| /**CFile**************************************************************** |
| |
| FileName [extraUtilMisc.c] |
| |
| SystemName [ABC: Logic synthesis and verification system.] |
| |
| PackageName [extra] |
| |
| Synopsis [Misc procedures.] |
| |
| Author [Alan Mishchenko] |
| |
| Affiliation [UC Berkeley] |
| |
| Date [Ver. 1.0. Started - June 20, 2005.] |
| |
| Revision [$Id: extraUtilMisc.c,v 1.0 2003/09/01 00:00:00 alanmi Exp $] |
| |
| ***********************************************************************/ |
| |
| #include <math.h> |
| |
| #include "extra.h" |
| |
| ABC_NAMESPACE_IMPL_START |
| |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Constant declarations */ |
| /*---------------------------------------------------------------------------*/ |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Stucture declarations */ |
| /*---------------------------------------------------------------------------*/ |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Type declarations */ |
| /*---------------------------------------------------------------------------*/ |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Variable declarations */ |
| /*---------------------------------------------------------------------------*/ |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Macro declarations */ |
| /*---------------------------------------------------------------------------*/ |
| |
| |
| /**AutomaticStart*************************************************************/ |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Static function prototypes */ |
| /*---------------------------------------------------------------------------*/ |
| |
| /**AutomaticEnd***************************************************************/ |
| |
| static void Extra_Permutations_rec( char ** pRes, int nFact, int n, char Array[] ); |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Definition of exported functions */ |
| /*---------------------------------------------------------------------------*/ |
| |
| /**Function******************************************************************** |
| |
| Synopsis [Finds the smallest integer larger of equal than the logarithm.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ******************************************************************************/ |
| int Extra_Base2LogDouble( double Num ) |
| { |
| double Res; |
| int ResInt; |
| |
| Res = log(Num)/log(2.0); |
| ResInt = (int)Res; |
| if ( ResInt == Res ) |
| return ResInt; |
| else |
| return ResInt+1; |
| } |
| |
| /**Function******************************************************************** |
| |
| Synopsis [Returns the power of two as a double.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ******************************************************************************/ |
| double Extra_Power2( int Degree ) |
| { |
| double Res; |
| assert( Degree >= 0 ); |
| if ( Degree < 32 ) |
| return (double)(01<<Degree); |
| for ( Res = 1.0; Degree; Res *= 2.0, Degree-- ); |
| return Res; |
| } |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int Extra_Power3( int Num ) |
| { |
| int i; |
| int Res; |
| Res = 1; |
| for ( i = 0; i < Num; i++ ) |
| Res *= 3; |
| return Res; |
| } |
| |
| /**Function******************************************************************** |
| |
| Synopsis [Finds the number of combinations of k elements out of n.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ******************************************************************************/ |
| int Extra_NumCombinations( int k, int n ) |
| { |
| int i, Res = 1; |
| for ( i = 1; i <= k; i++ ) |
| Res = Res * (n-i+1) / i; |
| return Res; |
| } /* end of Extra_NumCombinations */ |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int * Extra_DeriveRadixCode( int Number, int Radix, int nDigits ) |
| { |
| static int Code[100]; |
| int i; |
| assert( nDigits < 100 ); |
| for ( i = 0; i < nDigits; i++ ) |
| { |
| Code[i] = Number % Radix; |
| Number = Number / Radix; |
| } |
| assert( Number == 0 ); |
| return Code; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Counts the number of ones in the bitstring.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int Extra_CountOnes( unsigned char * pBytes, int nBytes ) |
| { |
| static int bit_count[256] = { |
| 0,1,1,2,1,2,2,3,1,2,2,3,2,3,3,4,1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5, |
| 1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6, |
| 1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6, |
| 2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7, |
| 1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6, |
| 2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7, |
| 2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7, |
| 3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,4,5,5,6,5,6,6,7,5,6,6,7,6,7,7,8 |
| }; |
| |
| int i, Counter; |
| Counter = 0; |
| for ( i = 0; i < nBytes; i++ ) |
| Counter += bit_count[ *(pBytes+i) ]; |
| return Counter; |
| } |
| |
| /**Function******************************************************************** |
| |
| Synopsis [Computes the factorial.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ******************************************************************************/ |
| int Extra_Factorial( int n ) |
| { |
| int i, Res = 1; |
| for ( i = 1; i <= n; i++ ) |
| Res *= i; |
| return Res; |
| } |
| |
| /**Function******************************************************************** |
| |
| Synopsis [Computes the set of all permutations.] |
| |
| Description [The number of permutations in the array is n!. The number of |
| entries in each permutation is n. Therefore, the resulting array is a |
| two-dimentional array of the size: n! x n. To free the resulting array, |
| call ABC_FREE() on the pointer returned by this procedure.] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ******************************************************************************/ |
| char ** Extra_Permutations( int n ) |
| { |
| char Array[50]; |
| char ** pRes; |
| int nFact, i; |
| // allocate memory |
| nFact = Extra_Factorial( n ); |
| pRes = (char **)Extra_ArrayAlloc( nFact, n, sizeof(char) ); |
| // fill in the permutations |
| for ( i = 0; i < n; i++ ) |
| Array[i] = i; |
| Extra_Permutations_rec( pRes, nFact, n, Array ); |
| // print the permutations |
| /* |
| { |
| int i, k; |
| for ( i = 0; i < nFact; i++ ) |
| { |
| printf( "{" ); |
| for ( k = 0; k < n; k++ ) |
| printf( " %d", pRes[i][k] ); |
| printf( " }\n" ); |
| } |
| } |
| */ |
| return pRes; |
| } |
| |
| /**Function******************************************************************** |
| |
| Synopsis [Fills in the array of permutations.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ******************************************************************************/ |
| void Extra_Permutations_rec( char ** pRes, int nFact, int n, char Array[] ) |
| { |
| char ** pNext; |
| int nFactNext; |
| int iTemp, iCur, iLast, k; |
| |
| if ( n == 1 ) |
| { |
| pRes[0][0] = Array[0]; |
| return; |
| } |
| |
| // get the next factorial |
| nFactNext = nFact / n; |
| // get the last entry |
| iLast = n - 1; |
| |
| for ( iCur = 0; iCur < n; iCur++ ) |
| { |
| // swap Cur and Last |
| iTemp = Array[iCur]; |
