type.syntax_origin, nullptr); |
| EXPECT_TRUE(cc_class_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, cc_class, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 3); |
| |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(outer_refs, ref_map, "outer"); |
| EXPECT_EQ(outer_refs.size(), 3); |
| |
| // all "outer::cc" references have the same structure |
| for (const auto& outer_ref : outer_refs) { |
| const ReferenceComponent& outer_ref_comp(outer_ref->components->Value()); |
| EXPECT_EQ(outer_ref_comp.identifier, "outer"); |
| EXPECT_EQ(outer_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(outer_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(outer_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(outer_ref->components->Children().size(), 2); |
| |
| const ReferenceComponentNode& s_param_ref( |
| outer_ref->components->Children().front()); |
| const ReferenceComponent& s_param_ref_comp(s_param_ref.Value()); |
| EXPECT_EQ(s_param_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(s_param_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(s_param_ref_comp.identifier, "S"); |
| EXPECT_EQ(s_param_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentNode& cc_ref( |
| outer_ref->components->Children().back()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| |
| ASSERT_EQ(cc_ref.Children().size(), 1); |
| const ReferenceComponentNode& t_param_ref(cc_ref.Children().front()); |
| const ReferenceComponent& t_param_ref_comp(t_param_ref.Value()); |
| EXPECT_EQ(t_param_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(t_param_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_param_ref_comp.identifier, "T"); |
| EXPECT_EQ(t_param_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| // Of all the "outer::cc" type refs, the outer one is the first one, by |
| // ordering of textual position among references that start with the same |
| // identifier. |
| const DependentReferences& data_cc_type(**outer_refs.begin()); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| data_cc_type.LastTypeComponent()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| for (const auto& outer_ref : outer_refs) { |
| const ReferenceComponent& outer_ref_comp(outer_ref->components->Value()); |
| EXPECT_EQ(outer_ref_comp.resolved_symbol, &outer_class); |
| |
| const ReferenceComponentNode& s_param_ref( |
| outer_ref->components->Children().front()); |
| const ReferenceComponent& s_param_ref_comp(s_param_ref.Value()); |
| EXPECT_EQ(s_param_ref_comp.resolved_symbol, &s_type_param); |
| |
| const ReferenceComponentNode& cc_ref( |
| outer_ref->components->Children().back()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &cc_class); |
| |
| const ReferenceComponentNode& t_param_ref(cc_ref.Children().front()); |
| const ReferenceComponent& t_param_ref_comp(t_param_ref.Value()); |
| EXPECT_EQ(t_param_ref_comp.resolved_symbol, &t_type_param); |
| } |
| // type of "data" is resolved |
| EXPECT_EQ( |
| data_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &cc_class); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationNoReturnType) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "function ff;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, root_symbol, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| // no return type |
| EXPECT_EQ(function_ff_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_TRUE(function_ff_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationWithPort) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "function ff(int g);\n" |
| "endfunction\n"); |
| // TODO: propagate type for ports like "int g, h" |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, root_symbol, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| EXPECT_EQ(function_ff_info.declared_type.syntax_origin, |
| nullptr); // there is no function return type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(param_g, function_ff, "g"); |
| EXPECT_EQ(param_g_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(param_g_info.file_origin, &src); |
| ASSERT_NE(param_g_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*param_g_info.declared_type.syntax_origin), |
| "int"); |
| |
| EXPECT_TRUE(function_ff_info.local_references_to_bind.empty()); |
| EXPECT_TRUE(param_g_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationWithLocalVariable) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "function ff();\n" |
| " logic g;\n" |
| "endfunction\n"); |
| // TODO: propagate type for ports like "int g, h" |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, root_symbol, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| EXPECT_EQ(function_ff_info.declared_type.syntax_origin, |
| nullptr); // there is no function return type |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(local_g, function_ff, "g"); |
| EXPECT_EQ(local_g_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(local_g_info.file_origin, &src); |
| ASSERT_NE(local_g_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*local_g_info.declared_type.syntax_origin), |
| "logic"); |
| |
| EXPECT_TRUE(function_ff_info.local_references_to_bind.empty()); |
| EXPECT_TRUE(local_g_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationVoidReturnType) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "function void ff;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, root_symbol, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| ASSERT_NE(function_ff_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *function_ff_info.declared_type.syntax_origin), |
| "void"); |
| |
| EXPECT_TRUE(function_ff_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationClassReturnType) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "class cc;\n" |
| "endclass\n" |
| "function cc ff;\n" // user-defined return type |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, root_symbol, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| ASSERT_NE(function_ff_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *function_ff_info.declared_type.syntax_origin), |
| "cc"); |
| const ReferenceComponentNode* cc_ref = |
| function_ff_info.declared_type.user_defined_type; |
| ASSERT_NE(cc_ref, nullptr); |
| const ReferenceComponent& cc_ref_comp(cc_ref->Value()); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| |
| // There should be one reference to return type "cc" of function "ff". |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Expect "cc" return type to resolve to class declaration. |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &class_cc); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationInModule) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "module mm;\n" |
| "function void ff();\n" |
| "endfunction\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_mm, root_symbol, "mm"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, module_mm, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| ASSERT_NE(function_ff_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *function_ff_info.declared_type.syntax_origin), |
| "void"); |
| const ReferenceComponentNode* ff_type = |
| function_ff_info.declared_type.user_defined_type; |
| EXPECT_EQ(ff_type, nullptr); |
| |
| // There are no references to resolve. |
| EXPECT_TRUE(root_symbol.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(module_mm.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(function_ff.Value().local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassMethodFunctionDeclaration) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "class cc;\n" |
| "function int ff;\n" |
| "endfunction\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, class_cc, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| ASSERT_NE(function_ff_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *function_ff_info.declared_type.syntax_origin), |
| "int"); |
| const ReferenceComponentNode* ff_type = |
| function_ff_info.declared_type.user_defined_type; |
| EXPECT_EQ(ff_type, nullptr); |
| |
| // There are no references to resolve. |
| EXPECT_TRUE(root_symbol.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(class_cc.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(function_ff.Value().local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, |
| ClassMethodFunctionDeclarationPackageTypeReturnType) { |
| TestVerilogSourceFile src("funkytown.sv", |
| "package aa;\n" |
| "class vv;\n" |
| "endclass\n" |
| "endpackage\n" |
| "package bb;\n" |
| "class cc;\n" |
| "function aa::vv ff();\n" |
| "endfunction\n" |
| "endclass\n" |
| "endpackage\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_aa, root_symbol, "aa"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_bb, root_symbol, "bb"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_vv, package_aa, "vv"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, package_bb, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, class_cc, "ff"); |
| |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| ASSERT_NE(function_ff_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *function_ff_info.declared_type.syntax_origin), |
| "aa::vv"); |
| |
| // return type points to the last component of the chain, "vv" |
| const ReferenceComponentNode* vv_ref = |
| function_ff_info.declared_type.user_defined_type; |
| ASSERT_NE(vv_ref, nullptr); |
| const ReferenceComponent& vv_ref_comp(vv_ref->Value()); |
| EXPECT_EQ(vv_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(vv_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(vv_ref_comp.identifier, "vv"); |
| EXPECT_EQ(vv_ref_comp.resolved_symbol, nullptr); |
| |
| // dependent reference parent is "aa" in "aa::vv" |
| const ReferenceComponentNode* aa_ref = vv_ref->Parent(); |
| ASSERT_NE(aa_ref, nullptr); |
| const ReferenceComponent& aa_ref_comp(aa_ref->Value()); |
| EXPECT_EQ(aa_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(aa_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(aa_ref_comp.identifier, "aa"); |
| EXPECT_EQ(aa_ref_comp.resolved_symbol, nullptr); |
| |
| // There is only one (type) reference chain to resolve: "aa::vv". |
| EXPECT_TRUE(root_symbol.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(package_aa.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(package_bb.Value().local_references_to_bind.empty()); |
| EXPECT_EQ(class_cc.Value().local_references_to_bind.size(), 1); |
| EXPECT_TRUE(function_ff.Value().local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Expect to resolve type reference chain "aa:vv" |
| EXPECT_EQ(aa_ref_comp.resolved_symbol, &package_aa); |
| EXPECT_EQ(vv_ref_comp.resolved_symbol, &class_vv); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationOutOfLineMissingOuterClass) { |
| TestVerilogSourceFile src("outofline_func.sv", |
| "function cc::ff;\n" // "cc" undeclared |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| { |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("No member symbol \"cc\" in parent scope (<root>) $root")); |
| } |
| |
| // out-of-line declaration creates a self-reference. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| // Same diagnostic as before. |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("No member symbol \"cc\" in parent scope (<root>) $root")); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationOutOfLineInvalidModuleInjection) { |
| TestVerilogSourceFile src("outofline_func.sv", |
| "module mm;\n" |
| "endmodule\n" |
| "function mm::ff;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| { |
| // Expect that "tt" will not injected into "mm" because it is a module, |
| // not a class. |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), |
| HasSubstr("Expecting reference \"mm\" to resolve to a class, " |
| "but found a module")); |
| } |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_mm, root_symbol, "mm"); |
| EXPECT_EQ(module_mm_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_mm.Find("ff"), module_mm.end()); |
| |
| // Reference must be resolved at Build-time. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(mm_ref, ref_map, "mm"); |
| EXPECT_EQ(mm_ref->components->Value().resolved_symbol, nullptr); |
| |
| // Method injection will not happen for modules. |
| const ReferenceComponentNode* ff_ref = mm_ref->LastLeaf(); |
| const ReferenceComponent& ref(ff_ref->Value()); |
| EXPECT_EQ(ref.identifier, "ff"); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSERT_EQ(resolve_diagnostics.size(), 1); |
| |
| // Still remain unresolved. |
| EXPECT_EQ(mm_ref->components->Value().resolved_symbol, nullptr); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationOutOfLineMissingPrototype) { |
| TestVerilogSourceFile src("outofline_func.sv", |
| "class cc;\n" |
| // no "ff" prototype |
| "endclass\n" |
| "function cc::ff;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| { |
| // This diagnostic is non-fatal. |
| // Expect that "ff" will be injected into "cc" when its method prototype is |
| // missing. |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("No member symbol \"ff\" in parent scope (class) cc")); |
| } |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(method_ff, class_cc, "ff"); |
| EXPECT_EQ(method_ff_info.metatype, SymbolMetaType::kFunction); |
| |
| // out-of-line declaration creates a self-reference. |
| // Reference must be resolved at Build-time. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_ref, ref_map, "cc"); |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| |
| // Method reference is resolved to the injected symbol. |
| const ReferenceComponentNode* ff_ref = cc_ref->LastLeaf(); |
| const ReferenceComponent& ref(ff_ref->Value()); |
| EXPECT_EQ(ref.identifier, "ff"); |
| EXPECT_EQ(ref.resolved_symbol, &method_ff); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Already resolved before, still remains resolved. |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| EXPECT_EQ(ref.resolved_symbol, &method_ff); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationMethodPrototypeOnly) { |
| TestVerilogSourceFile src("outofline_func.sv", |
| "class cc;\n" |
| " extern function int ff(logic ll);\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(method_ff, class_cc, "ff"); |
| EXPECT_EQ(method_ff_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(method_ff_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*method_ff_info.declared_type.syntax_origin), |
| "int"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(port_ll, method_ff, "ll"); |
| EXPECT_EQ(port_ll_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(port_ll_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*port_ll_info.declared_type.syntax_origin), |
| "logic"); |
| |
| // No references to resolve. |
| EXPECT_TRUE(root_symbol.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| EXPECT_TRUE(method_ff_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionDeclarationOutOfLineWithMethodPrototype) { |
| TestVerilogSourceFile src( |
| "outofline_func.sv", |
| "class cc;\n" |
| " extern function int ff(logic ll);\n" // prototype |
| "endclass\n" |
| "function int cc::ff(logic ll);\n" // definition |
| " bit bb;\n" // local variable |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(method_ff, class_cc, "ff"); |
| EXPECT_EQ(method_ff_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(method_ff_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*method_ff_info.declared_type.syntax_origin), |
| "int"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(port_ll, method_ff, "ll"); |
| EXPECT_EQ(port_ll_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(port_ll_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*port_ll_info.declared_type.syntax_origin), |
| "logic"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(local_bb, method_ff, "bb"); |
| EXPECT_EQ(local_bb_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(local_bb_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*local_bb_info.declared_type.syntax_origin), |
| "bit"); |
| |
| // out-of-line declaration creates a self-reference. |
| // Reference must be resolved at Build-time. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_ref, ref_map, "cc"); |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| |
| // Method reference is resolved to the injected symbol. |
| const ReferenceComponentNode* ff_ref = cc_ref->LastLeaf(); |
| const ReferenceComponent& ref(ff_ref->Value()); |
| EXPECT_EQ(ref.identifier, "ff"); |
| EXPECT_EQ(ref.resolved_symbol, &method_ff); |
| |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| EXPECT_TRUE(method_ff_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Already resolved. |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| EXPECT_EQ(ref.resolved_symbol, &method_ff); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclaration) { |
| TestVerilogSourceFile src("taskrabbit.sv", |
| "task tt;\n" |
| "endtask\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(task_tt, root_symbol, "tt"); |
| EXPECT_EQ(task_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(task_tt_info.file_origin, &src); |