| Array[iCur] = Array[iLast]; |
| Array[iLast] = iTemp; |
| |
| // get the pointer to the current section |
| pNext = pRes + (n - 1 - iCur) * nFactNext; |
| |
| // set the last entry |
| for ( k = 0; k < nFactNext; k++ ) |
| pNext[k][iLast] = Array[iLast]; |
| |
| // call recursively for this part |
| Extra_Permutations_rec( pNext, nFactNext, n - 1, Array ); |
| |
| // swap them back |
| iTemp = Array[iCur]; |
| Array[iCur] = Array[iLast]; |
| Array[iLast] = iTemp; |
| } |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Permutes the given vector of minterms.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_TruthPermute_int( int * pMints, int nMints, char * pPerm, int nVars, int * pMintsP ) |
| { |
| int m, v; |
| // clean the storage for minterms |
| memset( pMintsP, 0, sizeof(int) * nMints ); |
| // go through minterms and add the variables |
| for ( m = 0; m < nMints; m++ ) |
| for ( v = 0; v < nVars; v++ ) |
| if ( pMints[m] & (1 << v) ) |
| pMintsP[m] |= (1 << pPerm[v]); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Permutes the function.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthPermute( unsigned Truth, char * pPerms, int nVars, int fReverse ) |
| { |
| unsigned Result; |
| int * pMints; |
| int * pMintsP; |
| int nMints; |
| int i, m; |
| |
| assert( nVars < 6 ); |
| nMints = (1 << nVars); |
| pMints = ABC_ALLOC( int, nMints ); |
| pMintsP = ABC_ALLOC( int, nMints ); |
| for ( i = 0; i < nMints; i++ ) |
| pMints[i] = i; |
| |
| Extra_TruthPermute_int( pMints, nMints, pPerms, nVars, pMintsP ); |
| |
| Result = 0; |
| if ( fReverse ) |
| { |
| for ( m = 0; m < nMints; m++ ) |
| if ( Truth & (1 << pMintsP[m]) ) |
| Result |= (1 << m); |
| } |
| else |
| { |
| for ( m = 0; m < nMints; m++ ) |
| if ( Truth & (1 << m) ) |
| Result |= (1 << pMintsP[m]); |
| } |
| |
| ABC_FREE( pMints ); |
| ABC_FREE( pMintsP ); |
| |
| return Result; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Changes the phase of the function.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthPolarize( unsigned uTruth, int Polarity, int nVars ) |
| { |
| // elementary truth tables |
| static unsigned Signs[5] = { |
| 0xAAAAAAAA, // 1010 1010 1010 1010 1010 1010 1010 1010 |
| 0xCCCCCCCC, // 1010 1010 1010 1010 1010 1010 1010 1010 |
| 0xF0F0F0F0, // 1111 0000 1111 0000 1111 0000 1111 0000 |
| 0xFF00FF00, // 1111 1111 0000 0000 1111 1111 0000 0000 |
| 0xFFFF0000 // 1111 1111 1111 1111 0000 0000 0000 0000 |
| }; |
| unsigned uTruthRes, uCof0, uCof1; |
| int nMints, Shift, v; |
| assert( nVars < 6 ); |
| nMints = (1 << nVars); |
| uTruthRes = uTruth; |
| for ( v = 0; v < nVars; v++ ) |
| if ( Polarity & (1 << v) ) |
| { |
| uCof0 = uTruth & ~Signs[v]; |
| uCof1 = uTruth & Signs[v]; |
| Shift = (1 << v); |
| uCof0 <<= Shift; |
| uCof1 >>= Shift; |
| uTruth = uCof0 | uCof1; |
| } |
| return uTruth; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes N-canonical form using brute-force methods.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthCanonN( unsigned uTruth, int nVars ) |
| { |
| unsigned uTruthMin, uPhase; |
| int nMints, i; |
| nMints = (1 << nVars); |
| uTruthMin = 0xFFFFFFFF; |
| for ( i = 0; i < nMints; i++ ) |
| { |
| uPhase = Extra_TruthPolarize( uTruth, i, nVars ); |
| if ( uTruthMin > uPhase ) |
| uTruthMin = uPhase; |
| } |
| return uTruthMin; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes NN-canonical form using brute-force methods.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthCanonNN( unsigned uTruth, int nVars ) |
| { |
| unsigned uTruthMin, uTruthC, uPhase; |
| int nMints, i; |
| nMints = (1 << nVars); |
| uTruthC = (unsigned)( (~uTruth) & ((~((unsigned)0)) >> (32-nMints)) ); |
| uTruthMin = 0xFFFFFFFF; |
| for ( i = 0; i < nMints; i++ ) |
| { |
| uPhase = Extra_TruthPolarize( uTruth, i, nVars ); |
| if ( uTruthMin > uPhase ) |
| uTruthMin = uPhase; |
| uPhase = Extra_TruthPolarize( uTruthC, i, nVars ); |
| if ( uTruthMin > uPhase ) |
| uTruthMin = uPhase; |
| } |
| return uTruthMin; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes P-canonical form using brute-force methods.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthCanonP( unsigned uTruth, int nVars ) |
| { |
| static int nVarsOld, nPerms; |
| static char ** pPerms = NULL; |
| |
| unsigned uTruthMin, uPerm; |
| int k; |
| |
| if ( pPerms == NULL ) |
| { |
| nPerms = Extra_Factorial( nVars ); |
| pPerms = Extra_Permutations( nVars ); |
| nVarsOld = nVars; |
| } |
| else if ( nVarsOld != nVars ) |
| { |
| ABC_FREE( pPerms ); |
| nPerms = Extra_Factorial( nVars ); |
| pPerms = Extra_Permutations( nVars ); |
| nVarsOld = nVars; |
| } |
| |
| uTruthMin = 0xFFFFFFFF; |
| for ( k = 0; k < nPerms; k++ ) |
| { |
| uPerm = Extra_TruthPermute( uTruth, pPerms[k], nVars, 0 ); |
| if ( uTruthMin > uPerm ) |
| uTruthMin = uPerm; |
| } |
| return uTruthMin; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes NP-canonical form using brute-force methods.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthCanonNP( unsigned uTruth, int nVars ) |
| { |
| static int nVarsOld, nPerms; |
| static char ** pPerms = NULL; |
| |
| unsigned uTruthMin, uPhase, uPerm; |
| int nMints, k, i; |
| |
| if ( pPerms == NULL ) |
| { |
| nPerms = Extra_Factorial( nVars ); |
| pPerms = Extra_Permutations( nVars ); |
| nVarsOld = nVars; |
| } |
| else if ( nVarsOld != nVars ) |
| { |
| ABC_FREE( pPerms ); |
| nPerms = Extra_Factorial( nVars ); |
| pPerms = Extra_Permutations( nVars ); |
| nVarsOld = nVars; |
| } |
| |
| nMints = (1 << nVars); |
| uTruthMin = 0xFFFFFFFF; |
| for ( i = 0; i < nMints; i++ ) |
| { |
| uPhase = Extra_TruthPolarize( uTruth, i, nVars ); |
| for ( k = 0; k < nPerms; k++ ) |
| { |
| uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 ); |
| if ( uTruthMin > uPerm ) |
| uTruthMin = uPerm; |
| } |
| } |
| return uTruthMin; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes NPN-canonical form using brute-force methods.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthCanonNPN( unsigned uTruth, int nVars ) |
| { |
| static int nVarsOld, nPerms; |
| static char ** pPerms = NULL; |
| |
| unsigned uTruthMin, uTruthC, uPhase, uPerm; |
| int nMints, k, i; |
| |
| if ( pPerms == NULL ) |
| { |
| nPerms = Extra_Factorial( nVars ); |
| pPerms = Extra_Permutations( nVars ); |
| nVarsOld = nVars; |
| } |
| else if ( nVarsOld != nVars ) |
| { |
| ABC_FREE( pPerms ); |
| nPerms = Extra_Factorial( nVars ); |
| pPerms = Extra_Permutations( nVars ); |
| nVarsOld = nVars; |
| } |
| |
| nMints = (1 << nVars); |
| uTruthC = (unsigned)( (~uTruth) & ((~((unsigned)0)) >> (32-nMints)) ); |
| uTruthMin = 0xFFFFFFFF; |
| for ( i = 0; i < nMints; i++ ) |
| { |
| uPhase = Extra_TruthPolarize( uTruth, i, nVars ); |
| for ( k = 0; k < nPerms; k++ ) |
| { |
| uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 ); |
| if ( uTruthMin > uPerm ) |
| uTruthMin = uPerm; |
| } |
| uPhase = Extra_TruthPolarize( uTruthC, i, nVars ); |
| for ( k = 0; k < nPerms; k++ ) |
| { |
| uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 ); |
| if ( uTruthMin > uPerm ) |
| uTruthMin = uPerm; |
| } |
| } |
| return uTruthMin; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes NPN canonical forms for 4-variable functions.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_Truth4VarNPN( unsigned short ** puCanons, char ** puPhases, char ** puPerms, unsigned char ** puMap ) |
| { |
| unsigned short * uCanons; |
| unsigned char * uMap; |
| unsigned uTruth, uPhase, uPerm; |
| char ** pPerms4, * uPhases, * uPerms; |
| int nFuncs, nClasses; |
| int i, k; |
| |
| nFuncs = (1 << 16); |
| uCanons = ABC_ALLOC( unsigned short, nFuncs ); |
| uPhases = ABC_ALLOC( char, nFuncs ); |
| uPerms = ABC_ALLOC( char, nFuncs ); |
| uMap = ABC_ALLOC( unsigned char, nFuncs ); |
| memset( uCanons, 0, sizeof(unsigned short) * nFuncs ); |
| memset( uPhases, 0, sizeof(char) * nFuncs ); |
| memset( uPerms, 0, sizeof(char) * nFuncs ); |
| memset( uMap, 0, sizeof(unsigned char) * nFuncs ); |
| pPerms4 = Extra_Permutations( 4 ); |
| |
| nClasses = 1; |
| nFuncs = (1 << 15); |
| for ( uTruth = 1; uTruth < (unsigned)nFuncs; uTruth++ ) |
| { |
| // skip already assigned |
| if ( uCanons[uTruth] ) |
| { |
| assert( uTruth > uCanons[uTruth] ); |
| uMap[~uTruth & 0xFFFF] = uMap[uTruth] = uMap[uCanons[uTruth]]; |
| continue; |
| } |
| uMap[uTruth] = nClasses++; |
| for ( i = 0; i < 16; i++ ) |
| { |
| uPhase = Extra_TruthPolarize( uTruth, i, 4 ); |
| for ( k = 0; k < 24; k++ ) |
| { |
| uPerm = Extra_TruthPermute( uPhase, pPerms4[k], 4, 0 ); |
| if ( uCanons[uPerm] == 0 ) |
| { |
| uCanons[uPerm] = uTruth; |
| uPhases[uPerm] = i; |
| uPerms[uPerm] = k; |
| |
| uPerm = ~uPerm & 0xFFFF; |
| uCanons[uPerm] = uTruth; |
| uPhases[uPerm] = i | 16; |
| uPerms[uPerm] = k; |
| } |
| else |
| assert( uCanons[uPerm] == uTruth ); |
| } |
| uPhase = Extra_TruthPolarize( ~uTruth & 0xFFFF, i, 4 ); |
| for ( k = 0; k < 24; k++ ) |
| { |
| uPerm = Extra_TruthPermute( uPhase, pPerms4[k], 4, 0 ); |
| if ( uCanons[uPerm] == 0 ) |
| { |
| uCanons[uPerm] = uTruth; |
| uPhases[uPerm] = i; |
| uPerms[uPerm] = k; |
| |
| uPerm = ~uPerm & 0xFFFF; |
| uCanons[uPerm] = uTruth; |
| uPhases[uPerm] = i | 16; |
| uPerms[uPerm] = k; |
| } |
| else |
| assert( uCanons[uPerm] == uTruth ); |
| } |
| } |
| } |
| uPhases[(1<<16)-1] = 16; |
| assert( nClasses == 222 ); |
| ABC_FREE( pPerms4 ); |
| if ( puCanons ) |
| *puCanons = uCanons; |
| else |
| ABC_FREE( uCanons ); |
| if ( puPhases ) |
| *puPhases = uPhases; |
| else |
| ABC_FREE( uPhases ); |
| if ( puPerms ) |
| *puPerms = uPerms; |
| else |
| ABC_FREE( uPerms ); |
| if ( puMap ) |
| *puMap = uMap; |
| else |
| ABC_FREE( uMap ); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes NPN canonical forms for 4-variable functions.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_Truth3VarN( unsigned ** puCanons, char *** puPhases, char ** ppCounters ) |
| { |
| int nPhasesMax = 8; |
| unsigned * uCanons; |
| unsigned uTruth, uPhase, uTruth32; |
| char ** uPhases, * pCounters; |
| int nFuncs, nClasses, i; |
| |
| nFuncs = (1 << 8); |
| uCanons = ABC_ALLOC( unsigned, nFuncs ); |
| memset( uCanons, 0, sizeof(unsigned) * nFuncs ); |
| pCounters = ABC_ALLOC( char, nFuncs ); |
| memset( pCounters, 0, sizeof(char) * nFuncs ); |
| uPhases = (char **)Extra_ArrayAlloc( nFuncs, nPhasesMax, sizeof(char) ); |
| nClasses = 0; |
| for ( uTruth = 0; uTruth < (unsigned)nFuncs; uTruth++ ) |
| { |
| // skip already assigned |
| uTruth32 = ((uTruth << 24) | (uTruth << 16) | (uTruth << 8) | uTruth); |
| if ( uCanons[uTruth] ) |
| { |
| assert( uTruth32 > uCanons[uTruth] ); |
| continue; |
| } |
| nClasses++; |
| for ( i = 0; i < 8; i++ ) |
| { |
| uPhase = Extra_TruthPolarize( uTruth, i, 3 ); |
| if ( uCanons[uPhase] == 0 && (uTruth || i==0) ) |
| { |
| uCanons[uPhase] = uTruth32; |
| uPhases[uPhase][0] = i; |
| pCounters[uPhase] = 1; |
| } |
| else |
| { |
| assert( uCanons[uPhase] == uTruth32 ); |
| if ( pCounters[uPhase] < nPhasesMax ) |
| uPhases[uPhase][ (int)pCounters[uPhase]++ ] = i; |
| } |
| } |
| } |
| if ( puCanons ) |
| *puCanons = uCanons; |
| else |
| ABC_FREE( uCanons ); |
| if ( puPhases ) |
| *puPhases = uPhases; |
| else |
| ABC_FREE( uPhases ); |
| if ( ppCounters ) |
| *ppCounters = pCounters; |
| else |
| ABC_FREE( pCounters ); |
| // printf( "The number of 3N-classes = %d.\n", nClasses ); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes NPN canonical forms for 4-variable functions.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_Truth4VarN( unsigned short ** puCanons, char *** puPhases, char ** ppCounters, int nPhasesMax ) |
| { |
| unsigned short * uCanons; |
| unsigned uTruth, uPhase; |
| char ** uPhases, * pCounters; |
| int nFuncs, nClasses, i; |
| |
| nFuncs = (1 << 16); |
| uCanons = ABC_ALLOC( unsigned short, nFuncs ); |
| memset( uCanons, 0, sizeof(unsigned short) * nFuncs ); |
| pCounters = ABC_ALLOC( char, nFuncs ); |
| memset( pCounters, 0, sizeof(char) * nFuncs ); |
| uPhases = (char **)Extra_ArrayAlloc( nFuncs, nPhasesMax, sizeof(char) ); |
| nClasses = 0; |
| for ( uTruth = 0; uTruth < (unsigned)nFuncs; uTruth++ ) |
| { |
| // skip already assigned |
| if ( uCanons[uTruth] ) |
| { |
| assert( uTruth > uCanons[uTruth] ); |
| continue; |
| } |
| nClasses++; |
| for ( i = 0; i < 16; i++ ) |
| { |
| uPhase = Extra_TruthPolarize( uTruth, i, 4 ); |
| if ( uCanons[uPhase] == 0 && (uTruth || i==0) ) |
| { |
| uCanons[uPhase] = uTruth; |
| uPhases[uPhase][0] = i; |
| pCounters[uPhase] = 1; |
| } |
| else |
| { |
| assert( uCanons[uPhase] == uTruth ); |
| if ( pCounters[uPhase] < nPhasesMax ) |
| uPhases[uPhase][ (int)pCounters[uPhase]++ ] = i; |
| } |
| } |
| } |
| if ( puCanons ) |
| *puCanons = uCanons; |
| else |
| ABC_FREE( uCanons ); |
| if ( puPhases ) |
| *puPhases = uPhases; |
| else |
| ABC_FREE( uPhases ); |
| if ( ppCounters ) |
| *ppCounters = pCounters; |
| else |
| ABC_FREE( pCounters ); |
| // printf( "The number of 4N-classes = %d.\n", nClasses ); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Allocated one-memory-chunk array.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void ** Extra_ArrayAlloc( int nCols, int nRows, int Size ) |
| { |
| void ** pRes; |
| char * pBuffer; |
| int i; |
| assert( nCols > 0 && nRows > 0 && Size > 0 ); |
| pBuffer = ABC_ALLOC( char, nCols * (sizeof(void *) + nRows * Size) ); |
| pRes = (void **)pBuffer; |
| pRes[0] = pBuffer + nCols * sizeof(void *); |
| for ( i = 1; i < nCols; i++ ) |
| pRes[i] = (void *)((char *)pRes[0] + i * nRows * Size); |
| return pRes; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes a phase of the 3-var function.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned short Extra_TruthPerm4One( unsigned uTruth, int Phase ) |
| { |
| // cases |
| static unsigned short Cases[16] = { |
| 0, // 0000 - skip |
| 0, // 0001 - skip |
| 0xCCCC, // 0010 - single var |
| 0, // 0011 - skip |
| 0xF0F0, // 0100 - single var |
| 1, // 0101 |
| 1, // 0110 |
| 0, // 0111 - skip |
| 0xFF00, // 1000 - single var |
| 1, // 1001 |
| 1, // 1010 |
| 1, // 1011 |
| 1, // 1100 |
| 1, // 1101 |
| 1, // 1110 |
| 0 // 1111 - skip |
| }; |
| // permutations |
| static int Perms[16][4] = { |
| { 0, 0, 0, 0 }, // 0000 - skip |
| { 0, 0, 0, 0 }, // 0001 - skip |
| { 0, 0, 0, 0 }, // 0010 - single var |
| { 0, 0, 0, 0 }, // 0011 - skip |
| { 0, 0, 0, 0 }, // 0100 - single var |
| { 0, 2, 1, 3 }, // 0101 |
| { 2, 0, 1, 3 }, // 0110 |
| { 0, 0, 0, 0 }, // 0111 - skip |
| { 0, 0, 0, 0 }, // 1000 - single var |
| { 0, 2, 3, 1 }, // 1001 |
| { 2, 0, 3, 1 }, // 1010 |
| { 0, 1, 3, 2 }, // 1011 |