| // no return type |
| EXPECT_EQ(task_tt_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_TRUE(task_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationInPackage) { |
| TestVerilogSourceFile src("taskrabbit.sv", |
| "package pp;\n" |
| "task tt();\n" |
| "endtask\n" |
| "endpackage\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_pp, root_symbol, "pp"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(task_tt, package_pp, "tt"); |
| EXPECT_EQ(task_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(task_tt_info.file_origin, &src); |
| // no return type |
| EXPECT_EQ(task_tt_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_TRUE(task_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationInModule) { |
| TestVerilogSourceFile src("taskrabbit.sv", |
| "module mm;\n" |
| "task tt();\n" |
| "endtask\n" |
| "endmodule\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_mm, root_symbol, "mm"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(task_tt, module_mm, "tt"); |
| EXPECT_EQ(task_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(task_tt_info.file_origin, &src); |
| // no return type |
| EXPECT_EQ(task_tt_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_TRUE(task_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationInClass) { |
| TestVerilogSourceFile src("taskrabbit.sv", |
| "class cc;\n" |
| "task tt();\n" |
| "endtask\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(task_tt, class_cc, "tt"); |
| EXPECT_EQ(task_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(task_tt_info.file_origin, &src); |
| // no return type |
| EXPECT_EQ(task_tt_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_TRUE(task_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationWithPorts) { |
| TestVerilogSourceFile src("taskrabbit.sv", |
| "task tt(logic ll);\n" |
| "endtask\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(task_tt, root_symbol, "tt"); |
| EXPECT_EQ(task_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(task_tt_info.file_origin, &src); |
| // no return type |
| EXPECT_EQ(task_tt_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(logic_ll, task_tt, "ll"); |
| EXPECT_EQ(logic_ll_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(logic_ll_info.file_origin, &src); |
| // primitive type |
| ASSERT_NE(logic_ll_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*logic_ll_info.declared_type.syntax_origin), |
| "logic"); |
| |
| EXPECT_TRUE(task_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationOutOfLineMissingOuterClass) { |
| TestVerilogSourceFile src("outofline_task.sv", |
| "task cc::tt;\n" // "cc" undeclared |
| "endtask\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| { |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("No member symbol \"cc\" in parent scope (<root>) $root")); |
| } |
| |
| // out-of-line declaration creates a self-reference. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| |
| // Same diagnostic as before. |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("No member symbol \"cc\" in parent scope (<root>) $root")); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationOutOfLineMissingPrototype) { |
| TestVerilogSourceFile src("outofline_task.sv", |
| "class cc;\n" |
| // no "tt" prototype |
| "endclass\n" |
| "task cc::tt;\n" |
| "endtask\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| { |
| // This diagnostic is non-fatal. |
| // Expect that "tt" will be injected into "cc" when its method prototype is |
| // missing. |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("No member symbol \"tt\" in parent scope (class) cc")); |
| } |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(method_tt, class_cc, "tt"); |
| EXPECT_EQ(method_tt_info.metatype, SymbolMetaType::kTask); |
| |
| // out-of-line declaration creates a self-reference. |
| // Reference must be resolved at Build-time. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_ref, ref_map, "cc"); |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| |
| // Method reference is resolved to the injected symbol. |
| const ReferenceComponentNode* tt_ref = cc_ref->LastLeaf(); |
| const ReferenceComponent& ref(tt_ref->Value()); |
| EXPECT_EQ(ref.identifier, "tt"); |
| EXPECT_EQ(ref.resolved_symbol, &method_tt); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Already resolved before, still remains resolved. |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| EXPECT_EQ(ref.resolved_symbol, &method_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationOutOfLineInvalidPackageInjection) { |
| TestVerilogSourceFile src("outofline_task.sv", |
| "package pp;\n" |
| "endpackage\n" |
| "task pp::tt;\n" |
| "endtask\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| { |
| // Expect that "tt" will not injected into "pp" because it is a package, |
| // not a class. |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), |
| HasSubstr("Expecting reference \"pp\" to resolve to a class, " |
| "but found a package")); |
| } |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_pp, root_symbol, "pp"); |
| EXPECT_EQ(package_pp_info.metatype, SymbolMetaType::kPackage); |
| EXPECT_EQ(package_pp.Find("tt"), package_pp.end()); |
| |
| // Reference must be resolved at Build-time. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_ref, ref_map, "pp"); |
| EXPECT_EQ(pp_ref->components->Value().resolved_symbol, nullptr); |
| |
| // Method injection will not happen for packages. |
| const ReferenceComponentNode* tt_ref = pp_ref->LastLeaf(); |
| const ReferenceComponent& ref(tt_ref->Value()); |
| EXPECT_EQ(ref.identifier, "tt"); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSERT_EQ(resolve_diagnostics.size(), 1); |
| |
| // Still remain unresolved. |
| EXPECT_EQ(pp_ref->components->Value().resolved_symbol, nullptr); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationMethodPrototypeOnly) { |
| TestVerilogSourceFile src("outofline_task.sv", |
| "class cc;\n" |
| " extern task tt(logic ll);\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(method_tt, class_cc, "tt"); |
| EXPECT_EQ(method_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(method_tt_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(port_ll, method_tt, "ll"); |
| EXPECT_EQ(port_ll_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(port_ll_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*port_ll_info.declared_type.syntax_origin), |
| "logic"); |
| |
| // No references to resolve. |
| EXPECT_TRUE(root_symbol.Value().local_references_to_bind.empty()); |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| EXPECT_TRUE(method_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TaskDeclarationOutOfLineWithMethodPrototype) { |
| TestVerilogSourceFile src("outofline_task.sv", |
| "class cc;\n" |
| " extern task tt(logic ll);\n" // prototype |
| "endclass\n" |
| "task cc::tt(logic ll);\n" // definition |
| " bit bb;\n" // local variable |
| "endtask\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(method_tt, class_cc, "tt"); |
| EXPECT_EQ(method_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(method_tt_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(port_ll, method_tt, "ll"); |
| EXPECT_EQ(port_ll_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(port_ll_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*port_ll_info.declared_type.syntax_origin), |
| "logic"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(local_bb, method_tt, "bb"); |
| EXPECT_EQ(local_bb_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(local_bb_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*local_bb_info.declared_type.syntax_origin), |
| "bit"); |
| |
| // out-of-line declaration creates a self-reference. |
| // Reference must be resolved at Build-time. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_ref, ref_map, "cc"); |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| |
| // Method reference is resolved to the injected symbol. |
| const ReferenceComponentNode* tt_ref = cc_ref->LastLeaf(); |
| const ReferenceComponent& ref(tt_ref->Value()); |
| EXPECT_EQ(ref.identifier, "tt"); |
| EXPECT_EQ(ref.resolved_symbol, &method_tt); |
| |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| EXPECT_TRUE(method_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Already resolved. |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| EXPECT_EQ(ref.resolved_symbol, &method_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, OutOfLineDefinitionMismatchesPrototype) { |
| TestVerilogSourceFile src( |
| "outofline_task_or_func.sv", |
| "class cc;\n" |
| " extern task tt(logic ll);\n" // task prototype |
| "endclass\n" |
| "function int cc::tt(logic ll);\n" // function definition (wrong type) |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| ASSIGN_MUST_HAVE_UNIQUE(err, build_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kAlreadyExists); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr( |
| "task $root::cc::tt cannot be redefined out-of-line as a function")); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(method_tt, class_cc, "tt"); |
| EXPECT_EQ(method_tt_info.metatype, SymbolMetaType::kTask); |
| EXPECT_EQ(method_tt_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(port_ll, method_tt, "ll"); |
| EXPECT_EQ(port_ll_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(port_ll_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*port_ll_info.declared_type.syntax_origin), |
| "logic"); |
| |
| // Reference must be resolved at Build-time. |
| EXPECT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_ref, ref_map, "cc"); |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| |
| // Method reference "tt" fails to resolve due to metatype mismatch. |
| const ReferenceComponentNode* tt_ref = cc_ref->LastLeaf(); |
| const ReferenceComponent& ref(tt_ref->Value()); |
| EXPECT_EQ(ref.identifier, "tt"); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| |
| EXPECT_TRUE(class_cc_info.local_references_to_bind.empty()); |
| EXPECT_TRUE(method_tt_info.local_references_to_bind.empty()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), |
| HasSubstr("Expecting reference \"tt\" to resolve to a " |
| "function, but found a task")); |
| |
| EXPECT_EQ(cc_ref->components->Value().resolved_symbol, &class_cc); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); // Still fails to resolve. |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionCallResolvedSameScope) { |
| TestVerilogSourceFile src("call_me.sv", |
| "function int tt();\n" |
| " return 1;\n" |
| "endfunction\n" |
| "function int vv();\n" |
| " return tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, root_symbol, "tt"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(tt_ref, ref_map, "tt"); |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Call to "tt" is resolved. |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionCallUnresolved) { |
| TestVerilogSourceFile src("call_me_not.sv", |
| "function int vv();\n" |
| " return tt();\n" // undefined |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(tt_ref, ref_map, "tt"); |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("Unable to resolve symbol \"tt\" from context $root::vv")); |
| |
| // Call to "tt" is unresolved. |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionCallUnresolvedNamedParameters) { |
| TestVerilogSourceFile src("call_me_not.sv", |
| "function int vv();\n" |
| " return tt(.a(1), .b(2));\n" // undefined |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(tt_ref, ref_map, "tt"); |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentMap param_refs( |
| ReferenceComponentNodeMapView(*tt_ref->components)); |
| |
| ASSIGN_MUST_FIND(a_ref, param_refs, "a"); |
| const ReferenceComponent& a_ref_comp(a_ref->Value()); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(a_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| ASSIGN_MUST_FIND(b_ref, param_refs, "b"); |
| const ReferenceComponent& b_ref_comp(b_ref->Value()); |
| EXPECT_EQ(b_ref_comp.identifier, "b"); |
| EXPECT_EQ(b_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(b_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(b_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| EXPECT_THAT( |
| err.message(), |
| HasSubstr("Unable to resolve symbol \"tt\" from context $root::vv")); |
| |
| // Call to "tt" is unresolved, as are its named parameters. |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| EXPECT_EQ(b_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, FunctionCallResolvedNamedParameters) { |
| TestVerilogSourceFile src("call_me_not.sv", |
| "function int tt(int a, int b);\n" |
| " return 0;\n" |
| "endfunction\n" |
| "function int vv();\n" |
| " return tt(.a(1), .b(2));\n" // valid |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, root_symbol, "tt"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, |
| nullptr); // returns int |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(param_a, function_tt, "a"); |
| EXPECT_EQ(param_a_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(param_a_info.declared_type.syntax_origin, nullptr); // int a |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(param_b, function_tt, "b"); |
| EXPECT_EQ(param_b_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| ASSERT_NE(param_b_info.declared_type.syntax_origin, nullptr); // int b |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(tt_ref, ref_map, "tt"); |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentMap param_refs( |
| ReferenceComponentNodeMapView(*tt_ref->components)); |
| |
| ASSIGN_MUST_FIND(a_ref, param_refs, "a"); |
| const ReferenceComponent& a_ref_comp(a_ref->Value()); |
| EXPECT_EQ(a_ref_comp.identifier, "a"); |
| EXPECT_EQ(a_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(a_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| ASSIGN_MUST_FIND(b_ref, param_refs, "b"); |
| const ReferenceComponent& b_ref_comp(b_ref->Value()); |
| EXPECT_EQ(b_ref_comp.identifier, "b"); |
| EXPECT_EQ(b_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(b_ref_comp.required_metatype, |
| SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(b_ref_comp.resolved_symbol, nullptr); // not yet resolved |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Call to "tt" is resolved, along with its named parameters. |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| EXPECT_EQ(a_ref_comp.resolved_symbol, ¶m_a); |
| EXPECT_EQ(b_ref_comp.resolved_symbol, ¶m_b); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, CallNonFunction) { |
| TestVerilogSourceFile src("call_me.sv", |
| "module tt();\n" |
| "endmodule\n" |
| "function int vv();\n" |
| " return tt();\n" // not a function |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(module_tt, root_symbol, "tt"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(module_tt_info.metatype, SymbolMetaType::kModule); |
| EXPECT_EQ(module_tt_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(tt_ref, ref_map, "tt"); |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), |
| HasSubstr("Expecting reference \"tt\" to resolve to a " |
| "<callable>, but found a module")); |
| |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, NestedCallsArguments) { |
| TestVerilogSourceFile src("call_me.sv", |
| "function int tt(int aa);\n" |
| " return aa + 1;\n" |
| "endfunction\n" |
| "function int vv();\n" |
| " return tt(tt(tt(2)));\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, root_symbol, "tt"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(arg_aa, function_tt, "aa"); |
| EXPECT_EQ(arg_aa_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| |
| EXPECT_EQ(function_tt_info.local_references_to_bind.size(), 1); |
| const auto tt_ref_map(function_tt_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(aa_ref, tt_ref_map, "aa"); |
| const ReferenceComponent& aa_ref_comp(aa_ref->components->Value()); |
| EXPECT_EQ(aa_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(aa_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect 3 calls to "tt" from the same scope. |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 3); |
| const auto vv_ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(tt_refs, vv_ref_map, "tt"); |
| for (const auto& tt_ref : tt_refs) { |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(aa_ref_comp.resolved_symbol, &arg_aa); |
| |
| // Calls to "tt" are all resolved. |
| for (const auto& tt_ref : tt_refs) { |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, SelfRecursion) { |
| TestVerilogSourceFile src("call_me_from_me.sv", |
| "function int tt();\n" |
| " return 1 - tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, root_symbol, "tt"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_tt_info.local_references_to_bind.size(), 1); |
| const auto tt_ref_map(function_tt_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(tt_ref, tt_ref_map, "tt"); |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Call to "tt" (recursive) is resolved. |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, MutualRecursion) { |
| TestVerilogSourceFile src("call_me_back.sv", |
| "function int tt();\n" |
| " return vv();\n" |
| "endfunction\n" |
| "function int vv();\n" |
| " return tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, root_symbol, "tt"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_tt_info.local_references_to_bind.size(), 1); |
| const auto tt_ref_map(function_tt_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(vv_ref, tt_ref_map, "vv"); |
| const ReferenceComponent& vv_ref_comp(vv_ref->components->Value()); |
| EXPECT_EQ(vv_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(vv_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto vv_ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(tt_ref, vv_ref_map, "tt"); |
| const ReferenceComponent& tt_ref_comp(tt_ref->components->Value()); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Calls to "tt" and "vv" are all resolved. |
| EXPECT_EQ(vv_ref_comp.resolved_symbol, &function_vv); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, PackageQualifiedFunctionCall) { |
| TestVerilogSourceFile src("call_me.sv", |
| "package pp;\n" |
| " function int tt();\n" |
| " return 1;\n" |
| " endfunction\n" |
| "endpackage\n" |
| "function int vv();\n" |
| " return pp::tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_pp, root_symbol, "pp"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, package_pp, "tt"); |
| EXPECT_EQ(package_pp_info.metatype, SymbolMetaType::kPackage); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_ref, ref_map, "pp"); |
| ASSERT_EQ(pp_ref->components->Children().size(), 1); |
| const ReferenceComponent& pp_ref_comp(pp_ref->components->Value()); |
| EXPECT_EQ(pp_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponent& tt_ref_comp( |
| pp_ref->components->Children().front().Value()); |
| EXPECT_EQ(tt_ref_comp.identifier, "tt"); |
| EXPECT_EQ(tt_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Call to "tt" is resolved. |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, &package_pp); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassQualifiedFunctionCall) { |
| TestVerilogSourceFile src("call_me.sv", |
| "class cc;\n" |
| " function static int tt();\n" |
| " return 1;\n" |
| " endfunction\n" |
| "endclass\n" |
| "function int vv();\n" |
| " return cc::tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, class_cc, "tt"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_ref, ref_map, "cc"); |
| ASSERT_EQ(cc_ref->components->Children().size(), 1); |
| const ReferenceComponent& cc_ref_comp(cc_ref->components->Value()); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponent& tt_ref_comp( |
| cc_ref->components->Children().front().Value()); |
| EXPECT_EQ(tt_ref_comp.identifier, "tt"); |
| EXPECT_EQ(tt_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Call to "tt" is resolved. |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &class_cc); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassQualifiedFunctionCallUnresolved) { |
| TestVerilogSourceFile src("call_me.sv", |
| "class cc;\n" |
| "endclass\n" |
| "function int vv();\n" |
| " return cc::tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 1); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_ref, ref_map, "cc"); |
| ASSERT_EQ(cc_ref->components->Children().size(), 1); |
| const ReferenceComponent& cc_ref_comp(cc_ref->components->Value()); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponent& tt_ref_comp( |
| cc_ref->components->Children().front().Value()); |
| EXPECT_EQ(tt_ref_comp.identifier, "tt"); |
| EXPECT_EQ(tt_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &class_cc); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); // error |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassMethodCall) { |
| TestVerilogSourceFile src("call_me.sv", |
| "class cc;\n" |
| " function int tt();\n" |
| " return 1;\n" |
| " endfunction\n" |
| "endclass\n" |
| "function int vv();\n" |
| " cc cc_obj;\n" |
| " return cc_obj.tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, class_cc, "tt"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_obj, function_vv, "cc_obj"); |
| EXPECT_EQ(cc_obj_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 2); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_type_ref, ref_map, |
| "cc"); // "cc" is a type |
| const ReferenceComponent& cc_type_ref_comp(cc_type_ref->components->Value()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_obj_ref, ref_map, |
| "cc_obj"); // "cc_obj" is data |
| ASSERT_EQ(cc_obj_ref->components->Children().size(), 1); |
| const ReferenceComponent& cc_obj_ref_comp(cc_obj_ref->components->Value()); |
| EXPECT_EQ(cc_obj_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_obj_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_obj_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponent& tt_ref_comp( |
| cc_obj_ref->components->Children().front().Value()); |
| EXPECT_EQ(tt_ref_comp.identifier, "tt"); |
| EXPECT_EQ(tt_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Call to ".tt" is resolved. |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, &class_cc); |
| EXPECT_EQ(cc_obj_ref_comp.resolved_symbol, &cc_obj); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ClassMethodCallUnresolved) { |
| TestVerilogSourceFile src("call_me.sv", |
| "class cc;\n" |
| "endclass\n" |
| "function int vv();\n" |
| " cc cc_obj;\n" |
| " return cc_obj.tt();\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_obj, function_vv, "cc_obj"); |
| EXPECT_EQ(cc_obj_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 2); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_type_ref, ref_map, |
| "cc"); // "cc" is a type |
| const ReferenceComponent& cc_type_ref_comp(cc_type_ref->components->Value()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(cc_obj_ref, ref_map, |
| "cc_obj"); // "cc_obj" is data |
| ASSERT_EQ(cc_obj_ref->components->Children().size(), 1); |
| const ReferenceComponent& cc_obj_ref_comp(cc_obj_ref->components->Value()); |
| EXPECT_EQ(cc_obj_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_obj_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_obj_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponent& tt_ref_comp( |
| cc_obj_ref->components->Children().front().Value()); |
| EXPECT_EQ(tt_ref_comp.identifier, "tt"); |
| EXPECT_EQ(tt_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, &class_cc); |
| EXPECT_EQ(cc_obj_ref_comp.resolved_symbol, &cc_obj); |
| EXPECT_EQ(tt_ref_comp.resolved_symbol, nullptr); // unresolved |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ChainedMethodCall) { |
| TestVerilogSourceFile src("call_me.sv", |
| "class cc;\n" |
| " function dd tt();\n" |
| " endfunction\n" |
| "endclass\n" |
| "class dd;\n" |
| " function cc gg();\n" |
| " endfunction\n" |
| "endclass\n" |
| "function dd vv();\n" |
| " dd dd_obj;\n" |
| " return dd_obj.gg().tt();\n" |
| // .gg() -> cc |
| // .tt() -> dd |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_dd, root_symbol, "dd"); |
| EXPECT_EQ(class_dd_info.metatype, SymbolMetaType::kClass); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, class_cc, "tt"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| ASSERT_NE(function_tt_info.declared_type.user_defined_type, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_gg, class_dd, "gg"); |
| EXPECT_EQ(function_gg_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_gg_info.declared_type.syntax_origin, nullptr); |
| ASSERT_NE(function_gg_info.declared_type.user_defined_type, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(dd_obj, function_vv, "dd_obj"); |
| EXPECT_EQ(dd_obj_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 2); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(dd_type_ref, ref_map, |
| "dd"); // "dd" is a type |
| const ReferenceComponent& dd_type_ref_comp(dd_type_ref->components->Value()); |
| |
| // Examine the dd_obj.gg().tt() reference chain. |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(dd_obj_ref, ref_map, |
| "dd_obj"); // "dd_obj" is data |
| ASSERT_EQ(dd_obj_ref->components->Children().size(), 1); |
| const ReferenceComponent& dd_obj_ref_comp(dd_obj_ref->components->Value()); |
| EXPECT_EQ(dd_obj_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(dd_obj_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(dd_obj_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentNode& dd_gg_ref( |
| dd_obj_ref->components->Children().front()); |
| const ReferenceComponent& dd_gg_ref_comp(dd_gg_ref.Value()); |
| EXPECT_EQ(dd_gg_ref_comp.identifier, "gg"); |
| EXPECT_EQ(dd_gg_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(dd_gg_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(dd_gg_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentNode& dd_gg_tt_ref(dd_gg_ref.Children().front()); |
| const ReferenceComponent& dd_gg_tt_ref_comp(dd_gg_tt_ref.Value()); |
| EXPECT_EQ(dd_gg_tt_ref_comp.identifier, "tt"); |
| EXPECT_EQ(dd_gg_tt_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(dd_gg_tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(dd_gg_tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Return types of methods are resolved. |
| EXPECT_EQ(function_tt_info.declared_type.user_defined_type->Value() |
| .resolved_symbol, |
| &class_dd); |
| EXPECT_EQ(function_gg_info.declared_type.user_defined_type->Value() |
| .resolved_symbol, |
| &class_cc); |
| |
| // Chained call is resolved. |
| EXPECT_EQ(dd_type_ref_comp.resolved_symbol, &class_dd); |
| EXPECT_EQ(dd_obj_ref_comp.resolved_symbol, &dd_obj); |
| EXPECT_EQ(dd_gg_ref_comp.resolved_symbol, &function_gg); |
| EXPECT_EQ(dd_gg_tt_ref_comp.resolved_symbol, &function_tt); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, ChainedMethodCallReturnTypeNotAClass) { |
| TestVerilogSourceFile src( |
| "call_me.sv", |
| "class cc;\n" |
| " function dd tt();\n" |
| " endfunction\n" |
| "endclass\n" |
| "class dd;\n" |
| " function int gg();\n" // return type is a primitive |
| " endfunction\n" |
| "endclass\n" |
| "function dd vv();\n" |
| " dd dd_obj;\n" |
| " return dd_obj.gg().tt();\n" |
| // .gg() -> cc |
| // .tt() -> <error> |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_cc, root_symbol, "cc"); |
| EXPECT_EQ(class_cc_info.metatype, SymbolMetaType::kClass); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(class_dd, root_symbol, "dd"); |
| EXPECT_EQ(class_dd_info.metatype, SymbolMetaType::kClass); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_tt, class_cc, "tt"); |
| EXPECT_EQ(function_tt_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_tt_info.declared_type.syntax_origin, nullptr); |
| ASSERT_NE(function_tt_info.declared_type.user_defined_type, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_gg, class_dd, "gg"); |
| EXPECT_EQ(function_gg_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_gg_info.declared_type.syntax_origin, nullptr); |
| EXPECT_EQ(function_gg_info.declared_type.user_defined_type, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_vv, root_symbol, "vv"); |
| EXPECT_EQ(function_vv_info.metatype, SymbolMetaType::kFunction); |
| ASSERT_NE(function_vv_info.declared_type.syntax_origin, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(dd_obj, function_vv, "dd_obj"); |
| EXPECT_EQ(dd_obj_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| |
| EXPECT_EQ(function_vv_info.local_references_to_bind.size(), 2); |
| const auto ref_map(function_vv_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(dd_type_ref, ref_map, |
| "dd"); // "dd" is a type |
| const ReferenceComponent& dd_type_ref_comp(dd_type_ref->components->Value()); |
| |
| // Examine the dd_obj.gg().tt() reference chain. |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(dd_obj_ref, ref_map, |
| "dd_obj"); // "dd_obj" is data |
| ASSERT_EQ(dd_obj_ref->components->Children().size(), 1); |
| const ReferenceComponent& dd_obj_ref_comp(dd_obj_ref->components->Value()); |
| EXPECT_EQ(dd_obj_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(dd_obj_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(dd_obj_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentNode& dd_gg_ref( |
| dd_obj_ref->components->Children().front()); |
| const ReferenceComponent& dd_gg_ref_comp(dd_gg_ref.Value()); |
| EXPECT_EQ(dd_gg_ref_comp.identifier, "gg"); |
| EXPECT_EQ(dd_gg_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(dd_gg_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(dd_gg_ref_comp.resolved_symbol, nullptr); |
| |
| const ReferenceComponentNode& dd_gg_tt_ref(dd_gg_ref.Children().front()); |
| const ReferenceComponent& dd_gg_tt_ref_comp(dd_gg_tt_ref.Value()); |
| EXPECT_EQ(dd_gg_tt_ref_comp.identifier, "tt"); |
| EXPECT_EQ(dd_gg_tt_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(dd_gg_tt_ref_comp.required_metatype, SymbolMetaType::kCallable); |
| EXPECT_EQ(dd_gg_tt_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), HasSubstr("Type of parent reference")); |
| // reference text in diagnostic looks like: "@dd_obj.gg[<callable>]" |
| EXPECT_THAT(err.message(), HasSubstr("(int) does not have any members")); |
| |
| // Return types of methods are resolved (where non-primitive). |
| EXPECT_EQ(function_tt_info.declared_type.user_defined_type->Value() |
| .resolved_symbol, |
| &class_dd); |
| |
| // Chained call is partially resolved. |
| EXPECT_EQ(dd_type_ref_comp.resolved_symbol, &class_dd); |
| EXPECT_EQ(dd_obj_ref_comp.resolved_symbol, &dd_obj); |
| EXPECT_EQ(dd_gg_ref_comp.resolved_symbol, &function_gg); |
| EXPECT_EQ(dd_gg_tt_ref_comp.resolved_symbol, nullptr); // failed to resolve |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeData) { |
| TestVerilogSourceFile src("structy.sv", |
| "struct {\n" |
| " int size;\n" |
| "} data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Expect one anonymous struct definition and reference. |
| EXPECT_EQ(root_symbol.Value().anonymous_scope_names.size(), 1); |
| ASSERT_EQ(root_symbol.Children().size(), 2); |
| // Find the symbol that is a struct (anon), which is not "data". |
| const auto found = |
| std::find_if(root_symbol.Children().begin(), root_symbol.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.first != "data"; |
| }); |
| ASSERT_NE(found, root_symbol.Children().end()); |
| const SymbolTableNode& anon_struct(found->second); |
| const SymbolInfo& anon_struct_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_info.local_references_to_bind.empty()); |
| |
| // Struct has one member. |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_size, anon_struct, "size"); |
| EXPECT_EQ(int_size_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_size_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_size_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_size_info.declared_type.user_defined_type, nullptr); |
| |
| // Expect to bind anonymous struct immediately. |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const DependentReferences& anon_struct_ref( |
| root_symbol.Value().local_references_to_bind.front()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); // unchanged |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeDataMultiFields) { |
| TestVerilogSourceFile src("structy.sv", |
| "struct {\n" |
| " int size;\n" |
| " real weight;\n" |
| "} data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Expect one anonymous struct definition and reference. |
| EXPECT_EQ(root_symbol.Value().anonymous_scope_names.size(), 1); |
| ASSERT_EQ(root_symbol.Children().size(), 2); |
| // Find the symbol that is a struct (anon), which is not "data". |
| const auto found = |
| std::find_if(root_symbol.Children().begin(), root_symbol.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.first != "data"; |
| }); |
| ASSERT_NE(found, root_symbol.Children().end()); |
| const SymbolTableNode& anon_struct(found->second); |
| const SymbolInfo& anon_struct_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_info.local_references_to_bind.empty()); |
| |
| // Struct has two members. |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_size, anon_struct, "size"); |
| EXPECT_EQ(int_size_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_size_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_size_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_size_info.declared_type.user_defined_type, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_weight, anon_struct, "weight"); |
| EXPECT_EQ(int_weight_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_weight_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_weight_info.declared_type.syntax_origin), |
| "real"); |
| EXPECT_EQ(int_weight_info.declared_type.user_defined_type, nullptr); |
| |
| // Expect to bind anonymous struct immediately. |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const DependentReferences& anon_struct_ref( |
| root_symbol.Value().local_references_to_bind.front()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); // unchanged |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeDataMultiDeclaration) { |