| { 2, 3, 0, 1 }, // 1100 |
| { 0, 3, 1, 2 }, // 1101 |
| { 3, 0, 1, 2 }, // 1110 |
| { 0, 0, 0, 0 } // 1111 - skip |
| }; |
| int i, k, iRes; |
| unsigned uTruthRes; |
| assert( Phase >= 0 && Phase < 16 ); |
| if ( Cases[Phase] == 0 ) |
| return uTruth; |
| if ( Cases[Phase] > 1 ) |
| return Cases[Phase]; |
| uTruthRes = 0; |
| for ( i = 0; i < 16; i++ ) |
| if ( uTruth & (1 << i) ) |
| { |
| for ( iRes = 0, k = 0; k < 4; k++ ) |
| if ( i & (1 << Perms[Phase][k]) ) |
| iRes |= (1 << k); |
| uTruthRes |= (1 << iRes); |
| } |
| return uTruthRes; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes a phase of the 3-var function.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned Extra_TruthPerm5One( unsigned uTruth, int Phase ) |
| { |
| // cases |
| static unsigned Cases[32] = { |
| 0, // 00000 - skip |
| 0, // 00001 - skip |
| 0xCCCCCCCC, // 00010 - single var |
| 0, // 00011 - skip |
| 0xF0F0F0F0, // 00100 - single var |
| 1, // 00101 |
| 1, // 00110 |
| 0, // 00111 - skip |
| 0xFF00FF00, // 01000 - single var |
| 1, // 01001 |
| 1, // 01010 |
| 1, // 01011 |
| 1, // 01100 |
| 1, // 01101 |
| 1, // 01110 |
| 0, // 01111 - skip |
| 0xFFFF0000, // 10000 - skip |
| 1, // 10001 |
| 1, // 10010 |
| 1, // 10011 |
| 1, // 10100 |
| 1, // 10101 |
| 1, // 10110 |
| 1, // 10111 - four var |
| 1, // 11000 |
| 1, // 11001 |
| 1, // 11010 |
| 1, // 11011 - four var |
| 1, // 11100 |
| 1, // 11101 - four var |
| 1, // 11110 - four var |
| 0 // 11111 - skip |
| }; |
| // permutations |
| static int Perms[32][5] = { |
| { 0, 0, 0, 0, 0 }, // 00000 - skip |
| { 0, 0, 0, 0, 0 }, // 00001 - skip |
| { 0, 0, 0, 0, 0 }, // 00010 - single var |
| { 0, 0, 0, 0, 0 }, // 00011 - skip |
| { 0, 0, 0, 0, 0 }, // 00100 - single var |
| { 0, 2, 1, 3, 4 }, // 00101 |
| { 2, 0, 1, 3, 4 }, // 00110 |
| { 0, 0, 0, 0, 0 }, // 00111 - skip |
| { 0, 0, 0, 0, 0 }, // 01000 - single var |
| { 0, 2, 3, 1, 4 }, // 01001 |
| { 2, 0, 3, 1, 4 }, // 01010 |
| { 0, 1, 3, 2, 4 }, // 01011 |
| { 2, 3, 0, 1, 4 }, // 01100 |
| { 0, 3, 1, 2, 4 }, // 01101 |
| { 3, 0, 1, 2, 4 }, // 01110 |
| { 0, 0, 0, 0, 0 }, // 01111 - skip |
| { 0, 0, 0, 0, 0 }, // 10000 - single var |
| { 0, 4, 2, 3, 1 }, // 10001 |
| { 4, 0, 2, 3, 1 }, // 10010 |
| { 0, 1, 3, 4, 2 }, // 10011 |
| { 2, 3, 0, 4, 1 }, // 10100 |
| { 0, 3, 1, 4, 2 }, // 10101 |
| { 3, 0, 1, 4, 2 }, // 10110 |
| { 0, 1, 2, 4, 3 }, // 10111 - four var |
| { 2, 3, 4, 0, 1 }, // 11000 |
| { 0, 3, 4, 1, 2 }, // 11001 |
| { 3, 0, 4, 1, 2 }, // 11010 |
| { 0, 1, 4, 2, 3 }, // 11011 - four var |
| { 3, 4, 0, 1, 2 }, // 11100 |
| { 0, 4, 1, 2, 3 }, // 11101 - four var |
| { 4, 0, 1, 2, 3 }, // 11110 - four var |
| { 0, 0, 0, 0, 0 } // 11111 - skip |
| }; |
| int i, k, iRes; |
| unsigned uTruthRes; |
| assert( Phase >= 0 && Phase < 32 ); |
| if ( Cases[Phase] == 0 ) |
| return uTruth; |
| if ( Cases[Phase] > 1 ) |
| return Cases[Phase]; |
| uTruthRes = 0; |
| for ( i = 0; i < 32; i++ ) |
| if ( uTruth & (1 << i) ) |
| { |
| for ( iRes = 0, k = 0; k < 5; k++ ) |
| if ( i & (1 << Perms[Phase][k]) ) |
| iRes |= (1 << k); |
| uTruthRes |= (1 << iRes); |
| } |
| return uTruthRes; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes a phase of the 3-var function.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_TruthPerm6One( unsigned * uTruth, int Phase, unsigned * uTruthRes ) |
| { |
| // cases |
| static unsigned Cases[64] = { |
| 0, // 000000 - skip |
| 0, // 000001 - skip |
| 0xCCCCCCCC, // 000010 - single var |
| 0, // 000011 - skip |
| 0xF0F0F0F0, // 000100 - single var |
| 1, // 000101 |
| 1, // 000110 |
| 0, // 000111 - skip |
| 0xFF00FF00, // 001000 - single var |
| 1, // 001001 |
| 1, // 001010 |
| 1, // 001011 |
| 1, // 001100 |
| 1, // 001101 |
| 1, // 001110 |
| 0, // 001111 - skip |
| 0xFFFF0000, // 010000 - skip |
| 1, // 010001 |
| 1, // 010010 |
| 1, // 010011 |
| 1, // 010100 |
| 1, // 010101 |
| 1, // 010110 |
| 1, // 010111 - four var |
| 1, // 011000 |
| 1, // 011001 |
| 1, // 011010 |
| 1, // 011011 - four var |
| 1, // 011100 |
| 1, // 011101 - four var |
| 1, // 011110 - four var |
| 0, // 011111 - skip |
| 0xFFFFFFFF, // 100000 - single var |
| 1, // 100001 |
| 1, // 100010 |
| 1, // 100011 |
| 1, // 100100 |
| 1, // 100101 |
| 1, // 100110 |
| 1, // 100111 |
| 1, // 101000 |
| 1, // 101001 |
| 1, // 101010 |
| 1, // 101011 |
| 1, // 101100 |
| 1, // 101101 |
| 1, // 101110 |
| 1, // 101111 |
| 1, // 110000 |
| 1, // 110001 |
| 1, // 110010 |
| 1, // 110011 |
| 1, // 110100 |
| 1, // 110101 |
| 1, // 110110 |
| 1, // 110111 |
| 1, // 111000 |
| 1, // 111001 |
| 1, // 111010 |
| 1, // 111011 |
| 1, // 111100 |
| 1, // 111101 |
| 1, // 111110 |
| 0 // 111111 - skip |
| }; |
| // permutations |
| static int Perms[64][6] = { |
| { 0, 0, 0, 0, 0, 0 }, // 000000 - skip |
| { 0, 0, 0, 0, 0, 0 }, // 000001 - skip |
| { 0, 0, 0, 0, 0, 0 }, // 000010 - single var |
| { 0, 0, 0, 0, 0, 0 }, // 000011 - skip |
| { 0, 0, 0, 0, 0, 0 }, // 000100 - single var |
| { 0, 2, 1, 3, 4, 5 }, // 000101 |
| { 2, 0, 1, 3, 4, 5 }, // 000110 |
| { 0, 0, 0, 0, 0, 0 }, // 000111 - skip |
| { 0, 0, 0, 0, 0, 0 }, // 001000 - single var |
| { 0, 2, 3, 1, 4, 5 }, // 001001 |
| { 2, 0, 3, 1, 4, 5 }, // 001010 |
| { 0, 1, 3, 2, 4, 5 }, // 001011 |
| { 2, 3, 0, 1, 4, 5 }, // 001100 |
| { 0, 3, 1, 2, 4, 5 }, // 001101 |
| { 3, 0, 1, 2, 4, 5 }, // 001110 |
| { 0, 0, 0, 0, 0, 0 }, // 001111 - skip |
| { 0, 0, 0, 0, 0, 0 }, // 010000 - skip |
| { 0, 4, 2, 3, 1, 5 }, // 010001 |
| { 4, 0, 2, 3, 1, 5 }, // 010010 |
| { 0, 1, 3, 4, 2, 5 }, // 010011 |
| { 2, 3, 0, 4, 1, 5 }, // 010100 |
| { 0, 3, 1, 4, 2, 5 }, // 010101 |
| { 3, 0, 1, 4, 2, 5 }, // 010110 |
| { 0, 1, 2, 4, 3, 5 }, // 010111 - four var |
| { 2, 3, 4, 0, 1, 5 }, // 011000 |
| { 0, 3, 4, 1, 2, 5 }, // 011001 |
| { 3, 0, 4, 1, 2, 5 }, // 011010 |
| { 0, 1, 4, 2, 3, 5 }, // 011011 - four var |
| { 3, 4, 0, 1, 2, 5 }, // 011100 |
| { 0, 4, 1, 2, 3, 5 }, // 011101 - four var |
| { 4, 0, 1, 2, 3, 5 }, // 011110 - four var |
| { 0, 0, 0, 0, 0, 0 }, // 011111 - skip |
| { 0, 0, 0, 0, 0, 0 }, // 100000 - single var |
| { 0, 2, 3, 4, 5, 1 }, // 100001 |
| { 2, 0, 3, 4, 5, 1 }, // 100010 |
| { 0, 1, 3, 4, 5, 2 }, // 100011 |
| { 2, 3, 0, 4, 5, 1 }, // 100100 |
| { 0, 3, 1, 4, 5, 2 }, // 100101 |
| { 3, 0, 1, 4, 5, 2 }, // 100110 |
| { 0, 1, 2, 4, 5, 3 }, // 100111 |
| { 2, 3, 4, 0, 5, 1 }, // 101000 |
| { 0, 3, 4, 1, 5, 2 }, // 101001 |
| { 3, 0, 4, 1, 5, 2 }, // 101010 |
| { 0, 1, 4, 2, 5, 3 }, // 101011 |
| { 3, 4, 0, 1, 5, 2 }, // 101100 |
| { 0, 4, 1, 2, 5, 3 }, // 101101 |
| { 4, 0, 1, 2, 5, 3 }, // 101110 |
| { 0, 1, 2, 3, 5, 4 }, // 101111 |
| { 2, 3, 4, 5, 0, 1 }, // 110000 |
| { 0, 3, 4, 5, 1, 2 }, // 110001 |
| { 3, 0, 4, 5, 1, 2 }, // 110010 |
| { 0, 1, 4, 5, 2, 3 }, // 110011 |
| { 3, 4, 0, 5, 1, 2 }, // 110100 |
| { 0, 4, 1, 5, 2, 3 }, // 110101 |
| { 4, 0, 1, 5, 2, 3 }, // 110110 |
| { 0, 1, 2, 5, 3, 4 }, // 110111 |
| { 3, 4, 5, 0, 1, 2 }, // 111000 |
| { 0, 4, 5, 1, 2, 3 }, // 111001 |
| { 4, 0, 5, 1, 2, 3 }, // 111010 |
| { 0, 1, 5, 2, 3, 4 }, // 111011 |
| { 4, 5, 0, 1, 2, 3 }, // 111100 |
| { 0, 5, 1, 2, 3, 4 }, // 111101 |
| { 5, 0, 1, 2, 3, 4 }, // 111110 |
| { 0, 0, 0, 0, 0, 0 } // 111111 - skip |
| }; |
| int i, k, iRes; |
| assert( Phase >= 0 && Phase < 64 ); |
| if ( Cases[Phase] == 0 ) |
| { |
| uTruthRes[0] = uTruth[0]; |
| uTruthRes[1] = uTruth[1]; |
| return; |
| } |
| if ( Cases[Phase] > 1 ) |
| { |
| if ( Phase == 32 ) |
| { |
| uTruthRes[0] = 0x00000000; |
| uTruthRes[1] = 0xFFFFFFFF; |
| } |
| else |
| { |
| uTruthRes[0] = Cases[Phase]; |
| uTruthRes[1] = Cases[Phase]; |
| } |
| return; |
| } |
| uTruthRes[0] = 0; |
| uTruthRes[1] = 0; |
| for ( i = 0; i < 64; i++ ) |
| { |
| if ( i < 32 ) |
| { |
| if ( uTruth[0] & (1 << i) ) |
| { |
| for ( iRes = 0, k = 0; k < 6; k++ ) |
| if ( i & (1 << Perms[Phase][k]) ) |
| iRes |= (1 << k); |
| if ( iRes < 32 ) |
| uTruthRes[0] |= (1 << iRes); |
| else |
| uTruthRes[1] |= (1 << (iRes-32)); |
| } |
| } |
| else |
| { |
| if ( uTruth[1] & (1 << (i-32)) ) |
| { |
| for ( iRes = 0, k = 0; k < 6; k++ ) |
| if ( i & (1 << Perms[Phase][k]) ) |
| iRes |= (1 << k); |
| if ( iRes < 32 ) |
| uTruthRes[0] |= (1 << iRes); |
| else |
| uTruthRes[1] |= (1 << (iRes-32)); |
| } |
| } |
| } |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes a phase of the 8-var function.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_TruthExpand( int nVars, int nWords, unsigned * puTruth, unsigned uPhase, unsigned * puTruthR ) |
| { |
| // elementary truth tables |
| static unsigned uTruths[8][8] = { |
| { 0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA }, |
| { 0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC }, |
| { 0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0 }, |
| { 0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00 }, |
| { 0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000 }, |
| { 0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF }, |
| { 0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF }, |
| { 0x00000000,0x00000000,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF } |
| }; |
| static char Cases[256] = { |
| 0, // 00000000 |
| 0, // 00000001 |
| 1, // 00000010 |
| 0, // 00000011 |
| 2, // 00000100 |
| -1, // 00000101 |
| -1, // 00000110 |
| 0, // 00000111 |
| 3, // 00001000 |
| -1, // 00001001 |
| -1, // 00001010 |
| -1, // 00001011 |
| -1, // 00001100 |
| -1, // 00001101 |
| -1, // 00001110 |
| 0, // 00001111 |
| 4, // 00010000 |
| -1, // 00010001 |
| -1, // 00010010 |
| -1, // 00010011 |
| -1, // 00010100 |
| -1, // 00010101 |
| -1, // 00010110 |
| -1, // 00010111 |
| -1, // 00011000 |
| -1, // 00011001 |
| -1, // 00011010 |
| -1, // 00011011 |
| -1, // 00011100 |
| -1, // 00011101 |
| -1, // 00011110 |
| 0, // 00011111 |
| 5, // 00100000 |
| -1, // 00100001 |
| -1, // 00100010 |
| -1, // 00100011 |
| -1, // 00100100 |
| -1, // 00100101 |
| -1, // 00100110 |
| -1, // 00100111 |
| -1, // 00101000 |
| -1, // 00101001 |
| -1, // 00101010 |
| -1, // 00101011 |
| -1, // 00101100 |
| -1, // 00101101 |
| -1, // 00101110 |
| -1, // 00101111 |
| -1, // 00110000 |
| -1, // 00110001 |
| -1, // 00110010 |
| -1, // 00110011 |
| -1, // 00110100 |
| -1, // 00110101 |
| -1, // 00110110 |
| -1, // 00110111 |
| -1, // 00111000 |
| -1, // 00111001 |
| -1, // 00111010 |
| -1, // 00111011 |
| -1, // 00111100 |
| -1, // 00111101 |
| -1, // 00111110 |
| 0, // 00111111 |
| 6, // 01000000 |
| -1, // 01000001 |
| -1, // 01000010 |
| -1, // 01000011 |
| -1, // 01000100 |
| -1, // 01000101 |
| -1, // 01000110 |
| -1, // 01000111 |
| -1, // 01001000 |
| -1, // 01001001 |
| -1, // 01001010 |
| -1, // 01001011 |
| -1, // 01001100 |
| -1, // 01001101 |
| -1, // 01001110 |
| -1, // 01001111 |
| -1, // 01010000 |
| -1, // 01010001 |
| -1, // 01010010 |
| -1, // 01010011 |
| -1, // 01010100 |
| -1, // 01010101 |
| -1, // 01010110 |
| -1, // 01010111 |
| -1, // 01011000 |
| -1, // 01011001 |
| -1, // 01011010 |
| -1, // 01011011 |
| -1, // 01011100 |
| -1, // 01011101 |
| -1, // 01011110 |
| -1, // 01011111 |
| -1, // 01100000 |
| -1, // 01100001 |
| -1, // 01100010 |
| -1, // 01100011 |
| -1, // 01100100 |
| -1, // 01100101 |
| -1, // 01100110 |
| -1, // 01100111 |
| -1, // 01101000 |
| -1, // 01101001 |
| -1, // 01101010 |
| -1, // 01101011 |
| -1, // 01101100 |
| -1, // 01101101 |
| -1, // 01101110 |
| -1, // 01101111 |
| -1, // 01110000 |
| -1, // 01110001 |
| -1, // 01110010 |
| -1, // 01110011 |
| -1, // 01110100 |
| -1, // 01110101 |
| -1, // 01110110 |
| -1, // 01110111 |
| -1, // 01111000 |
| -1, // 01111001 |
| -1, // 01111010 |
| -1, // 01111011 |
| -1, // 01111100 |
| -1, // 01111101 |
| -1, // 01111110 |
| 0, // 01111111 |
| 7, // 10000000 |
| -1, // 10000001 |
| -1, // 10000010 |
| -1, // 10000011 |
| -1, // 10000100 |
| -1, // 10000101 |
| -1, // 10000110 |
| -1, // 10000111 |
| -1, // 10001000 |
| -1, // 10001001 |
| -1, // 10001010 |
| -1, // 10001011 |
| -1, // 10001100 |
| -1, // 10001101 |
| -1, // 10001110 |
| -1, // 10001111 |
| -1, // 10010000 |
| -1, // 10010001 |
| -1, // 10010010 |
| -1, // 10010011 |
| -1, // 10010100 |
| -1, // 10010101 |
| -1, // 10010110 |
| -1, // 10010111 |
| -1, // 10011000 |
| -1, // 10011001 |
| -1, // 10011010 |
| -1, // 10011011 |
| -1, // 10011100 |
| -1, // 10011101 |
| -1, // 10011110 |
| -1, // 10011111 |
| -1, // 10100000 |
| -1, // 10100001 |
| -1, // 10100010 |
| -1, // 10100011 |
| -1, // 10100100 |
| -1, // 10100101 |
| -1, // 10100110 |
| -1, // 10100111 |
| -1, // 10101000 |
| -1, // 10101001 |
| -1, // 10101010 |
| -1, // 10101011 |
| -1, // 10101100 |
| -1, // 10101101 |
| -1, // 10101110 |
| -1, // 10101111 |
| -1, // 10110000 |
| -1, // 10110001 |
| -1, // 10110010 |
| -1, // 10110011 |
| -1, // 10110100 |
| -1, // 10110101 |
| -1, // 10110110 |
| -1, // 10110111 |
| -1, // 10111000 |
| -1, // 10111001 |
| -1, // 10111010 |
| -1, // 10111011 |
| -1, // 10111100 |
| -1, // 10111101 |
| -1, // 10111110 |
| -1, // 10111111 |
| -1, // 11000000 |
| -1, // 11000001 |
| -1, // 11000010 |
| -1, // 11000011 |
| -1, // 11000100 |
| -1, // 11000101 |
| -1, // 11000110 |
| -1, // 11000111 |
| -1, // 11001000 |
| -1, // 11001001 |
| -1, // 11001010 |
| -1, // 11001011 |
| -1, // 11001100 |
| -1, // 11001101 |
| -1, // 11001110 |
| -1, // 11001111 |
| -1, // 11010000 |
| -1, // 11010001 |
| -1, // 11010010 |
| -1, // 11010011 |
| -1, // 11010100 |
| -1, // 11010101 |
| -1, // 11010110 |
| -1, // 11010111 |
| -1, // 11011000 |
| -1, // 11011001 |
| -1, // 11011010 |
| -1, // 11011011 |
| -1, // 11011100 |
| -1, // 11011101 |
| -1, // 11011110 |
| -1, // 11011111 |
| -1, // 11100000 |
| -1, // 11100001 |
| -1, // 11100010 |
| -1, // 11100011 |
| -1, // 11100100 |
| -1, // 11100101 |
| -1, // 11100110 |
| -1, // 11100111 |
| -1, // 11101000 |
| -1, // 11101001 |
| -1, // 11101010 |
| -1, // 11101011 |
| -1, // 11101100 |
| -1, // 11101101 |
| -1, // 11101110 |
| -1, // 11101111 |
| -1, // 11110000 |
| -1, // 11110001 |
| -1, // 11110010 |
| -1, // 11110011 |
| -1, // 11110100 |
| -1, // 11110101 |
| -1, // 11110110 |
| -1, // 11110111 |
| -1, // 11111000 |
| -1, // 11111001 |
| -1, // 11111010 |
| -1, // 11111011 |
| -1, // 11111100 |
| -1, // 11111101 |
| -1, // 11111110 |
| 0 // 11111111 |
| }; |
| static char Perms[256][8] = { |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000000 |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000001 |
| { 1, 0, 2, 3, 4, 5, 6, 7 }, // 00000010 |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000011 |
| { 1, 2, 0, 3, 4, 5, 6, 7 }, // 00000100 |
| { 0, 2, 1, 3, 4, 5, 6, 7 }, // 00000101 |