| TestVerilogSourceFile src("structy.sv", |
| "struct {\n" |
| " int size, weight;\n" |
| // Note: the syntax tree structure for "weight" |
| // looks different than that of the the first |
| // variable "size". Make sure this test continues to |
| // work after CST restructuring. |
| "} data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Expect one anonymous struct definition and reference. |
| EXPECT_EQ(root_symbol.Value().anonymous_scope_names.size(), 1); |
| ASSERT_EQ(root_symbol.Children().size(), 2); |
| // Find the symbol that is a struct (anon), which is not "data". |
| const auto found = |
| std::find_if(root_symbol.Children().begin(), root_symbol.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.first != "data"; |
| }); |
| ASSERT_NE(found, root_symbol.Children().end()); |
| const SymbolTableNode& anon_struct(found->second); |
| const SymbolInfo& anon_struct_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_info.local_references_to_bind.empty()); |
| |
| // Struct has two members. |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_size, anon_struct, "size"); |
| EXPECT_EQ(int_size_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_size_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_size_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_size_info.declared_type.user_defined_type, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_weight, anon_struct, "weight"); |
| EXPECT_EQ(int_weight_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_weight_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_weight_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_weight_info.declared_type.user_defined_type, nullptr); |
| |
| // Expect to bind anonymous struct immediately. |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const DependentReferences& anon_struct_ref( |
| root_symbol.Value().local_references_to_bind.front()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); // unchanged |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeDataMultiVariables) { |
| TestVerilogSourceFile src("structy.sv", |
| "struct {\n" |
| " int size;\n" |
| "} data, foobar;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Expect one anonymous struct definition and two type references. |
| EXPECT_EQ(root_symbol.Value().anonymous_scope_names.size(), 1); |
| ASSERT_EQ(root_symbol.Children().size(), 3); |
| // Find the first symbol that is a struct (anon). |
| const auto found = std::find_if( |
| root_symbol.Children().begin(), root_symbol.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.second.Value().metatype == SymbolMetaType::kStruct; |
| }); |
| ASSERT_NE(found, root_symbol.Children().end()); |
| const SymbolTableNode& anon_struct(found->second); |
| const SymbolInfo& anon_struct_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_info.local_references_to_bind.empty()); |
| |
| // Struct has one member. |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_size, anon_struct, "size"); |
| EXPECT_EQ(int_size_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_size_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_size_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_size_info.declared_type.user_defined_type, nullptr); |
| |
| // Expect to bind anonymous struct immediately. |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const DependentReferences& anon_struct_ref( |
| root_symbol.Value().local_references_to_bind.front()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| // "foobar" has same anonymous struct type |
| MUST_ASSIGN_LOOKUP_SYMBOL(foobar, root_symbol, "foobar"); |
| EXPECT_EQ(foobar_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foobar_info.file_origin, &src); |
| EXPECT_EQ(foobar_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // "data" and "foobar" share the same anonymous struct type. |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); // unchanged |
| EXPECT_EQ( |
| data_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &anon_struct); |
| EXPECT_EQ( |
| foobar_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &anon_struct); |
| } |
| } |
| |
| static bool IsStruct(const SymbolTableNode::key_value_type& p) { |
| return p.second.Value().metatype == SymbolMetaType::kStruct; |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeDataMultiVariablesDistinctTypes) { |
| TestVerilogSourceFile src("structy.sv", |
| "struct {\n" |
| " int size;\n" |
| "} data;\n" |
| "struct {\n" |
| " int size;\n" |
| "} foobar;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Expect two anonymous struct definitions and two type references. |
| EXPECT_EQ(root_symbol.Value().anonymous_scope_names.size(), 2); |
| ASSERT_EQ(root_symbol.Children().size(), 4); |
| // Find the symbol that is a struct (anon). |
| const auto found = std::find_if(root_symbol.Children().begin(), |
| root_symbol.Children().end(), IsStruct); |
| ASSERT_NE(found, root_symbol.Children().end()); |
| const SymbolTableNode& anon_struct(found->second); |
| const SymbolInfo& anon_struct_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_info.local_references_to_bind.empty()); |
| |
| const auto found_2 = |
| std::find_if(std::next(found), root_symbol.Children().end(), IsStruct); |
| ASSERT_NE(found_2, root_symbol.Children().end()); |
| const SymbolTableNode& anon_struct_2(found_2->second); |
| const SymbolInfo& anon_struct_2_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_2_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_2_info.local_references_to_bind.empty()); |
| |
| // Struct has one member. Both structs have the same elements and structure, |
| // but have distinct scopes in the symbol table. |
| for (const auto* anon_struct_iter : {&anon_struct, &anon_struct_2}) { |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_size, *anon_struct_iter, "size"); |
| EXPECT_EQ(int_size_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_size_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_size_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_size_info.declared_type.user_defined_type, nullptr); |
| } |
| |
| // Expect to bind both anonymous structs immediately. |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 2); |
| const DependentReferences& anon_struct_ref( |
| root_symbol.Value().local_references_to_bind.front()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); |
| |
| const DependentReferences& anon_struct_2_ref( |
| root_symbol.Value().local_references_to_bind.back()); |
| const ReferenceComponent& anon_struct_2_ref_comp( |
| anon_struct_2_ref.components->Value()); |
| EXPECT_EQ(anon_struct_2_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_2_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_2_ref_comp.resolved_symbol, &anon_struct_2); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| // "foobar" has a different anonymous struct type |
| MUST_ASSIGN_LOOKUP_SYMBOL(foobar, root_symbol, "foobar"); |
| EXPECT_EQ(foobar_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foobar_info.file_origin, &src); |
| EXPECT_EQ(foobar_info.declared_type.user_defined_type, |
| anon_struct_2_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // "data" and "foobar" have different anonymous struct types. |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); // unchanged |
| EXPECT_EQ(anon_struct_2_ref_comp.resolved_symbol, |
| &anon_struct_2); // unchanged |
| EXPECT_EQ( |
| data_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &anon_struct); |
| EXPECT_EQ( |
| foobar_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &anon_struct_2); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeFunctionParameter) { |
| TestVerilogSourceFile src("structy_funky.sv", |
| "function int ff(struct {\n" |
| " int weight;\n" |
| " } data);\n" |
| " return data.weight;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ff_function, root_symbol, "ff"); |
| EXPECT_EQ(ff_function_info.metatype, SymbolMetaType::kFunction); |
| |
| // Expect one anonymous struct definition and reference. |
| EXPECT_EQ(ff_function_info.anonymous_scope_names.size(), 1); |
| ASSERT_EQ(ff_function.Children().size(), 2); |
| // Find the symbol that is a struct (anon). |
| const auto found = std::find_if( |
| ff_function.Children().begin(), ff_function.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.second.Value().metatype == SymbolMetaType::kStruct; |
| }); |
| ASSERT_NE(found, ff_function.Children().end()); |
| const SymbolTableNode& anon_struct(found->second); |
| const SymbolInfo& anon_struct_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_weight, anon_struct, "weight"); |
| EXPECT_EQ(int_weight_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_weight_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_weight_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_weight_info.declared_type.user_defined_type, nullptr); |
| |
| // Expect to bind anonymous struct immediately. |
| const auto ref_map(ff_function_info.LocalReferencesMapViewForTesting()); |
| // Expect one type reference and one reference rooted at "data". |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(data_ref, ref_map, "data"); |
| const ReferenceComponent& data_ref_comp(data_ref->components->Value()); |
| EXPECT_EQ(data_ref_comp.identifier, "data"); |
| EXPECT_EQ(data_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(data_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(data_ref_comp.resolved_symbol, nullptr); |
| |
| // "data.weight" |
| ASSIGN_MUST_HAVE_UNIQUE(weight_ref, data_ref->components->Children()); |
| const ReferenceComponent& weight_ref_comp(weight_ref.Value()); |
| EXPECT_EQ(weight_ref_comp.identifier, "weight"); |
| EXPECT_EQ(weight_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(weight_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(weight_ref_comp.resolved_symbol, nullptr); |
| |
| const DependentReferences& anon_struct_ref( |
| **std::find_if(ref_map.begin(), ref_map.end(), |
| [](const decltype(ref_map)::value_type& r) { |
| return (*r.second.begin()) |
| ->components->Value() |
| .required_metatype == SymbolMetaType::kStruct; |
| }) |
| ->second.begin()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, ff_function, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(data_ref_comp.resolved_symbol, &data); // "data" |
| EXPECT_EQ(weight_ref_comp.resolved_symbol, &int_weight); // ".weight" |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &anon_struct); // unchanged |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeNested) { |
| TestVerilogSourceFile src("structy.sv", |
| "struct {\n" |
| " struct {\n" |
| " int size;\n" |
| " } foo;\n" |
| "} data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Expect one anonymous struct definition and reference at root level. |
| EXPECT_EQ(root_symbol.Value().anonymous_scope_names.size(), 1); |
| ASSERT_EQ(root_symbol.Children().size(), 2); |
| // Find the symbol that is a struct (anon), which is not "data". |
| const auto outer_found = std::find_if(root_symbol.Children().begin(), |
| root_symbol.Children().end(), IsStruct); |
| ASSERT_NE(outer_found, root_symbol.Children().end()); |
| const SymbolTableNode& outer_anon_struct(outer_found->second); |
| const SymbolInfo& outer_anon_struct_info(outer_anon_struct.Value()); |
| EXPECT_EQ(outer_anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(outer_anon_struct_info.local_references_to_bind.size(), 1); |
| // Expect one anonymous struct definition inside the outer struct. |
| EXPECT_EQ(outer_anon_struct_info.anonymous_scope_names.size(), 1); |
| |
| // Outer struct has one member. |
| MUST_ASSIGN_LOOKUP_SYMBOL(struct_foo, outer_anon_struct, "foo"); |
| EXPECT_TRUE(struct_foo.Children().empty()); |
| EXPECT_EQ(struct_foo_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(struct_foo_info.file_origin, &src); |
| EXPECT_NE(struct_foo_info.declared_type.syntax_origin, nullptr); |
| |
| // Inner struct lives in the scope of the outer struct. |
| const auto inner_found = |
| std::find_if(outer_anon_struct.Children().begin(), |
| outer_anon_struct.Children().end(), IsStruct); |
| ASSERT_NE(inner_found, outer_anon_struct.Children().end()); |
| const SymbolTableNode& inner_anon_struct(inner_found->second); |
| const SymbolInfo& inner_anon_struct_info(inner_anon_struct.Value()); |
| EXPECT_EQ(inner_anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(inner_anon_struct_info.local_references_to_bind.empty()); |
| |
| // "foo"'s type is pre-bound to the inner anonymous struct. |
| const ReferenceComponentNode* foo_type = |
| struct_foo_info.declared_type.user_defined_type; |
| ASSERT_NE(foo_type, nullptr); |
| const ReferenceComponent& foo_type_comp(foo_type->Value()); |
| EXPECT_EQ(foo_type_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(foo_type_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(foo_type_comp.resolved_symbol, &inner_anon_struct); |
| |
| // Inner struct has one member. |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_size, inner_anon_struct, "size"); |
| EXPECT_EQ(int_size_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_size_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_size_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_size_info.declared_type.user_defined_type, nullptr); |
| |
| // Expect to bind (outer) anonymous struct immediately. |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 1); |
| const DependentReferences& anon_struct_ref( |
| root_symbol.Value().local_references_to_bind.front()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &outer_anon_struct); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // No change, anonymous types were already bound. |
| EXPECT_EQ(foo_type_comp.resolved_symbol, &inner_anon_struct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &outer_anon_struct); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousStructTypeNestedMemberReference) { |
| TestVerilogSourceFile src("funky_structy.sv", |
| "function int ff();\n" |
| " struct {\n" |
| " struct {\n" |
| " int size;\n" |
| " } foo;\n" |
| " } data;\n" |
| " return data.foo.size;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(function_ff, root_symbol, "ff"); |
| EXPECT_EQ(function_ff_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(function_ff_info.file_origin, &src); |
| |
| // Expect one anonymous struct definition and reference in function. |
| EXPECT_EQ(function_ff_info.anonymous_scope_names.size(), 1); |
| ASSERT_EQ(function_ff.Children().size(), 2); |
| // Find the symbol that is a struct (anon), which is not "data". |
| const auto outer_found = std::find_if(function_ff.Children().begin(), |
| function_ff.Children().end(), IsStruct); |
| ASSERT_NE(outer_found, function_ff.Children().end()); |
| const SymbolTableNode& outer_anon_struct(outer_found->second); |
| const SymbolInfo& outer_anon_struct_info(outer_anon_struct.Value()); |
| EXPECT_EQ(outer_anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(outer_anon_struct_info.local_references_to_bind.size(), 1); |
| // Expect one anonymous struct definition inside the outer struct. |
| EXPECT_EQ(outer_anon_struct_info.anonymous_scope_names.size(), 1); |
| |
| // Outer struct has one member. |
| MUST_ASSIGN_LOOKUP_SYMBOL(struct_foo, outer_anon_struct, "foo"); |
| EXPECT_TRUE(struct_foo.Children().empty()); |
| EXPECT_EQ(struct_foo_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(struct_foo_info.file_origin, &src); |
| EXPECT_NE(struct_foo_info.declared_type.syntax_origin, nullptr); |
| |
| // Inner struct lives in the scope of the outer struct. |
| const auto inner_found = |
| std::find_if(outer_anon_struct.Children().begin(), |
| outer_anon_struct.Children().end(), IsStruct); |
| ASSERT_NE(inner_found, outer_anon_struct.Children().end()); |
| const SymbolTableNode& inner_anon_struct(inner_found->second); |
| const SymbolInfo& inner_anon_struct_info(inner_anon_struct.Value()); |
| EXPECT_EQ(inner_anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(inner_anon_struct_info.local_references_to_bind.empty()); |
| |
| // "foo"'s type is pre-bound to the inner anonymous struct. |
| const ReferenceComponentNode* foo_type = |
| struct_foo_info.declared_type.user_defined_type; |
| ASSERT_NE(foo_type, nullptr); |
| const ReferenceComponent& foo_type_comp(foo_type->Value()); |
| EXPECT_EQ(foo_type_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(foo_type_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(foo_type_comp.resolved_symbol, &inner_anon_struct); |
| |
| // Inner struct has one member. |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_size, inner_anon_struct, "size"); |
| EXPECT_EQ(int_size_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_size_info.file_origin, &src); |
| EXPECT_EQ( |
| verible::StringSpanOfSymbol(*int_size_info.declared_type.syntax_origin), |
| "int"); |
| EXPECT_EQ(int_size_info.declared_type.user_defined_type, nullptr); |
| |
| // Expect to bind (outer) anonymous struct immediately. |
| // First reference to anonymous struct, second reference to "data". |
| ASSERT_EQ(function_ff_info.local_references_to_bind.size(), 2); |
| |
| const DependentReferences& anon_struct_ref( |
| function_ff_info.local_references_to_bind.front()); |
| const ReferenceComponent& anon_struct_ref_comp( |
| anon_struct_ref.components->Value()); |
| EXPECT_EQ(anon_struct_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_struct_ref_comp.required_metatype, SymbolMetaType::kStruct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &outer_anon_struct); |
| |
| // "data"'s type is the (internal) anonymous struct type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, function_ff, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_struct_ref.LastLeaf()); |
| |
| // Find the "data.foo.size" reference |
| const DependentReferences& data_ref( |
| function_ff_info.local_references_to_bind.back()); |
| const ReferenceComponent& data_ref_comp(data_ref.components->Value()); |
| EXPECT_EQ(data_ref_comp.identifier, "data"); |
| EXPECT_EQ(data_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(data_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(data_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(data_foo_ref, data_ref.components->Children()); |
| const ReferenceComponent& data_foo_ref_comp(data_foo_ref.Value()); |
| EXPECT_EQ(data_foo_ref_comp.identifier, "foo"); |
| EXPECT_EQ(data_foo_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(data_foo_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(data_foo_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(data_foo_size_ref, data_foo_ref.Children()); |
| const ReferenceComponent& data_foo_size_ref_comp(data_foo_size_ref.Value()); |
| EXPECT_EQ(data_foo_size_ref_comp.identifier, "size"); |
| EXPECT_EQ(data_foo_size_ref_comp.ref_type, |
| ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(data_foo_size_ref_comp.required_metatype, |
| SymbolMetaType::kUnspecified); |
| EXPECT_EQ(data_foo_size_ref_comp.resolved_symbol, nullptr); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(foo_type_comp.resolved_symbol, &inner_anon_struct); |
| EXPECT_EQ(anon_struct_ref_comp.resolved_symbol, &outer_anon_struct); |
| // Resolve the reference chain "data.foo.size". |
| EXPECT_EQ(data_ref_comp.resolved_symbol, &data); |
| EXPECT_EQ(data_foo_ref_comp.resolved_symbol, &struct_foo); |
| EXPECT_EQ(data_foo_size_ref_comp.resolved_symbol, &int_size); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AnonymousEnumTypeData) { |
| TestVerilogSourceFile src("simple_enum.sv", |
| "enum {\n" |
| " idle, busy\n" |
| "} data;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Expect one anonymous enum definition and reference. |
| EXPECT_EQ(root_symbol.Value().anonymous_scope_names.size(), 1); |
| |
| // Expect four symbols (enum, data, idle, busy) |
| ASSERT_EQ(root_symbol.Children().size(), 4); |
| |
| // Find the symbol that is a enum (anon) |
| const auto found = std::find_if( |
| root_symbol.Children().begin(), root_symbol.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.first != "data" && p.first != "idle" && p.first != "busy"; |
| }); |
| ASSERT_NE(found, root_symbol.Children().end()); |
| const SymbolTableNode& anon_enum(found->second); |
| const SymbolInfo& anon_enum_info(anon_enum.Value()); |
| EXPECT_EQ(anon_enum_info.metatype, SymbolMetaType::kEnumType); |
| EXPECT_TRUE(anon_enum_info.local_references_to_bind.empty()); |
| |
| // Enum has two members. |
| EXPECT_EQ(anon_enum.Children().size(), 2); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(idle, anon_enum, "idle"); |
| EXPECT_EQ(idle_info.metatype, SymbolMetaType::kEnumConstant); |
| EXPECT_EQ(idle_info.file_origin, &src); |
| EXPECT_EQ(idle_info.declared_type.user_defined_type, nullptr); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(busy, anon_enum, "busy"); |
| EXPECT_EQ(busy_info.metatype, SymbolMetaType::kEnumConstant); |
| EXPECT_EQ(busy_info.file_origin, &src); |
| EXPECT_EQ(busy_info.declared_type.user_defined_type, nullptr); |
| |
| // Find idle symbol |
| const auto found_enum_idle = |
| std::find_if(root_symbol.Children().begin(), root_symbol.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.first == "idle"; |
| }); |
| ASSERT_NE(found_enum_idle, root_symbol.Children().end()); |
| const SymbolTableNode& enum_idle(found_enum_idle->second); |
| const SymbolInfo& enum_idle_info(enum_idle.Value()); |
| EXPECT_EQ(enum_idle_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_TRUE(enum_idle_info.local_references_to_bind.empty()); |
| |
| // Find busy symbol |
| const auto found_enum_busy = |
| std::find_if(root_symbol.Children().begin(), root_symbol.Children().end(), |
| [](const SymbolTableNode::key_value_type& p) { |
| return p.first == "busy"; |
| }); |
| ASSERT_NE(found_enum_busy, root_symbol.Children().end()); |
| const SymbolTableNode& enum_busy(found_enum_busy->second); |
| const SymbolInfo& enum_busy_info(enum_busy.Value()); |
| EXPECT_EQ(enum_busy_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_TRUE(enum_busy_info.local_references_to_bind.empty()); |
| |
| // Three references: data and two enum constants |
| ASSERT_EQ(root_symbol.Value().local_references_to_bind.size(), 3); |
| |
| // Expect them to bind immediately. |
| |
| const ReferenceComponent& anon_enum_ref_comp( |
| root_symbol.Value().local_references_to_bind[2].LastLeaf()->Value()); |
| EXPECT_EQ(anon_enum_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(anon_enum_ref_comp.required_metatype, SymbolMetaType::kEnumType); |
| EXPECT_EQ(anon_enum_ref_comp.resolved_symbol, &anon_enum); |
| |
| const ReferenceComponent& enum_idle_ref_comp( |
| root_symbol.Value().local_references_to_bind[0].LastLeaf()->Value()); |
| EXPECT_EQ(enum_idle_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(enum_idle_ref_comp.required_metatype, |
| SymbolMetaType::kEnumConstant); |
| EXPECT_EQ(enum_idle_ref_comp.resolved_symbol, &busy); |
| |
| const ReferenceComponent& enum_busy_ref_comp( |
| root_symbol.Value().local_references_to_bind[1].LastLeaf()->Value()); |
| EXPECT_EQ(enum_busy_ref_comp.ref_type, ReferenceType::kImmediate); |
| EXPECT_EQ(enum_busy_ref_comp.required_metatype, |
| SymbolMetaType::kEnumConstant); |
| EXPECT_EQ(enum_busy_ref_comp.resolved_symbol, &idle); |
| |
| // "data"'s type is the (internal) anonymous enum type reference. |
| MUST_ASSIGN_LOOKUP_SYMBOL(data, root_symbol, "data"); |
| EXPECT_EQ(data_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(data_info.file_origin, &src); |
| |
| const DependentReferences& anon_enum_ref( |
| root_symbol.Value().local_references_to_bind[2]); |
| EXPECT_EQ(data_info.declared_type.user_defined_type, |
| anon_enum_ref.LastLeaf()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Make sure that resolve doesn't change/break anything |
| EXPECT_EQ(anon_enum_ref_comp.resolved_symbol, &anon_enum); |
| EXPECT_EQ(enum_idle_ref_comp.resolved_symbol, &busy); |
| EXPECT_EQ(enum_busy_ref_comp.resolved_symbol, &idle); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefPrimitive) { |
| TestVerilogSourceFile src("typedef.sv", |
| "typedef int number;\n" |
| "number one = 1;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(one_var, root_symbol, "one"); |
| EXPECT_EQ(one_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(one_var_info.file_origin, &src); |
| |
| // Expect one type reference to "number". |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, |
| root_symbol.Value().local_references_to_bind); |
| const ReferenceComponent& number_ref_comp(number_ref.components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(one_var_info.declared_type.user_defined_type, |
| number_ref.components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve type "number" to the typedef. |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefTransitive) { |
| TestVerilogSourceFile src("typedef.sv", |
| "typedef int num;\n" |
| "typedef num number;\n" |
| "number one = 1;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(num_typedef, root_symbol, "num"); |
| EXPECT_EQ(num_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(num_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(one_var, root_symbol, "one"); |
| EXPECT_EQ(one_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(one_var_info.file_origin, &src); |
| |
| const auto ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| |
| // Expect one type reference to "num". |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(num_ref, ref_map, "num"); |
| const ReferenceComponent& num_ref_comp(num_ref->components->Value()); |
| EXPECT_EQ(num_ref_comp.identifier, "num"); |
| EXPECT_EQ(num_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(num_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(num_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect one type reference to "number". |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(number_ref, ref_map, "number"); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(number_typedef_info.declared_type.user_defined_type, |
| num_ref->components.get()); |
| EXPECT_EQ(one_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve type "num" to the typedef. |
| EXPECT_EQ(num_ref_comp.resolved_symbol, &num_typedef); |
| // Resolve type "number" to the typedef. |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefClass) { |
| TestVerilogSourceFile src("typedef.sv", |
| "class cc;\n" |
| "endclass\n" |
| "typedef cc number;\n" |
| "number foo;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, root_symbol, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, root_symbol, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| // Expect one type reference to "number", and one to "cc". |
| const auto& ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(cc_type_refs, ref_map, "cc"); |
| ASSIGN_MUST_HAVE_UNIQUE(cc_type_ref, cc_type_refs); |
| const ReferenceComponent& cc_type_ref_comp(cc_type_ref->components->Value()); |
| EXPECT_EQ(cc_type_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND(number_refs, ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, &cc_class); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefClassPackageQualified) { |
| TestVerilogSourceFile src("typedef.sv", |
| "package pp;\n" |
| " class cc;\n" |
| " endclass\n" |
| "endpackage\n" |
| "typedef pp::cc number;\n" |
| "number foo;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_package, root_symbol, "pp"); |
| EXPECT_EQ(pp_package_info.metatype, SymbolMetaType::kPackage); |
| EXPECT_EQ(pp_package_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, pp_package, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, root_symbol, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| const auto& ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| |
| // Expect one type reference to "pp::cc". |
| ASSIGN_MUST_FIND(pp_type_refs, ref_map, "pp"); |
| ASSIGN_MUST_HAVE_UNIQUE(pp_type_ref, pp_type_refs); |
| const ReferenceComponent& pp_type_ref_comp(pp_type_ref->components->Value()); |
| EXPECT_EQ(pp_type_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_type_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(cc_type_ref, pp_type_ref->components->Children()); |
| const ReferenceComponent& cc_type_ref_comp(cc_type_ref.Value()); |
| EXPECT_EQ(cc_type_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_type_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect one type reference to "number". |
| ASSIGN_MUST_FIND(number_refs, ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(pp_type_ref_comp.resolved_symbol, &pp_package); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, &cc_class); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefClassUnresolvedQualifiedReferenceBase) { |
| TestVerilogSourceFile src("typedef.sv", |
| "typedef pp::cc number;\n" // unresolved |
| "number foo;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, root_symbol, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| const auto& ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| |
| // Expect one type reference to "pp::cc". |
| ASSIGN_MUST_FIND(pp_type_refs, ref_map, "pp"); |
| ASSIGN_MUST_HAVE_UNIQUE(pp_type_ref, pp_type_refs); |
| const ReferenceComponent& pp_type_ref_comp(pp_type_ref->components->Value()); |
| EXPECT_EQ(pp_type_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_type_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(cc_type_ref, pp_type_ref->components->Children()); |
| const ReferenceComponent& cc_type_ref_comp(cc_type_ref.Value()); |
| EXPECT_EQ(cc_type_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_type_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect one type reference to "number". |
| ASSIGN_MUST_FIND(number_refs, ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| |
| EXPECT_EQ(pp_type_ref_comp.resolved_symbol, nullptr); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, nullptr); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefClassPartiallyResolvedQualifiedReference) { |
| TestVerilogSourceFile src( |
| "typedef.sv", |
| "package pp;\n" // empty |
| "endpackage\n" |
| "typedef pp::cc::dd number;\n" // unresolved at "cc" |
| "number foo;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(package_pp, root_symbol, "pp"); |
| EXPECT_EQ(package_pp_info.metatype, SymbolMetaType::kPackage); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, root_symbol, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| const auto& ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| |
| // Expect one type reference to "pp::cc::dd". |
| ASSIGN_MUST_FIND(pp_type_refs, ref_map, "pp"); |
| ASSIGN_MUST_HAVE_UNIQUE(pp_type_ref, pp_type_refs); |
| const ReferenceComponent& pp_type_ref_comp(pp_type_ref->components->Value()); |
| EXPECT_EQ(pp_type_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_type_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(cc_type_ref, pp_type_ref->components->Children()); |
| const ReferenceComponent& cc_type_ref_comp(cc_type_ref.Value()); |
| EXPECT_EQ(cc_type_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_type_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(dd_type_ref, cc_type_ref.Children()); |
| const ReferenceComponent& dd_type_ref_comp(dd_type_ref.Value()); |
| EXPECT_EQ(dd_type_ref_comp.identifier, "dd"); |
| EXPECT_EQ(dd_type_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(dd_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(dd_type_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect one type reference to "number". |
| ASSIGN_MUST_FIND(number_refs, ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kNotFound); |
| |
| EXPECT_EQ(pp_type_ref_comp.resolved_symbol, &package_pp); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, nullptr); // chain fails here |
| EXPECT_EQ(dd_type_ref_comp.resolved_symbol, nullptr); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefOfClassTypeParameter) { |
| TestVerilogSourceFile src("typedef.sv", |
| "class cc #(parameter type T = int);\n" |
| " typedef T number;\n" |
| " number foo;\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, root_symbol, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, cc_class, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, cc_class, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, cc_class, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| // Expect one type reference to "number", and one to "T". |
| const auto& ref_map(cc_class_info.LocalReferencesMapViewForTesting()); |
| |
| ASSIGN_MUST_FIND(t_type_refs, ref_map, "T"); |
| ASSIGN_MUST_HAVE_UNIQUE(t_type_ref, t_type_refs); |
| const ReferenceComponent& t_type_ref_comp(t_type_ref->components->Value()); |
| EXPECT_EQ(t_type_ref_comp.identifier, "T"); |
| EXPECT_EQ(t_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(t_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(t_type_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND(number_refs, ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // "number" is type-aliased to "T" |
| EXPECT_EQ(t_type_ref_comp.resolved_symbol, &t_type_param); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefOfParameterizedClassPositionalParams) { |
| TestVerilogSourceFile src("typedef.sv", |
| "package pp;\n" |
| " class cc #(parameter type T = int);\n" |
| " endclass\n" |
| "endpackage\n" |
| "typedef pp::cc#(pp::cc#(int)) number;\n" |
| "number foo;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_package, root_symbol, "pp"); |
| EXPECT_EQ(pp_package_info.metatype, SymbolMetaType::kPackage); |
| EXPECT_EQ(pp_package_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, pp_package, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, cc_class, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, root_symbol, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| const auto& ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| // Expect one type reference to "number". |
| ASSIGN_MUST_FIND(number_refs, ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect two type references to "pp::cc". |