| { 2, 0, 1, 3, 4, 5, 6, 7 }, // 00000110 |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000111 |
| { 1, 2, 3, 0, 4, 5, 6, 7 }, // 00001000 |
| { 0, 2, 3, 1, 4, 5, 6, 7 }, // 00001001 |
| { 2, 0, 3, 1, 4, 5, 6, 7 }, // 00001010 |
| { 0, 1, 3, 2, 4, 5, 6, 7 }, // 00001011 |
| { 2, 3, 0, 1, 4, 5, 6, 7 }, // 00001100 |
| { 0, 3, 1, 2, 4, 5, 6, 7 }, // 00001101 |
| { 3, 0, 1, 2, 4, 5, 6, 7 }, // 00001110 |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 00001111 |
| { 1, 2, 3, 4, 0, 5, 6, 7 }, // 00010000 |
| { 0, 2, 3, 4, 1, 5, 6, 7 }, // 00010001 |
| { 2, 0, 3, 4, 1, 5, 6, 7 }, // 00010010 |
| { 0, 1, 3, 4, 2, 5, 6, 7 }, // 00010011 |
| { 2, 3, 0, 4, 1, 5, 6, 7 }, // 00010100 |
| { 0, 3, 1, 4, 2, 5, 6, 7 }, // 00010101 |
| { 3, 0, 1, 4, 2, 5, 6, 7 }, // 00010110 |
| { 0, 1, 2, 4, 3, 5, 6, 7 }, // 00010111 |
| { 2, 3, 4, 0, 1, 5, 6, 7 }, // 00011000 |
| { 0, 3, 4, 1, 2, 5, 6, 7 }, // 00011001 |
| { 3, 0, 4, 1, 2, 5, 6, 7 }, // 00011010 |
| { 0, 1, 4, 2, 3, 5, 6, 7 }, // 00011011 |
| { 3, 4, 0, 1, 2, 5, 6, 7 }, // 00011100 |
| { 0, 4, 1, 2, 3, 5, 6, 7 }, // 00011101 |
| { 4, 0, 1, 2, 3, 5, 6, 7 }, // 00011110 |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 00011111 |
| { 1, 2, 3, 4, 5, 0, 6, 7 }, // 00100000 |
| { 0, 2, 3, 4, 5, 1, 6, 7 }, // 00100001 |
| { 2, 0, 3, 4, 5, 1, 6, 7 }, // 00100010 |
| { 0, 1, 3, 4, 5, 2, 6, 7 }, // 00100011 |
| { 2, 3, 0, 4, 5, 1, 6, 7 }, // 00100100 |
| { 0, 3, 1, 4, 5, 2, 6, 7 }, // 00100101 |
| { 3, 0, 1, 4, 5, 2, 6, 7 }, // 00100110 |
| { 0, 1, 2, 4, 5, 3, 6, 7 }, // 00100111 |
| { 2, 3, 4, 0, 5, 1, 6, 7 }, // 00101000 |
| { 0, 3, 4, 1, 5, 2, 6, 7 }, // 00101001 |
| { 3, 0, 4, 1, 5, 2, 6, 7 }, // 00101010 |
| { 0, 1, 4, 2, 5, 3, 6, 7 }, // 00101011 |
| { 3, 4, 0, 1, 5, 2, 6, 7 }, // 00101100 |
| { 0, 4, 1, 2, 5, 3, 6, 7 }, // 00101101 |
| { 4, 0, 1, 2, 5, 3, 6, 7 }, // 00101110 |
| { 0, 1, 2, 3, 5, 4, 6, 7 }, // 00101111 |
| { 2, 3, 4, 5, 0, 1, 6, 7 }, // 00110000 |
| { 0, 3, 4, 5, 1, 2, 6, 7 }, // 00110001 |
| { 3, 0, 4, 5, 1, 2, 6, 7 }, // 00110010 |
| { 0, 1, 4, 5, 2, 3, 6, 7 }, // 00110011 |
| { 3, 4, 0, 5, 1, 2, 6, 7 }, // 00110100 |
| { 0, 4, 1, 5, 2, 3, 6, 7 }, // 00110101 |
| { 4, 0, 1, 5, 2, 3, 6, 7 }, // 00110110 |
| { 0, 1, 2, 5, 3, 4, 6, 7 }, // 00110111 |
| { 3, 4, 5, 0, 1, 2, 6, 7 }, // 00111000 |
| { 0, 4, 5, 1, 2, 3, 6, 7 }, // 00111001 |
| { 4, 0, 5, 1, 2, 3, 6, 7 }, // 00111010 |
| { 0, 1, 5, 2, 3, 4, 6, 7 }, // 00111011 |
| { 4, 5, 0, 1, 2, 3, 6, 7 }, // 00111100 |
| { 0, 5, 1, 2, 3, 4, 6, 7 }, // 00111101 |
| { 5, 0, 1, 2, 3, 4, 6, 7 }, // 00111110 |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 00111111 |
| { 1, 2, 3, 4, 5, 6, 0, 7 }, // 01000000 |
| { 0, 2, 3, 4, 5, 6, 1, 7 }, // 01000001 |
| { 2, 0, 3, 4, 5, 6, 1, 7 }, // 01000010 |
| { 0, 1, 3, 4, 5, 6, 2, 7 }, // 01000011 |
| { 2, 3, 0, 4, 5, 6, 1, 7 }, // 01000100 |
| { 0, 3, 1, 4, 5, 6, 2, 7 }, // 01000101 |
| { 3, 0, 1, 4, 5, 6, 2, 7 }, // 01000110 |
| { 0, 1, 2, 4, 5, 6, 3, 7 }, // 01000111 |
| { 2, 3, 4, 0, 5, 6, 1, 7 }, // 01001000 |
| { 0, 3, 4, 1, 5, 6, 2, 7 }, // 01001001 |
| { 3, 0, 4, 1, 5, 6, 2, 7 }, // 01001010 |
| { 0, 1, 4, 2, 5, 6, 3, 7 }, // 01001011 |
| { 3, 4, 0, 1, 5, 6, 2, 7 }, // 01001100 |
| { 0, 4, 1, 2, 5, 6, 3, 7 }, // 01001101 |
| { 4, 0, 1, 2, 5, 6, 3, 7 }, // 01001110 |
| { 0, 1, 2, 3, 5, 6, 4, 7 }, // 01001111 |
| { 2, 3, 4, 5, 0, 6, 1, 7 }, // 01010000 |
| { 0, 3, 4, 5, 1, 6, 2, 7 }, // 01010001 |
| { 3, 0, 4, 5, 1, 6, 2, 7 }, // 01010010 |
| { 0, 1, 4, 5, 2, 6, 3, 7 }, // 01010011 |
| { 3, 4, 0, 5, 1, 6, 2, 7 }, // 01010100 |
| { 0, 4, 1, 5, 2, 6, 3, 7 }, // 01010101 |
| { 4, 0, 1, 5, 2, 6, 3, 7 }, // 01010110 |
| { 0, 1, 2, 5, 3, 6, 4, 7 }, // 01010111 |
| { 3, 4, 5, 0, 1, 6, 2, 7 }, // 01011000 |
| { 0, 4, 5, 1, 2, 6, 3, 7 }, // 01011001 |
| { 4, 0, 5, 1, 2, 6, 3, 7 }, // 01011010 |
| { 0, 1, 5, 2, 3, 6, 4, 7 }, // 01011011 |
| { 4, 5, 0, 1, 2, 6, 3, 7 }, // 01011100 |
| { 0, 5, 1, 2, 3, 6, 4, 7 }, // 01011101 |
| { 5, 0, 1, 2, 3, 6, 4, 7 }, // 01011110 |
| { 0, 1, 2, 3, 4, 6, 5, 7 }, // 01011111 |
| { 2, 3, 4, 5, 6, 0, 1, 7 }, // 01100000 |
| { 0, 3, 4, 5, 6, 1, 2, 7 }, // 01100001 |
| { 3, 0, 4, 5, 6, 1, 2, 7 }, // 01100010 |
| { 0, 1, 4, 5, 6, 2, 3, 7 }, // 01100011 |
| { 3, 4, 0, 5, 6, 1, 2, 7 }, // 01100100 |
| { 0, 4, 1, 5, 6, 2, 3, 7 }, // 01100101 |
| { 4, 0, 1, 5, 6, 2, 3, 7 }, // 01100110 |
| { 0, 1, 2, 5, 6, 3, 4, 7 }, // 01100111 |
| { 3, 4, 5, 0, 6, 1, 2, 7 }, // 01101000 |
| { 0, 4, 5, 1, 6, 2, 3, 7 }, // 01101001 |
| { 4, 0, 5, 1, 6, 2, 3, 7 }, // 01101010 |
| { 0, 1, 5, 2, 6, 3, 4, 7 }, // 01101011 |
| { 4, 5, 0, 1, 6, 2, 3, 7 }, // 01101100 |
| { 0, 5, 1, 2, 6, 3, 4, 7 }, // 01101101 |
| { 5, 0, 1, 2, 6, 3, 4, 7 }, // 01101110 |
| { 0, 1, 2, 3, 6, 4, 5, 7 }, // 01101111 |
| { 3, 4, 5, 6, 0, 1, 2, 7 }, // 01110000 |
| { 0, 4, 5, 6, 1, 2, 3, 7 }, // 01110001 |
| { 4, 0, 5, 6, 1, 2, 3, 7 }, // 01110010 |
| { 0, 1, 5, 6, 2, 3, 4, 7 }, // 01110011 |
| { 4, 5, 0, 6, 1, 2, 3, 7 }, // 01110100 |
| { 0, 5, 1, 6, 2, 3, 4, 7 }, // 01110101 |
| { 5, 0, 1, 6, 2, 3, 4, 7 }, // 01110110 |
| { 0, 1, 2, 6, 3, 4, 5, 7 }, // 01110111 |
| { 4, 5, 6, 0, 1, 2, 3, 7 }, // 01111000 |
| { 0, 5, 6, 1, 2, 3, 4, 7 }, // 01111001 |
| { 5, 0, 6, 1, 2, 3, 4, 7 }, // 01111010 |
| { 0, 1, 6, 2, 3, 4, 5, 7 }, // 01111011 |
| { 5, 6, 0, 1, 2, 3, 4, 7 }, // 01111100 |
| { 0, 6, 1, 2, 3, 4, 5, 7 }, // 01111101 |
| { 6, 0, 1, 2, 3, 4, 5, 7 }, // 01111110 |
| { 0, 1, 2, 3, 4, 5, 6, 7 }, // 01111111 |
| { 1, 2, 3, 4, 5, 6, 7, 0 }, // 10000000 |
| { 0, 2, 3, 4, 5, 6, 7, 1 }, // 10000001 |
| { 2, 0, 3, 4, 5, 6, 7, 1 }, // 10000010 |
| { 0, 1, 3, 4, 5, 6, 7, 2 }, // 10000011 |
| { 2, 3, 0, 4, 5, 6, 7, 1 }, // 10000100 |
| { 0, 3, 1, 4, 5, 6, 7, 2 }, // 10000101 |
| { 3, 0, 1, 4, 5, 6, 7, 2 }, // 10000110 |
| { 0, 1, 2, 4, 5, 6, 7, 3 }, // 10000111 |
| { 2, 3, 4, 0, 5, 6, 7, 1 }, // 10001000 |
| { 0, 3, 4, 1, 5, 6, 7, 2 }, // 10001001 |
| { 3, 0, 4, 1, 5, 6, 7, 2 }, // 10001010 |
| { 0, 1, 4, 2, 5, 6, 7, 3 }, // 10001011 |
| { 3, 4, 0, 1, 5, 6, 7, 2 }, // 10001100 |
| { 0, 4, 1, 2, 5, 6, 7, 3 }, // 10001101 |
| { 4, 0, 1, 2, 5, 6, 7, 3 }, // 10001110 |
| { 0, 1, 2, 3, 5, 6, 7, 4 }, // 10001111 |
| { 2, 3, 4, 5, 0, 6, 7, 1 }, // 10010000 |
| { 0, 3, 4, 5, 1, 6, 7, 2 }, // 10010001 |
| { 3, 0, 4, 5, 1, 6, 7, 2 }, // 10010010 |
| { 0, 1, 4, 5, 2, 6, 7, 3 }, // 10010011 |
| { 3, 4, 0, 5, 1, 6, 7, 2 }, // 10010100 |
| { 0, 4, 1, 5, 2, 6, 7, 3 }, // 10010101 |
| { 4, 0, 1, 5, 2, 6, 7, 3 }, // 10010110 |
| { 0, 1, 2, 5, 3, 6, 7, 4 }, // 10010111 |
| { 3, 4, 5, 0, 1, 6, 7, 2 }, // 10011000 |
| { 0, 4, 5, 1, 2, 6, 7, 3 }, // 10011001 |
| { 4, 0, 5, 1, 2, 6, 7, 3 }, // 10011010 |
| { 0, 1, 5, 2, 3, 6, 7, 4 }, // 10011011 |
| { 4, 5, 0, 1, 2, 6, 7, 3 }, // 10011100 |
| { 0, 5, 1, 2, 3, 6, 7, 4 }, // 10011101 |
| { 5, 0, 1, 2, 3, 6, 7, 4 }, // 10011110 |
| { 0, 1, 2, 3, 4, 6, 7, 5 }, // 10011111 |
| { 2, 3, 4, 5, 6, 0, 7, 1 }, // 10100000 |
| { 0, 3, 4, 5, 6, 1, 7, 2 }, // 10100001 |
| { 3, 0, 4, 5, 6, 1, 7, 2 }, // 10100010 |
| { 0, 1, 4, 5, 6, 2, 7, 3 }, // 10100011 |
| { 3, 4, 0, 5, 6, 1, 7, 2 }, // 10100100 |
| { 0, 4, 1, 5, 6, 2, 7, 3 }, // 10100101 |
| { 4, 0, 1, 5, 6, 2, 7, 3 }, // 10100110 |
| { 0, 1, 2, 5, 6, 3, 7, 4 }, // 10100111 |
| { 3, 4, 5, 0, 6, 1, 7, 2 }, // 10101000 |
| { 0, 4, 5, 1, 6, 2, 7, 3 }, // 10101001 |
| { 4, 0, 5, 1, 6, 2, 7, 3 }, // 10101010 |
| { 0, 1, 5, 2, 6, 3, 7, 4 }, // 10101011 |
| { 4, 5, 0, 1, 6, 2, 7, 3 }, // 10101100 |
| { 0, 5, 1, 2, 6, 3, 7, 4 }, // 10101101 |
| { 5, 0, 1, 2, 6, 3, 7, 4 }, // 10101110 |
| { 0, 1, 2, 3, 6, 4, 7, 5 }, // 10101111 |
| { 3, 4, 5, 6, 0, 1, 7, 2 }, // 10110000 |
| { 0, 4, 5, 6, 1, 2, 7, 3 }, // 10110001 |
| { 4, 0, 5, 6, 1, 2, 7, 3 }, // 10110010 |
| { 0, 1, 5, 6, 2, 3, 7, 4 }, // 10110011 |
| { 4, 5, 0, 6, 1, 2, 7, 3 }, // 10110100 |
| { 0, 5, 1, 6, 2, 3, 7, 4 }, // 10110101 |
| { 5, 0, 1, 6, 2, 3, 7, 4 }, // 10110110 |
| { 0, 1, 2, 6, 3, 4, 7, 5 }, // 10110111 |
| { 4, 5, 6, 0, 1, 2, 7, 3 }, // 10111000 |
| { 0, 5, 6, 1, 2, 3, 7, 4 }, // 10111001 |
| { 5, 0, 6, 1, 2, 3, 7, 4 }, // 10111010 |
| { 0, 1, 6, 2, 3, 4, 7, 5 }, // 10111011 |
| { 5, 6, 0, 1, 2, 3, 7, 4 }, // 10111100 |
| { 0, 6, 1, 2, 3, 4, 7, 5 }, // 10111101 |
| { 6, 0, 1, 2, 3, 4, 7, 5 }, // 10111110 |
| { 0, 1, 2, 3, 4, 5, 7, 6 }, // 10111111 |
| { 2, 3, 4, 5, 6, 7, 0, 1 }, // 11000000 |
| { 0, 3, 4, 5, 6, 7, 1, 2 }, // 11000001 |
| { 3, 0, 4, 5, 6, 7, 1, 2 }, // 11000010 |
| { 0, 1, 4, 5, 6, 7, 2, 3 }, // 11000011 |
| { 3, 4, 0, 5, 6, 7, 1, 2 }, // 11000100 |
| { 0, 4, 1, 5, 6, 7, 2, 3 }, // 11000101 |
| { 4, 0, 1, 5, 6, 7, 2, 3 }, // 11000110 |
| { 0, 1, 2, 5, 6, 7, 3, 4 }, // 11000111 |
| { 3, 4, 5, 0, 6, 7, 1, 2 }, // 11001000 |
| { 0, 4, 5, 1, 6, 7, 2, 3 }, // 11001001 |
| { 4, 0, 5, 1, 6, 7, 2, 3 }, // 11001010 |
| { 0, 1, 5, 2, 6, 7, 3, 4 }, // 11001011 |
| { 4, 5, 0, 1, 6, 7, 2, 3 }, // 11001100 |
| { 0, 5, 1, 2, 6, 7, 3, 4 }, // 11001101 |
| { 5, 0, 1, 2, 6, 7, 3, 4 }, // 11001110 |
| { 0, 1, 2, 3, 6, 7, 4, 5 }, // 11001111 |
| { 3, 4, 5, 6, 0, 7, 1, 2 }, // 11010000 |
| { 0, 4, 5, 6, 1, 7, 2, 3 }, // 11010001 |
| { 4, 0, 5, 6, 1, 7, 2, 3 }, // 11010010 |
| { 0, 1, 5, 6, 2, 7, 3, 4 }, // 11010011 |
| { 4, 5, 0, 6, 1, 7, 2, 3 }, // 11010100 |
| { 0, 5, 1, 6, 2, 7, 3, 4 }, // 11010101 |
| { 5, 0, 1, 6, 2, 7, 3, 4 }, // 11010110 |
| { 0, 1, 2, 6, 3, 7, 4, 5 }, // 11010111 |
| { 4, 5, 6, 0, 1, 7, 2, 3 }, // 11011000 |
| { 0, 5, 6, 1, 2, 7, 3, 4 }, // 11011001 |
| { 5, 0, 6, 1, 2, 7, 3, 4 }, // 11011010 |
| { 0, 1, 6, 2, 3, 7, 4, 5 }, // 11011011 |
| { 5, 6, 0, 1, 2, 7, 3, 4 }, // 11011100 |
| { 0, 6, 1, 2, 3, 7, 4, 5 }, // 11011101 |
| { 6, 0, 1, 2, 3, 7, 4, 5 }, // 11011110 |
| { 0, 1, 2, 3, 4, 7, 5, 6 }, // 11011111 |
| { 3, 4, 5, 6, 7, 0, 1, 2 }, // 11100000 |
| { 0, 4, 5, 6, 7, 1, 2, 3 }, // 11100001 |
| { 4, 0, 5, 6, 7, 1, 2, 3 }, // 11100010 |
| { 0, 1, 5, 6, 7, 2, 3, 4 }, // 11100011 |
| { 4, 5, 0, 6, 7, 1, 2, 3 }, // 11100100 |
| { 0, 5, 1, 6, 7, 2, 3, 4 }, // 11100101 |
| { 5, 0, 1, 6, 7, 2, 3, 4 }, // 11100110 |
| { 0, 1, 2, 6, 7, 3, 4, 5 }, // 11100111 |
| { 4, 5, 6, 0, 7, 1, 2, 3 }, // 11101000 |
| { 0, 5, 6, 1, 7, 2, 3, 4 }, // 11101001 |
| { 5, 0, 6, 1, 7, 2, 3, 4 }, // 11101010 |
| { 0, 1, 6, 2, 7, 3, 4, 5 }, // 11101011 |
| { 5, 6, 0, 1, 7, 2, 3, 4 }, // 11101100 |
| { 0, 6, 1, 2, 7, 3, 4, 5 }, // 11101101 |
| { 6, 0, 1, 2, 7, 3, 4, 5 }, // 11101110 |
| { 0, 1, 2, 3, 7, 4, 5, 6 }, // 11101111 |
| { 4, 5, 6, 7, 0, 1, 2, 3 }, // 11110000 |
| { 0, 5, 6, 7, 1, 2, 3, 4 }, // 11110001 |
| { 5, 0, 6, 7, 1, 2, 3, 4 }, // 11110010 |
| { 0, 1, 6, 7, 2, 3, 4, 5 }, // 11110011 |
| { 5, 6, 0, 7, 1, 2, 3, 4 }, // 11110100 |
| { 0, 6, 1, 7, 2, 3, 4, 5 }, // 11110101 |
| { 6, 0, 1, 7, 2, 3, 4, 5 }, // 11110110 |
| { 0, 1, 2, 7, 3, 4, 5, 6 }, // 11110111 |
| { 5, 6, 7, 0, 1, 2, 3, 4 }, // 11111000 |
| { 0, 6, 7, 1, 2, 3, 4, 5 }, // 11111001 |
| { 6, 0, 7, 1, 2, 3, 4, 5 }, // 11111010 |
| { 0, 1, 7, 2, 3, 4, 5, 6 }, // 11111011 |
| { 6, 7, 0, 1, 2, 3, 4, 5 }, // 11111100 |
| { 0, 7, 1, 2, 3, 4, 5, 6 }, // 11111101 |
| { 7, 0, 1, 2, 3, 4, 5, 6 }, // 11111110 |
| { 0, 1, 2, 3, 4, 5, 6, 7 } // 11111111 |
| }; |
| |
| assert( uPhase > 0 && uPhase < (unsigned)(1 << nVars) ); |
| |
| // the same function |
| if ( Cases[uPhase] == 0 ) |
| { |
| int i; |
| for ( i = 0; i < nWords; i++ ) |
| puTruthR[i] = puTruth[i]; |
| return; |
| } |
| |
| // an elementary variable |
| if ( Cases[uPhase] > 0 ) |
| { |
| int i; |
| for ( i = 0; i < nWords; i++ ) |
| puTruthR[i] = uTruths[(int)Cases[uPhase]][i]; |
| return; |
| } |
| |
| // truth table takes one word |
| if ( nWords == 1 ) |
| { |
| int i, k, nMints, iRes; |
| char * pPerm = Perms[uPhase]; |
| puTruthR[0] = 0; |
| nMints = (1 << nVars); |
| for ( i = 0; i < nMints; i++ ) |
| if ( puTruth[0] & (1 << i) ) |
| { |
| for ( iRes = 0, k = 0; k < nVars; k++ ) |
| if ( i & (1 << pPerm[k]) ) |
| iRes |= (1 << k); |
| puTruthR[0] |= (1 << iRes); |
| } |
| return; |
| } |
| else if ( nWords == 2 ) |
| { |
| int i, k, iRes; |
| char * pPerm = Perms[uPhase]; |
| puTruthR[0] = puTruthR[1] = 0; |
| for ( i = 0; i < 32; i++ ) |
| { |
| if ( puTruth[0] & (1 << i) ) |
| { |
| for ( iRes = 0, k = 0; k < 6; k++ ) |
| if ( i & (1 << pPerm[k]) ) |
| iRes |= (1 << k); |
| if ( iRes < 32 ) |
| puTruthR[0] |= (1 << iRes); |
| else |
| puTruthR[1] |= (1 << (iRes-32)); |
| } |
| } |
| for ( ; i < 64; i++ ) |
| { |
| if ( puTruth[1] & (1 << (i-32)) ) |
| { |
| for ( iRes = 0, k = 0; k < 6; k++ ) |
| if ( i & (1 << pPerm[k]) ) |
| iRes |= (1 << k); |
| if ( iRes < 32 ) |
| puTruthR[0] |= (1 << iRes); |
| else |
| puTruthR[1] |= (1 << (iRes-32)); |
| } |
| } |
| } |
| // truth table takes more than one word |
| else |
| { |
| int i, k, nMints, iRes; |
| char * pPerm = Perms[uPhase]; |
| for ( i = 0; i < nWords; i++ ) |
| puTruthR[i] = 0; |
| nMints = (1 << nVars); |
| for ( i = 0; i < nMints; i++ ) |
| if ( puTruth[i>>5] & (1 << (i&31)) ) |
| { |
| for ( iRes = 0, k = 0; k < 5; k++ ) |
| if ( i & (1 << pPerm[k]) ) |
| iRes |= (1 << k); |
| puTruthR[iRes>>5] |= (1 << (iRes&31)); |
| } |
| } |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Allocated lookup table for truth table permutation.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned short ** Extra_TruthPerm43() |
| { |
| unsigned short ** pTable; |
| unsigned uTruth; |
| int i, k; |
| pTable = (unsigned short **)Extra_ArrayAlloc( 256, 16, 2 ); |
| for ( i = 0; i < 256; i++ ) |
| { |
| uTruth = (i << 8) | i; |
| for ( k = 0; k < 16; k++ ) |
| pTable[i][k] = Extra_TruthPerm4One( uTruth, k ); |
| } |
| return pTable; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Allocated lookup table for truth table permutation.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned ** Extra_TruthPerm53() |
| { |
| unsigned ** pTable; |
| unsigned uTruth; |
| int i, k; |
| pTable = (unsigned **)Extra_ArrayAlloc( 256, 32, 4 ); |
| for ( i = 0; i < 256; i++ ) |
| { |
| uTruth = (i << 24) | (i << 16) | (i << 8) | i; |
| for ( k = 0; k < 32; k++ ) |
| pTable[i][k] = Extra_TruthPerm5One( uTruth, k ); |
| } |
| return pTable; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Allocated lookup table for truth table permutation.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned ** Extra_TruthPerm54() |
| { |
| unsigned ** pTable; |
| unsigned uTruth; |
| int i; |
| pTable = (unsigned **)Extra_ArrayAlloc( 256*256, 4, 4 ); |
| for ( i = 0; i < 256*256; i++ ) |
| { |
| uTruth = (i << 16) | i; |
| pTable[i][0] = Extra_TruthPerm5One( uTruth, 31-8 ); |
| pTable[i][1] = Extra_TruthPerm5One( uTruth, 31-4 ); |
| pTable[i][2] = Extra_TruthPerm5One( uTruth, 31-2 ); |