| ASSIGN_MUST_FIND(pp_refs, ref_map, "pp"); |
| EXPECT_EQ(pp_refs.size(), 2); |
| for (const auto& pp_ref_iter : pp_refs) { |
| const ReferenceComponent& pp_ref_comp(pp_ref_iter->components->Value()); |
| EXPECT_EQ(pp_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(cc_ref, pp_ref_iter->components->Children()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve "pp::cc" type references |
| for (const auto& pp_ref_iter : pp_refs) { |
| const ReferenceComponent& pp_ref_comp(pp_ref_iter->components->Value()); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, &pp_package); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(cc_ref, pp_ref_iter->components->Children()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &cc_class); |
| } |
| // Resolve "number" type reference. |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, TypedefOfParameterizedClassNamedParams) { |
| TestVerilogSourceFile src("typedef.sv", |
| "package pp;\n" |
| " class cc #(parameter type T = int);\n" |
| " endclass\n" |
| "endpackage\n" |
| "typedef pp::cc#(.T(pp::cc#(.T(int)))) number;\n" |
| "number foo;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_package, root_symbol, "pp"); |
| EXPECT_EQ(pp_package_info.metatype, SymbolMetaType::kPackage); |
| EXPECT_EQ(pp_package_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, pp_package, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(t_type_param, cc_class, "T"); |
| EXPECT_EQ(t_type_param_info.metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_type_param_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, root_symbol, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| const auto& ref_map(root_symbol.Value().LocalReferencesMapViewForTesting()); |
| // Expect one type reference to "number". |
| ASSIGN_MUST_FIND(number_refs, ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect two type references to "pp::cc#(.T(...))". |
| ASSIGN_MUST_FIND(pp_refs, ref_map, "pp"); |
| EXPECT_EQ(pp_refs.size(), 2); |
| for (const auto& pp_ref_iter : pp_refs) { |
| const ReferenceComponent& pp_ref_comp(pp_ref_iter->components->Value()); |
| EXPECT_EQ(pp_ref_comp.identifier, "pp"); |
| EXPECT_EQ(pp_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(cc_ref, pp_ref_iter->components->Children()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(cc_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(t_param_ref, cc_ref.Children()); |
| const ReferenceComponent& t_param_ref_comp(t_param_ref.Value()); |
| EXPECT_EQ(t_param_ref_comp.identifier, "T"); |
| EXPECT_EQ(t_param_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(t_param_ref_comp.required_metatype, SymbolMetaType::kParameter); |
| EXPECT_EQ(t_param_ref_comp.resolved_symbol, nullptr); |
| } |
| |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve "pp::cc#(.T(...))" type references |
| for (const auto& pp_ref_iter : pp_refs) { |
| const ReferenceComponent& pp_ref_comp(pp_ref_iter->components->Value()); |
| EXPECT_EQ(pp_ref_comp.resolved_symbol, &pp_package); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(cc_ref, pp_ref_iter->components->Children()); |
| const ReferenceComponent& cc_ref_comp(cc_ref.Value()); |
| EXPECT_EQ(cc_ref_comp.resolved_symbol, &cc_class); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(t_param_ref, cc_ref.Children()); |
| const ReferenceComponent& t_param_ref_comp(t_param_ref.Value()); |
| EXPECT_EQ(t_param_ref_comp.resolved_symbol, &t_type_param); |
| } |
| // Resolve "number" type reference. |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, InvalidMemberLookupOfAliasedType) { |
| TestVerilogSourceFile src("typedef.sv", |
| "typedef int number;\n" |
| "typedef number::count bar;\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| EXPECT_EQ(number_typedef_info.declared_type.user_defined_type, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *number_typedef_info.declared_type.syntax_origin), |
| "int"); |
| |
| // Expect one type reference to "number". |
| const auto& get_count_ref_map( |
| root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(number_refs, get_count_ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(number_count_ref, number_ref->components->Children()); |
| const ReferenceComponent& number_count_ref_comp(number_count_ref.Value()); |
| EXPECT_EQ(number_count_ref_comp.identifier, "count"); |
| EXPECT_EQ(number_count_ref_comp.ref_type, ReferenceType::kDirectMember); |
| EXPECT_EQ(number_count_ref_comp.required_metatype, |
| SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_count_ref_comp.resolved_symbol, nullptr); |
| |
| // Expect one type reference to "number". |
| MUST_ASSIGN_LOOKUP_SYMBOL(bar, root_symbol, "bar"); |
| EXPECT_EQ(bar_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(bar_info.file_origin, &src); |
| // type of "bar" is "number::count" |
| EXPECT_EQ(bar_info.declared_type.user_defined_type, &number_count_ref); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), HasSubstr("Canonical type of ")); |
| EXPECT_THAT(err.message(), HasSubstr("does not have any members")); |
| |
| // Resolving "number::count" should fail. |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| EXPECT_EQ(number_count_ref_comp.resolved_symbol, nullptr); // failed |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, InvalidMemberLookupOfTypedefPrimitive) { |
| TestVerilogSourceFile src("typedef.sv", |
| "typedef int number;\n" |
| "function int get_count(number foo);\n" |
| " return foo.count;\n" // invalid member |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| EXPECT_EQ(number_typedef_info.declared_type.user_defined_type, nullptr); |
| EXPECT_EQ(verible::StringSpanOfSymbol( |
| *number_typedef_info.declared_type.syntax_origin), |
| "int"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, root_symbol, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(get_count_info.file_origin, &src); |
| EXPECT_EQ(get_count_info.declared_type.user_defined_type, nullptr); // int |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, get_count, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| // Expect one type reference to "number". |
| const auto& get_count_ref_map( |
| get_count_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(number_refs, get_count_ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND(foo_refs, get_count_ref_map, "foo"); |
| ASSIGN_MUST_HAVE_UNIQUE(foo_ref, foo_refs); |
| const ReferenceComponent& foo_ref_comp(foo_ref->components->Value()); |
| EXPECT_EQ(foo_ref_comp.identifier, "foo"); |
| EXPECT_EQ(foo_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(foo_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(foo_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(foo_count_ref, foo_ref->components->Children()); |
| const ReferenceComponent& foo_count_ref_comp(foo_count_ref.Value()); |
| EXPECT_EQ(foo_count_ref_comp.identifier, "count"); |
| EXPECT_EQ(foo_count_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(foo_count_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(foo_count_ref_comp.resolved_symbol, nullptr); |
| |
| // type of "foo" is "number" |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| ASSIGN_MUST_HAVE_UNIQUE(err, resolve_diagnostics); |
| EXPECT_EQ(err.code(), absl::StatusCode::kInvalidArgument); |
| EXPECT_THAT(err.message(), HasSubstr("Canonical type of ")); |
| EXPECT_THAT(err.message(), HasSubstr("does not have any members")); |
| |
| // Resolve "foo.count" to "cc::count" through typedef "number" |
| EXPECT_EQ(foo_ref_comp.resolved_symbol, &foo_var); |
| EXPECT_EQ(foo_count_ref_comp.resolved_symbol, nullptr); // failed |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AccessClassMemberThroughTypedef) { |
| TestVerilogSourceFile src("typedef.sv", |
| "class cc;\n" |
| " int count;\n" |
| "endclass\n" |
| "typedef cc number;\n" |
| "function int get_count(number foo);\n" |
| " return foo.count;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(cc_class, root_symbol, "cc"); |
| EXPECT_EQ(cc_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(cc_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_count, cc_class, "count"); |
| EXPECT_EQ(int_count_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_count_info.file_origin, &src); |
| EXPECT_EQ(int_count_info.declared_type.user_defined_type, nullptr); // int |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, root_symbol, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(get_count_info.file_origin, &src); |
| EXPECT_EQ(get_count_info.declared_type.user_defined_type, nullptr); // int |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, get_count, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| // Expect one type reference to "cc". |
| const auto& root_ref_map( |
| root_symbol.Value().LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(cc_type_refs, root_ref_map, "cc"); |
| ASSIGN_MUST_HAVE_UNIQUE(cc_type_ref, cc_type_refs); |
| const ReferenceComponent& cc_type_ref_comp(cc_type_ref->components->Value()); |
| EXPECT_EQ(cc_type_ref_comp.identifier, "cc"); |
| EXPECT_EQ(cc_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(cc_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(number_typedef_info.declared_type.user_defined_type, |
| cc_type_ref->LastTypeComponent()); |
| |
| // Expect one type reference to "number". |
| const auto& get_count_ref_map( |
| get_count_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(number_refs, get_count_ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND(foo_refs, get_count_ref_map, "foo"); |
| ASSIGN_MUST_HAVE_UNIQUE(foo_ref, foo_refs); |
| const ReferenceComponent& foo_ref_comp(foo_ref->components->Value()); |
| EXPECT_EQ(foo_ref_comp.identifier, "foo"); |
| EXPECT_EQ(foo_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(foo_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(foo_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(foo_count_ref, foo_ref->components->Children()); |
| const ReferenceComponent& foo_count_ref_comp(foo_count_ref.Value()); |
| EXPECT_EQ(foo_count_ref_comp.identifier, "count"); |
| EXPECT_EQ(foo_count_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(foo_count_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(foo_count_ref_comp.resolved_symbol, nullptr); |
| |
| // type of "foo" is "number" |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve "foo.count" to "cc::count" through typedef "number" |
| EXPECT_EQ(cc_type_ref_comp.resolved_symbol, &cc_class); |
| EXPECT_EQ(foo_ref_comp.resolved_symbol, &foo_var); |
| EXPECT_EQ(foo_count_ref_comp.resolved_symbol, &int_count); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| TEST(BuildSymbolTableTest, AccessStructMemberThroughTypedef) { |
| TestVerilogSourceFile src("typedef.sv", |
| "typedef struct {\n" |
| " int count;\n" |
| "} number;\n" |
| "function int get_count(number foo);\n" |
| " return foo.count;\n" |
| "endfunction\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Find the symbol that is a struct (anon). |
| const auto found = std::find_if(root_symbol.Children().begin(), |
| root_symbol.Children().end(), IsStruct); |
| ASSERT_NE(found, root_symbol.Children().end()); |
| const SymbolTableNode& anon_struct(found->second); |
| const SymbolInfo& anon_struct_info(anon_struct.Value()); |
| EXPECT_EQ(anon_struct_info.metatype, SymbolMetaType::kStruct); |
| EXPECT_TRUE(anon_struct_info.local_references_to_bind.empty()); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(int_count, anon_struct, "count"); |
| EXPECT_EQ(int_count_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(int_count_info.file_origin, &src); |
| EXPECT_EQ(int_count_info.declared_type.user_defined_type, nullptr); // int |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, root_symbol, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(get_count, root_symbol, "get_count"); |
| EXPECT_EQ(get_count_info.metatype, SymbolMetaType::kFunction); |
| EXPECT_EQ(get_count_info.file_origin, &src); |
| EXPECT_EQ(get_count_info.declared_type.user_defined_type, nullptr); // int |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(foo_var, get_count, "foo"); |
| EXPECT_EQ(foo_var_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(foo_var_info.file_origin, &src); |
| |
| // typedef struct is already resolved. |
| ASSERT_NE(number_typedef_info.declared_type.user_defined_type, nullptr); |
| EXPECT_EQ(number_typedef_info.declared_type.user_defined_type->Value() |
| .resolved_symbol, |
| &anon_struct); |
| |
| // Expect one type reference to "number". |
| const auto& get_count_ref_map( |
| get_count_info.LocalReferencesMapViewForTesting()); |
| ASSIGN_MUST_FIND(number_refs, get_count_ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_FIND(foo_refs, get_count_ref_map, "foo"); |
| ASSIGN_MUST_HAVE_UNIQUE(foo_ref, foo_refs); |
| const ReferenceComponent& foo_ref_comp(foo_ref->components->Value()); |
| EXPECT_EQ(foo_ref_comp.identifier, "foo"); |
| EXPECT_EQ(foo_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(foo_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(foo_ref_comp.resolved_symbol, nullptr); |
| |
| ASSIGN_MUST_HAVE_UNIQUE(foo_count_ref, foo_ref->components->Children()); |
| const ReferenceComponent& foo_count_ref_comp(foo_count_ref.Value()); |
| EXPECT_EQ(foo_count_ref_comp.identifier, "count"); |
| EXPECT_EQ(foo_count_ref_comp.ref_type, ReferenceType::kMemberOfTypeOfParent); |
| EXPECT_EQ(foo_count_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(foo_count_ref_comp.resolved_symbol, nullptr); |
| |
| // type of "foo" is "number" |
| EXPECT_EQ(foo_var_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Resolve "foo.count" to "cc::count" through typedef "number" |
| EXPECT_EQ(foo_ref_comp.resolved_symbol, &foo_var); |
| EXPECT_EQ(foo_count_ref_comp.resolved_symbol, &int_count); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| TEST(BuildSymbolTableTest, InheritBaseClassThroughTypedef) { |
| TestVerilogSourceFile src("typedef.sv", |
| "class base;\n" |
| " typedef int number;\n" |
| "endclass\n" |
| "typedef base base_alias;\n" |
| "class derived extends base_alias;\n" |
| " number count;\n" |
| "endclass\n"); |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_class, root_symbol, "base"); |
| EXPECT_EQ(base_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(number_typedef, base_class, "number"); |
| EXPECT_EQ(number_typedef_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(number_typedef_info.file_origin, &src); |
| EXPECT_EQ(number_typedef_info.declared_type.user_defined_type, |
| nullptr); // int |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(base_alias, root_symbol, "base_alias"); |
| EXPECT_EQ(base_alias_info.metatype, SymbolMetaType::kTypeAlias); |
| EXPECT_EQ(base_alias_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(derived_class, root_symbol, "derived"); |
| EXPECT_EQ(derived_class_info.metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(derived_class_info.file_origin, &src); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(count, derived_class, "count"); |
| EXPECT_EQ(count_info.metatype, SymbolMetaType::kDataNetVariableInstance); |
| EXPECT_EQ(count_info.file_origin, &src); |
| |
| const auto& root_ref_map( |
| root_symbol.Value().LocalReferencesMapViewForTesting()); |
| |
| // Expect one reference to "base" |
| ASSIGN_MUST_FIND(base_type_refs, root_ref_map, "base"); |
| ASSIGN_MUST_HAVE_UNIQUE(base_type_ref, base_type_refs); |
| const ReferenceComponent& base_type_ref_comp( |
| base_type_ref->components->Value()); |
| EXPECT_EQ(base_type_ref_comp.identifier, "base"); |
| EXPECT_EQ(base_type_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(base_type_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(base_type_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(base_alias_info.declared_type.user_defined_type, |
| base_type_ref->components.get()); |
| |
| // Expect one reference to "base_alias" |
| ASSIGN_MUST_FIND(base_alias_refs, root_ref_map, "base_alias"); |
| ASSIGN_MUST_HAVE_UNIQUE(base_alias_ref, base_alias_refs); |
| const ReferenceComponent& base_alias_ref_comp( |
| base_alias_ref->components->Value()); |
| EXPECT_EQ(base_alias_ref_comp.identifier, "base_alias"); |
| EXPECT_EQ(base_alias_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(base_alias_ref_comp.required_metatype, SymbolMetaType::kClass); |
| EXPECT_EQ(base_alias_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(derived_class_info.parent_type.user_defined_type, |
| base_alias_ref->components.get()); |
| |
| const auto& derived_ref_map( |
| derived_class_info.LocalReferencesMapViewForTesting()); |
| |
| // Expect one type reference to "number". |
| ASSIGN_MUST_FIND(number_refs, derived_ref_map, "number"); |
| ASSIGN_MUST_HAVE_UNIQUE(number_ref, number_refs); |
| const ReferenceComponent& number_ref_comp(number_ref->components->Value()); |
| EXPECT_EQ(number_ref_comp.identifier, "number"); |
| EXPECT_EQ(number_ref_comp.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(number_ref_comp.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(number_ref_comp.resolved_symbol, nullptr); |
| |
| EXPECT_EQ(count_info.declared_type.user_defined_type, |
| number_ref->components.get()); |
| |
| { |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| EXPECT_EQ(base_type_ref_comp.resolved_symbol, &base_class); |
| EXPECT_EQ(base_alias_ref_comp.resolved_symbol, &base_alias); |
| // "number" is resolved to "base::number" |
| EXPECT_EQ(number_ref_comp.resolved_symbol, &number_typedef); |
| } |
| } |
| |
| static bool SourceFileLess(const TestVerilogSourceFile* left, |
| const TestVerilogSourceFile* right) { |
| return left->ReferencedPath() < right->ReferencedPath(); |
| } |
| |
| static void SortSourceFiles( |
| std::vector<const TestVerilogSourceFile*>* sources) { |
| std::sort(sources->begin(), sources->end(), SourceFileLess); |
| } |
| |
| static bool PermuteSourceFiles( |
| std::vector<const TestVerilogSourceFile*>* sources) { |
| return std::next_permutation(sources->begin(), sources->end(), |
| SourceFileLess); |
| } |
| |
| TEST(BuildSymbolTableTest, MultiFileModuleInstance) { |
| // Linear dependency chain between 3 files. |
| TestVerilogSourceFile pp_src("pp.sv", |
| "module pp;\n" |
| "endmodule\n"); |
| TestVerilogSourceFile qq_src("qq.sv", |
| "module qq;\n" |
| " pp pp_inst();\n" // instance |
| "endmodule\n"); |
| TestVerilogSourceFile ss_src("ss.sv", |
| "module ss;\n" |
| " qq qq_inst();\n" // instance |
| "endmodule\n"); |
| { |
| const auto status = pp_src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| } |
| { |
| const auto status = qq_src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| } |
| { |
| const auto status = ss_src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| } |
| |
| // All permutations of the following file ordering should end up with the |
| // same results. |
| std::vector<const TestVerilogSourceFile*> ordering( |
| {&pp_src, &qq_src, &ss_src}); |
| // start with the lexicographically "lowest" permutation |
| SortSourceFiles(&ordering); |
| int count = 0; |
| do { |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| for (const auto* src : ordering) { |
| const auto build_diagnostics = BuildSymbolTable(*src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| } |
| |
| // Goal: resolve the reference of "pp" to this definition node. |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ss, root_symbol, "ss"); |
| |
| // "pp_inst" is an instance of type "pp" |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_inst, qq, "pp_inst"); |
| |
| // "qq_inst" is an instance of type "qq" |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq_inst, ss, "qq_inst"); |
| |
| EXPECT_EQ(pp_info.file_origin, &pp_src); |
| EXPECT_EQ(qq_info.file_origin, &qq_src); |
| EXPECT_EQ(ss_info.file_origin, &ss_src); |
| { |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 2); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| qq_src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "pp_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_inst_self_ref, ref_map, "pp_inst"); |
| EXPECT_TRUE(is_leaf(*pp_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(pp_inst_self_ref->components->Value().resolved_symbol, |
| &pp_inst); |
| } |
| } |
| { |
| ASSERT_EQ(ss_info.local_references_to_bind.size(), 2); |
| const auto ref_map(ss_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_type, ref_map, "qq"); |
| const ReferenceComponentNode* ref_node = qq_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "qq"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| ss_src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "qq_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_inst_self_ref, ref_map, "qq_inst"); |
| EXPECT_TRUE(is_leaf(*qq_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(qq_inst_self_ref->components->Value().resolved_symbol, |
| &qq_inst); |
| } |
| } |
| |
| { // Verify pp_inst's type info |
| EXPECT_TRUE(pp_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(pp_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& pp_type( |
| pp_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_inst_info.file_origin, &qq_src); |
| } |
| |
| { // Verify qq_inst's type info |
| EXPECT_TRUE(qq_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(qq_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& qq_type( |
| qq_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(qq_type.identifier, "qq"); |
| EXPECT_EQ(qq_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(qq_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(qq_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(qq_inst_info.file_origin, &ss_src); |
| } |
| |
| // Resolve symbols. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Verify that typeof(pp_inst) successfully resolved to module pp. |
| EXPECT_EQ( |
| pp_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &pp); |
| // Verify that typeof(qq_inst) successfully resolved to module qq. |
| EXPECT_EQ( |
| qq_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &qq); |
| ++count; |
| } while (PermuteSourceFiles(&ordering)); |
| EXPECT_EQ(count, 6); // make sure we covered all permutations |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstancesFromProjectOneFileAtATime) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| VerilogProject project(sources_dir, {/* no include path */}); |
| |
| // Linear dependency chain between 3 files. Order arbitrarily chosen. |
| constexpr absl::string_view // |
| text1( |
| "module ss;\n" |
| " qq qq_inst();\n" // instance |
| "endmodule\n"), |
| text2( |
| "module pp;\n" |
| "endmodule\n"), |
| text3( |
| "module qq;\n" |
| " pp pp_inst();\n" // instance |
| "endmodule\n"); |
| // Write to temporary files. |
| const ScopedTestFile file1(sources_dir, text1); |
| const ScopedTestFile file2(sources_dir, text2); |
| const ScopedTestFile file3(sources_dir, text3); |
| |
| // Register files as part of project. |
| for (const auto* file : {&file1, &file2, &file3}) { |
| const auto status_or_file = |
| project.OpenTranslationUnit(Basename(file->filename())); |
| ASSERT_TRUE(status_or_file.ok()); |
| } |
| |
| SymbolTable symbol_table(&project); |
| EXPECT_EQ(symbol_table.Project(), &project); |
| |
| // Caller decides order of processing files, which doesn't matter for this |
| // example. |
| std::vector<absl::Status> build_diagnostics; |
| for (const auto* file : {&file3, &file2, &file1}) { |
| symbol_table.BuildSingleTranslationUnit(Basename(file->filename()), |
| &build_diagnostics); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| } |
| |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| // Goal: resolve the reference of "pp" to this definition node. |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ss, root_symbol, "ss"); |
| |
| // "pp_inst" is an instance of type "pp" |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_inst, qq, "pp_inst"); |
| |
| // "qq_inst" is an instance of type "qq" |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq_inst, ss, "qq_inst"); |
| |
| { |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 2); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "pp_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_inst_self_ref, ref_map, "pp_inst"); |
| EXPECT_TRUE(is_leaf(*pp_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(pp_inst_self_ref->components->Value().resolved_symbol, |
| &pp_inst); |
| } |
| } |
| { |
| ASSERT_EQ(ss_info.local_references_to_bind.size(), 2); |
| const auto ref_map(ss_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_type, ref_map, "qq"); |
| const ReferenceComponentNode* ref_node = qq_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "qq"); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "qq_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_inst_self_ref, ref_map, "qq_inst"); |
| EXPECT_TRUE(is_leaf(*qq_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(qq_inst_self_ref->components->Value().resolved_symbol, |
| &qq_inst); |
| } |
| } |
| |
| { // Verify pp_inst's type info |
| EXPECT_TRUE(pp_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(pp_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& pp_type( |
| pp_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| } |
| |
| { // Verify qq_inst's type info |
| EXPECT_TRUE(qq_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(qq_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& qq_type( |
| qq_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(qq_type.identifier, "qq"); |
| EXPECT_EQ(qq_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(qq_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(qq_type.required_metatype, SymbolMetaType::kUnspecified); |
| } |
| |
| // Resolve symbols. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Verify that typeof(pp_inst) successfully resolved to module pp. |
| EXPECT_EQ( |
| pp_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &pp); |
| // Verify that typeof(qq_inst) successfully resolved to module qq. |
| EXPECT_EQ( |
| qq_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &qq); |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstancesFromProjectMissingFile) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| VerilogProject project(sources_dir, {/* no include path */}); |
| |
| SymbolTable symbol_table(&project); |
| EXPECT_EQ(symbol_table.Project(), &project); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.BuildSingleTranslationUnit("file/not/found.txt", |
| &build_diagnostics); |
| ASSERT_FALSE(build_diagnostics.empty()); |
| EXPECT_THAT(build_diagnostics.front().code(), absl::StatusCode::kNotFound); |
| } |
| |
| TEST(BuildSymbolTableTest, ModuleInstancesFromProjectFilesGood) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| VerilogProject project(sources_dir, {/* no include path */}); |
| |
| // Linear dependency chain between 3 files. Order arbitrarily chosen. |
| constexpr absl::string_view // |
| text1( |
| "module ss;\n" |
| " qq qq_inst();\n" // instance |
| "endmodule\n"), |
| text2( |
| "module pp;\n" |
| "endmodule\n"), |
| text3( |
| "module qq;\n" |
| " pp pp_inst();\n" // instance |
| "endmodule\n"); |
| // Write to temporary files. |
| const ScopedTestFile file1(sources_dir, text1); |
| const ScopedTestFile file2(sources_dir, text2); |
| const ScopedTestFile file3(sources_dir, text3); |
| |
| // Register files as part of project. |
| for (const auto* file : {&file1, &file2, &file3}) { |
| const auto status_or_file = |
| project.OpenTranslationUnit(Basename(file->filename())); |
| ASSERT_TRUE(status_or_file.ok()); |
| } |
| |
| SymbolTable symbol_table(&project); |
| EXPECT_EQ(symbol_table.Project(), &project); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.Build(&build_diagnostics); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| // Goal: resolve the reference of "pp" to this definition node. |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ss, root_symbol, "ss"); |
| |
| // "pp_inst" is an instance of type "pp" |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_inst, qq, "pp_inst"); |
| |
| // "qq_inst" is an instance of type "qq" |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq_inst, ss, "qq_inst"); |
| |
| { |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 2); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "pp_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_inst_self_ref, ref_map, "pp_inst"); |
| EXPECT_TRUE(is_leaf(*pp_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(pp_inst_self_ref->components->Value().resolved_symbol, |
| &pp_inst); |
| } |
| } |
| { |
| ASSERT_EQ(ss_info.local_references_to_bind.size(), 2); |
| const auto ref_map(ss_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_type, ref_map, "qq"); |
| const ReferenceComponentNode* ref_node = qq_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "qq"); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "qq_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_inst_self_ref, ref_map, "qq_inst"); |
| EXPECT_TRUE(is_leaf(*qq_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(qq_inst_self_ref->components->Value().resolved_symbol, |
| &qq_inst); |
| } |
| } |
| |
| { // Verify pp_inst's type info |
| EXPECT_TRUE(pp_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(pp_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& pp_type( |
| pp_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| } |
| |
| { // Verify qq_inst's type info |
| EXPECT_TRUE(qq_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(qq_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& qq_type( |
| qq_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(qq_type.identifier, "qq"); |
| EXPECT_EQ(qq_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(qq_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(qq_type.required_metatype, SymbolMetaType::kUnspecified); |
| } |
| |
| // Resolve symbols. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Verify that typeof(pp_inst) successfully resolved to module pp. |
| EXPECT_EQ( |
| pp_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &pp); |
| // Verify that typeof(qq_inst) successfully resolved to module qq. |
| EXPECT_EQ( |
| qq_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &qq); |
| } |
| |
| TEST(BuildSymbolTableTest, SingleFileModuleInstanceCyclicDependencies) { |
| // Cyclic dependencies among three modules in one file. |
| // Make sure this can still build and resolve without hanging, |
| // even if this is semantically illegal. |
| TestVerilogSourceFile src("cycle.sv", |
| "module pp;\n" |
| " ss ss_inst();\n" // instance |
| "endmodule\n" |
| "module qq;\n" |
| " pp pp_inst();\n" // instance |
| "endmodule\n" |
| "module ss;\n" |
| " qq qq_inst();\n" // instance |
| "endmodule\n"); |
| { |
| const auto status = src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| } |
| |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| const auto build_diagnostics = BuildSymbolTable(src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Goal: resolve the reference of "pp" to this definition node. |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ss, root_symbol, "ss"); |
| |
| // "ss_inst" is an instance of type "ss" |
| MUST_ASSIGN_LOOKUP_SYMBOL(ss_inst, pp, "ss_inst"); |
| |
| // "pp_inst" is an instance of type "pp" |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_inst, qq, "pp_inst"); |
| |
| // "qq_inst" is an instance of type "qq" |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq_inst, ss, "qq_inst"); |
| |
| EXPECT_EQ(pp_info.file_origin, &src); |
| EXPECT_EQ(qq_info.file_origin, &src); |
| EXPECT_EQ(ss_info.file_origin, &src); |
| { |
| ASSERT_EQ(pp_info.local_references_to_bind.size(), 2); |
| const auto ref_map(pp_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(ss_type, ref_map, "ss"); |
| const ReferenceComponentNode* ref_node = ss_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "ss"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "ss_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(ss_inst_self_ref, ref_map, "ss_inst"); |
| EXPECT_TRUE(is_leaf(*ss_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(ss_inst_self_ref->components->Value().resolved_symbol, |
| &ss_inst); |
| } |
| } |
| { |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 2); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "pp_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_inst_self_ref, ref_map, "pp_inst"); |
| EXPECT_TRUE(is_leaf(*pp_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(pp_inst_self_ref->components->Value().resolved_symbol, |
| &pp_inst); |
| } |
| } |
| { |
| ASSERT_EQ(ss_info.local_references_to_bind.size(), 2); |
| const auto ref_map(ss_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_type, ref_map, "qq"); |
| const ReferenceComponentNode* ref_node = qq_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "qq"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "qq_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_inst_self_ref, ref_map, "qq_inst"); |
| EXPECT_TRUE(is_leaf(*qq_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(qq_inst_self_ref->components->Value().resolved_symbol, |
| &qq_inst); |
| } |
| } |
| |
| { // Verify ss_inst's type info |
| EXPECT_TRUE(ss_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(ss_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& ss_type( |
| ss_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(ss_type.identifier, "ss"); |
| EXPECT_EQ(ss_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(ss_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ss_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ss_inst_info.file_origin, &src); |
| } |
| |
| { // Verify pp_inst's type info |
| EXPECT_TRUE(pp_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(pp_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& pp_type( |
| pp_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_inst_info.file_origin, &src); |
| } |
| |
| { // Verify qq_inst's type info |
| EXPECT_TRUE(qq_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(qq_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& qq_type( |
| qq_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(qq_type.identifier, "qq"); |
| EXPECT_EQ(qq_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(qq_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(qq_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(qq_inst_info.file_origin, &src); |
| } |
| |
| // Resolve symbols. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Verify that typeof(ss_inst) successfully resolved to module ss. |
| EXPECT_EQ( |
| ss_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &ss); |
| // Verify that typeof(pp_inst) successfully resolved to module pp. |
| EXPECT_EQ( |
| pp_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &pp); |
| // Verify that typeof(qq_inst) successfully resolved to module qq. |
| EXPECT_EQ( |
| qq_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &qq); |
| } |
| |
| TEST(BuildSymbolTableTest, MultiFileModuleInstanceCyclicDependencies) { |
| // Cyclic dependencies among three files. |
| // Make sure this can still build and resolve without hanging, |
| // even if this is semantically illegal. |
| TestVerilogSourceFile pp_src("pp.sv", |
| "module pp;\n" |
| " ss ss_inst();\n" // instance |
| "endmodule\n"); |
| TestVerilogSourceFile qq_src("qq.sv", |
| "module qq;\n" |
| " pp pp_inst();\n" // instance |
| "endmodule\n"); |
| TestVerilogSourceFile ss_src("ss.sv", |
| "module ss;\n" |
| " qq qq_inst();\n" // instance |
| "endmodule\n"); |
| { |
| const auto status = pp_src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| } |
| { |
| const auto status = qq_src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| } |
| { |
| const auto status = ss_src.Parse(); |
| ASSERT_TRUE(status.ok()) << status.message(); |
| } |
| |
| // All permutations of the following file ordering should end up with the |
| // same results. |
| std::vector<const TestVerilogSourceFile*> ordering( |
| {&pp_src, &qq_src, &ss_src}); |
| // start with the lexicographically "lowest" permutation |
| SortSourceFiles(&ordering); |
| int count = 0; |
| do { |
| SymbolTable symbol_table(nullptr); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| for (const auto* src : ordering) { |
| const auto build_diagnostics = BuildSymbolTable(*src, &symbol_table); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| } |
| |
| // Goal: resolve the reference of "pp" to this definition node. |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| // Inspect inside the "qq" module definition. |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(ss, root_symbol, "ss"); |
| |
| // "ss_inst" is an instance of type "ss" |
| MUST_ASSIGN_LOOKUP_SYMBOL(ss_inst, pp, "ss_inst"); |
| |
| // "pp_inst" is an instance of type "pp" |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_inst, qq, "pp_inst"); |
| |
| // "qq_inst" is an instance of type "qq" |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq_inst, ss, "qq_inst"); |
| |
| EXPECT_EQ(pp_info.file_origin, &pp_src); |
| EXPECT_EQ(qq_info.file_origin, &qq_src); |
| EXPECT_EQ(ss_info.file_origin, &ss_src); |
| { |
| ASSERT_EQ(pp_info.local_references_to_bind.size(), 2); |
| const auto ref_map(pp_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(ss_type, ref_map, "ss"); |
| const ReferenceComponentNode* ref_node = ss_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "ss"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| pp_src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "ss_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(ss_inst_self_ref, ref_map, "ss_inst"); |
| EXPECT_TRUE(is_leaf(*ss_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(ss_inst_self_ref->components->Value().resolved_symbol, |
| &ss_inst); |
| } |
| } |
| { |
| ASSERT_EQ(qq_info.local_references_to_bind.size(), 2); |
| const auto ref_map(qq_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_type, ref_map, "pp"); |
| const ReferenceComponentNode* ref_node = pp_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "pp"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| qq_src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "pp_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(pp_inst_self_ref, ref_map, "pp_inst"); |
| EXPECT_TRUE(is_leaf(*pp_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(pp_inst_self_ref->components->Value().resolved_symbol, |
| &pp_inst); |
| } |
| } |
| { |
| ASSERT_EQ(ss_info.local_references_to_bind.size(), 2); |
| const auto ref_map(ss_info.LocalReferencesMapViewForTesting()); |
| { |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_type, ref_map, "qq"); |
| const ReferenceComponentNode* ref_node = qq_type->LastTypeComponent(); |
| ASSERT_NE(ref_node, nullptr); |
| const ReferenceComponent& ref(ref_node->Value()); |
| EXPECT_EQ(ref.identifier, "qq"); |
| EXPECT_TRUE(verible::IsSubRange(ref.identifier, |
| ss_src.GetTextStructure()->Contents())); |
| EXPECT_EQ(ref.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ref.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ref.resolved_symbol, nullptr); |
| } |
| { // self-reference to "qq_inst" instance |
| ASSIGN_MUST_FIND_EXACTLY_ONE_REF(qq_inst_self_ref, ref_map, "qq_inst"); |
| EXPECT_TRUE(is_leaf(*qq_inst_self_ref->components)); // no named ports |
| // self-reference is already bound. |
| EXPECT_EQ(qq_inst_self_ref->components->Value().resolved_symbol, |
| &qq_inst); |
| } |
| } |
| |
| { // Verify ss_inst's type info |
| EXPECT_TRUE(ss_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(ss_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& ss_type( |
| ss_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(ss_type.identifier, "ss"); |
| EXPECT_EQ(ss_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(ss_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(ss_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(ss_inst_info.file_origin, &pp_src); |
| } |
| |
| { // Verify pp_inst's type info |
| EXPECT_TRUE(pp_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(pp_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& pp_type( |
| pp_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(pp_type.identifier, "pp"); |
| EXPECT_EQ(pp_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(pp_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(pp_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(pp_inst_info.file_origin, &qq_src); |
| } |
| |
| { // Verify qq_inst's type info |
| EXPECT_TRUE(qq_inst_info.local_references_to_bind.empty()); |
| EXPECT_NE(qq_inst_info.declared_type.user_defined_type, nullptr); |
| const ReferenceComponent& qq_type( |
| qq_inst_info.declared_type.user_defined_type->Value()); |
| EXPECT_EQ(qq_type.identifier, "qq"); |
| EXPECT_EQ(qq_type.resolved_symbol, nullptr); // nothing resolved yet |
| EXPECT_EQ(qq_type.ref_type, ReferenceType::kUnqualified); |
| EXPECT_EQ(qq_type.required_metatype, SymbolMetaType::kUnspecified); |
| EXPECT_EQ(qq_inst_info.file_origin, &ss_src); |
| } |
| |
| // Resolve symbols. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| |
| // Verify that typeof(ss_inst) successfully resolved to module ss. |
| EXPECT_EQ( |
| ss_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &ss); |
| // Verify that typeof(pp_inst) successfully resolved to module pp. |
| EXPECT_EQ( |
| pp_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &pp); |
| // Verify that typeof(qq_inst) successfully resolved to module qq. |
| EXPECT_EQ( |
| qq_inst_info.declared_type.user_defined_type->Value().resolved_symbol, |
| &qq); |
| ++count; |
| } while (PermuteSourceFiles(&ordering)); |
| EXPECT_EQ(count, 6); // make sure we covered all permutations |
| } |
| |
| TEST(BuildSymbolTableTest, IncludeModuleDefinition) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| // Create files. |
| ScopedTestFile IncludedFile(sources_dir, |
| "module pp;\n" |
| "endmodule\n", |
| "module.sv"); |
| ScopedTestFile pp_src(sources_dir, "`include \"module.sv\"\n", "pp.sv"); |
| |
| VerilogProject project(sources_dir, {sources_dir}); |
| const auto file_or_status = |
| project.OpenTranslationUnit(Basename(pp_src.filename())); |
| ASSERT_TRUE(file_or_status.ok()) << file_or_status.status().message(); |
| |
| SymbolTable symbol_table(&project); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.Build(&build_diagnostics); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| |
| const VerilogSourceFile* included = project.LookupRegisteredFile("module.sv"); |
| ASSERT_NE(included, nullptr); |
| EXPECT_EQ(pp_info.file_origin, included); |
| |
| // Resolve symbols. Nothing to resolve. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| TEST(BuildSymbolTableTest, IncludeWithoutProject) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| // Create files. |
| ScopedTestFile IncludedFile(sources_dir, |
| "module pp;\n" |
| "endmodule\n", |
| "module.sv"); |
| TestVerilogSourceFile pp_src("pp.sv", "`include \"module.sv\"\n"); |
| |
| SymbolTable symbol_table(nullptr); |
| |
| const auto build_diagnostics = BuildSymbolTable(pp_src, nullptr); |
| // include files are ignored. |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Resolve symbols. Nothing to resolve. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| TEST(BuildSymbolTableTest, IncludeFileNotFound) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| // Create files. |
| ScopedTestFile pp_src(sources_dir, "`include \"not-found.sv\"\n", "pp.sv"); |
| |
| VerilogProject project(sources_dir, {sources_dir}); |
| const auto file_or_status = |
| project.OpenTranslationUnit(Basename(pp_src.filename())); |
| ASSERT_TRUE(file_or_status.ok()) << file_or_status.status().message(); |
| |
| SymbolTable symbol_table(&project); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.Build(&build_diagnostics); |
| ASSERT_FALSE(build_diagnostics.empty()); |
| EXPECT_EQ(build_diagnostics.front().code(), absl::StatusCode::kNotFound); |
| |
| EXPECT_TRUE(root_symbol.Children().empty()); |
| |
| // Resolve symbols. Nothing to resolve. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| TEST(BuildSymbolTableTest, IncludeFileParseError) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| // Create files. |
| ScopedTestFile IncludedFile(sources_dir, |
| "module 333;\n" // syntax error |
| "endmodule\n", |
| "module.sv"); |
| ScopedTestFile pp_src(sources_dir, "`include \"module.sv\"\n", "pp.sv"); |
| |
| VerilogProject project(sources_dir, {sources_dir}); |
| const auto file_or_status = |
| project.OpenTranslationUnit(Basename(pp_src.filename())); |
| ASSERT_TRUE(file_or_status.ok()) << file_or_status.status().message(); |
| |
| SymbolTable symbol_table(&project); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.Build(&build_diagnostics); |
| ASSERT_FALSE(build_diagnostics.empty()); |
| EXPECT_EQ(build_diagnostics.front().code(), |
| absl::StatusCode::kInvalidArgument); |
| |
| // Resolve symbols. Nothing to resolve. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| TEST(BuildSymbolTableTest, IncludeFileEmpty) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| // Create files. |
| ScopedTestFile IncludedFile(sources_dir, |
| "", // empty |
| "empty.sv"); |
| ScopedTestFile pp_src(sources_dir, "`include \"empty.sv\"\n", "pp.sv"); |
| |
| VerilogProject project(sources_dir, {sources_dir}); |
| const auto file_or_status = |
| project.OpenTranslationUnit(Basename(pp_src.filename())); |
| ASSERT_TRUE(file_or_status.ok()) << file_or_status.status().message(); |
| |
| SymbolTable symbol_table(&project); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.Build(&build_diagnostics); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| // Resolve symbols. Nothing to resolve. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| TEST(BuildSymbolTableTest, IncludedTwiceFromOneFile) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| // Create files. |
| ScopedTestFile IncludedFile(sources_dir, |
| "// verilog_syntax: parse-as-module-body\n" |
| "wire ww;\n", |
| "wires.sv"); |
| ScopedTestFile pp_src(sources_dir, |
| "module pp;\n" |
| "`include \"wires.sv\"\n" |
| "endmodule\n" |
| "module qq;\n" |
| "`include \"wires.sv\"\n" |
| "endmodule\n", |
| "pp.sv"); |
| |
| VerilogProject project(sources_dir, {sources_dir}); |
| const auto file_or_status = |
| project.OpenTranslationUnit(Basename(pp_src.filename())); |
| ASSERT_TRUE(file_or_status.ok()) << file_or_status.status().message(); |
| const VerilogSourceFile* pp_file = *file_or_status; |
| ASSERT_NE(pp_file, nullptr); |
| |
| SymbolTable symbol_table(&project); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.Build(&build_diagnostics); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_ww, pp, "ww"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq_ww, qq, "ww"); |
| |
| const VerilogSourceFile* included = project.LookupRegisteredFile("wires.sv"); |
| ASSERT_NE(included, nullptr); |
| EXPECT_EQ(pp_info.file_origin, pp_file); |
| EXPECT_EQ(qq_info.file_origin, pp_file); |
| EXPECT_EQ(pp_ww_info.file_origin, included); |
| EXPECT_EQ(qq_ww_info.file_origin, included); |
| |
| // Resolve symbols. Nothing to resolve. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| TEST(BuildSymbolTableTest, IncludedTwiceFromDifferentFiles) { |
| const auto tempdir = ::testing::TempDir(); |
| const std::string sources_dir = JoinPath(tempdir, __FUNCTION__); |
| ASSERT_TRUE(CreateDir(sources_dir).ok()); |
| |
| // Create files. |
| ScopedTestFile IncludedFile(sources_dir, |
| "// verilog_syntax: parse-as-module-body\n" |
| "wire ww;\n", |
| "wires.sv"); |
| ScopedTestFile pp_src(sources_dir, |
| "module pp;\n" |
| "`include \"wires.sv\"\n" |
| "endmodule\n", |
| "pp.sv"); |
| ScopedTestFile qq_src(sources_dir, |
| "module qq;\n" |
| "`include \"wires.sv\"\n" |
| "endmodule\n", |
| "qq.sv"); |
| |
| VerilogProject project(sources_dir, {sources_dir}); |
| |
| const auto pp_file_or_status = |
| project.OpenTranslationUnit(Basename(pp_src.filename())); |
| ASSERT_TRUE(pp_file_or_status.ok()) << pp_file_or_status.status().message(); |
| const VerilogSourceFile* pp_file = *pp_file_or_status; |
| ASSERT_NE(pp_file, nullptr); |
| |
| const auto qq_file_or_status = |
| project.OpenTranslationUnit(Basename(qq_src.filename())); |
| ASSERT_TRUE(qq_file_or_status.ok()) << qq_file_or_status.status().message(); |
| const VerilogSourceFile* qq_file = *qq_file_or_status; |
| ASSERT_NE(qq_file, nullptr); |
| |
| SymbolTable symbol_table(&project); |
| const SymbolTableNode& root_symbol(symbol_table.Root()); |
| |
| std::vector<absl::Status> build_diagnostics; |
| symbol_table.Build(&build_diagnostics); |
| EXPECT_EMPTY_STATUSES(build_diagnostics); |
| |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp, root_symbol, "pp"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq, root_symbol, "qq"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(pp_ww, pp, "ww"); |
| MUST_ASSIGN_LOOKUP_SYMBOL(qq_ww, qq, "ww"); |
| |
| const VerilogSourceFile* included = project.LookupRegisteredFile("wires.sv"); |
| ASSERT_NE(included, nullptr); |
| EXPECT_EQ(pp_info.file_origin, pp_file); |
| EXPECT_EQ(qq_info.file_origin, qq_file); |
| EXPECT_EQ(pp_ww_info.file_origin, included); |
| EXPECT_EQ(qq_ww_info.file_origin, included); |
| |
| // Resolve symbols. Nothing to resolve. |
| std::vector<absl::Status> resolve_diagnostics; |
| symbol_table.Resolve(&resolve_diagnostics); |
| EXPECT_EMPTY_STATUSES(resolve_diagnostics); |
| } |
| |
| struct FileListTestCase { |
| absl::string_view contents; |
| std::vector<absl::string_view> expected_files; |
| }; |
| |
| TEST(ParseSourceFileListFromFileTest, FileNotFound) { |
| FileList file_list; |
| const auto status(AppendFileListFromFile("/no/such/file.txt", &file_list)); |
| EXPECT_FALSE(status.ok()); |
| } |
| |
| TEST(ParseSourceFileListFromFileTest, VariousValidFiles) { |
| const FileListTestCase kTestCases[] = { |
| {"", {}}, // empty |
| {"\n\n", {}}, // blank lines |
| {"foo.sv", {"foo.sv"}}, // missing terminating newline, but still works |
| {"foo.sv\n", {"foo.sv"}}, |
| {"file name contains space.sv\n", {"file name contains space.sv"}}, |
| {"foo/bar.sv\n", {"foo/bar.sv"}}, // with path separator |
| {" foo.sv\n", {"foo.sv"}}, // remove leading whitespace |
| {"foo.sv \n", {"foo.sv"}}, // remove trailing whitespace |
| {"#foo.sv\n", {}}, // commented out |
| {"# foo.sv\n", {}}, // commented out |
| {"foo.sv\nbar/bar.sv\n", {"foo.sv", "bar/bar.sv"}}, |
| {"/foo/bar.sv\n" |
| "### ignore this one\n" |
| "bar/baz.txt\n", |
| {"/foo/bar.sv", "bar/baz.txt"}}, |
| }; |
| for (const auto& test : kTestCases) { |
| const ScopedTestFile test_file(testing::TempDir(), test.contents); |
| FileList file_list; |
| const auto status(AppendFileListFromFile(test_file.filename(), &file_list)); |
| ASSERT_TRUE(status.ok()) << status; |
| EXPECT_THAT(file_list.file_paths, ElementsAreArray(test.expected_files)) |
| << "input: " << test.contents; |
| } |
| } |
| |
| } // namespace |
| } // namespace verilog |