| pTable[i][3] = Extra_TruthPerm5One( uTruth, 31-1 ); |
| } |
| return pTable; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Allocated lookup table for truth table permutation.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned ** Extra_TruthPerm63() |
| { |
| unsigned ** pTable; |
| unsigned uTruth[2]; |
| int i, k; |
| pTable = (unsigned **)Extra_ArrayAlloc( 256, 64, 8 ); |
| for ( i = 0; i < 256; i++ ) |
| { |
| uTruth[0] = (i << 24) | (i << 16) | (i << 8) | i; |
| uTruth[1] = uTruth[0]; |
| for ( k = 0; k < 64; k++ ) |
| Extra_TruthPerm6One( uTruth, k, &pTable[i][k] ); |
| } |
| return pTable; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Returns the pointer to the elementary truth tables.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| unsigned ** Extra_Truths8() |
| { |
| static unsigned uTruths[8][8] = { |
| { 0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA }, |
| { 0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC }, |
| { 0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0 }, |
| { 0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00 }, |
| { 0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000 }, |
| { 0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF }, |
| { 0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF }, |
| { 0x00000000,0x00000000,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF } |
| }; |
| static unsigned * puResult[8] = { |
| uTruths[0], uTruths[1], uTruths[2], uTruths[3], uTruths[4], uTruths[5], uTruths[6], uTruths[7] |
| }; |
| return (unsigned **)puResult; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Bubble-sorts components by scores in increasing order.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_BubbleSort( int Order[], int Costs[], int nSize, int fIncreasing ) |
| { |
| int i, Temp, fChanges; |
| assert( nSize < 1000 ); |
| for ( i = 0; i < nSize; i++ ) |
| Order[i] = i; |
| if ( fIncreasing ) |
| { |
| do { |
| fChanges = 0; |
| for ( i = 0; i < nSize - 1; i++ ) |
| { |
| if ( Costs[Order[i]] <= Costs[Order[i+1]] ) |
| continue; |
| Temp = Order[i]; |
| Order[i] = Order[i+1]; |
| Order[i+1] = Temp; |
| fChanges = 1; |
| } |
| } while ( fChanges ); |
| } |
| else |
| { |
| do { |
| fChanges = 0; |
| for ( i = 0; i < nSize - 1; i++ ) |
| { |
| if ( Costs[Order[i]] >= Costs[Order[i+1]] ) |
| continue; |
| Temp = Order[i]; |
| Order[i] = Order[i+1]; |
| Order[i+1] = Temp; |
| fChanges = 1; |
| } |
| } while ( fChanges ); |
| } |
| } |
| |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Definition of internal functions */ |
| /*---------------------------------------------------------------------------*/ |
| |
| /*---------------------------------------------------------------------------*/ |
| /* Definition of static Functions */ |
| /*---------------------------------------------------------------------------*/ |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes the permutation table for 8 variables.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_TruthExpandGeneratePermTable() |
| { |
| int i, k, nOnes, Last1, First0; |
| int iOne, iZero; |
| |
| printf( "\nstatic char Cases[256] = {\n" ); |
| for ( i = 0; i < 256; i++ ) |
| { |
| nOnes = 0; |
| Last1 = First0 = -1; |
| for ( k = 0; k < 8; k++ ) |
| { |
| if ( i & (1 << k) ) |
| { |
| nOnes++; |
| Last1 = k; |
| } |
| else if ( First0 == -1 ) |
| First0 = k; |
| } |
| if ( Last1 + 1 == First0 || i == 255 ) |
| printf( " %d%s", 0, (i==255? " ":",") ); |
| else if ( nOnes == 1 ) |
| printf( " %d,", Last1 ); |
| else |
| printf( " -%d,", 1 ); |
| printf( " // " ); |
| Extra_PrintBinary( stdout, (unsigned*)&i, 8 ); |
| printf( "\n" ); |
| } |
| printf( "};\n" ); |
| |
| printf( "\nstatic char Perms[256][8] = {\n" ); |
| for ( i = 0; i < 256; i++ ) |
| { |
| printf( " {" ); |
| nOnes = 0; |
| for ( k = 0; k < 8; k++ ) |
| if ( i & (1 << k) ) |
| nOnes++; |
| iOne = 0; |
| iZero = nOnes; |
| for ( k = 0; k < 8; k++ ) |
| if ( i & (1 << k) ) |
| printf( "%s %d", (k==0? "":","), iOne++ ); |
| else |
| printf( "%s %d", (k==0? "":","), iZero++ ); |
| assert( iOne + iZero == 8 ); |
| printf( " }%s // ", (i==255? " ":",") ); |
| Extra_PrintBinary( stdout, (unsigned*)&i, 8 ); |
| printf( "\n" ); |
| } |
| printf( "};\n" ); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes complementation schedule for 2^n Grey codes.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int * Extra_GreyCodeSchedule( int n ) |
| { |
| int * pRes = ABC_ALLOC( int, (1<<n) ); |
| int i, k, b = 0; |
| // pRes[b++] = -1; |
| for ( k = 0; k < n; k++ ) |
| for ( pRes[b++] = k, i = 1; i < (1<<k); i++ ) |
| pRes[b++] = pRes[i-1]; // pRes[i]; |
| pRes[b++] = n-1; |
| assert( b == (1<<n) ); |
| |
| if ( 0 ) |
| { |
| unsigned uSign = 0; |
| for ( b = 0; b < (1<<n); b++ ) |
| { |
| uSign ^= (1 << pRes[b]); |
| printf( "%3d %3d ", b, pRes[b] ); |
| Extra_PrintBinary( stdout, &uSign, n ); |
| printf( "\n" ); |
| } |
| } |
| return pRes; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes permutation schedule for n! permutations.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int * Extra_PermSchedule( int n ) |
| { |
| int nFact = Extra_Factorial(n); |
| int nGroups = nFact / n / 2; |
| int * pRes = ABC_ALLOC( int, nFact ); |
| int * pRes0, i, k, b = 0; |
| assert( n > 0 ); |
| if ( n == 1 ) |
| { |
| pRes[0] = 0; |
| return pRes; |
| } |
| if ( n == 2 ) |
| { |
| pRes[0] = pRes[1] = 0; |
| return pRes; |
| } |
| pRes0 = Extra_PermSchedule( n-1 ); |
| for ( k = 0; k < nGroups; k++ ) |
| { |
| for ( i = n-1; i > 0; i-- ) |
| pRes[b++] = i-1; |
| pRes[b++] = pRes0[2*k]+1; |
| for ( i = 0; i < n-1; i++ ) |
| pRes[b++] = i; |
| pRes[b++] = pRes0[2*k+1]; |
| } |
| ABC_FREE( pRes0 ); |
| assert( b == nFact ); |
| |
| if ( 0 ) |
| { |
| int Perm[16]; |
| for ( i = 0; i < n; i++ ) |
| Perm[i] = i; |
| for ( b = 0; b < nFact; b++ ) |
| { |
| ABC_SWAP( int, Perm[pRes[b]], Perm[pRes[b]+1] ); |
| printf( "%3d %3d ", b, pRes[b] ); |
| for ( i = 0; i < n; i++ ) |
| printf( "%d", Perm[i] ); |
| printf( "\n" ); |
| } |
| } |
| return pRes; |
| } |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [Finds minimum form of a 6-input function.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| static inline word Extra_Truth6SwapAdjacent( word t, int v ) |
| { |
| // variable swapping code |
| static word PMasks[5][3] = { |
| { ABC_CONST(0x9999999999999999), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444) }, |
| { ABC_CONST(0xC3C3C3C3C3C3C3C3), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030) }, |
| { ABC_CONST(0xF00FF00FF00FF00F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00) }, |
| { ABC_CONST(0xFF0000FFFF0000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000) }, |
| { ABC_CONST(0xFFFF00000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000) } |
| }; |
| assert( v < 5 ); |
| return (t & PMasks[v][0]) | ((t & PMasks[v][1]) << (1 << v)) | ((t & PMasks[v][2]) >> (1 << v)); |
| } |
| static inline word Extra_Truth6ChangePhase( word t, int v ) |
| { |
| // elementary truth tables |
| static word Truth6[6] = { |
| ABC_CONST(0xAAAAAAAAAAAAAAAA), |
| ABC_CONST(0xCCCCCCCCCCCCCCCC), |
| ABC_CONST(0xF0F0F0F0F0F0F0F0), |
| ABC_CONST(0xFF00FF00FF00FF00), |
| ABC_CONST(0xFFFF0000FFFF0000), |
| ABC_CONST(0xFFFFFFFF00000000) |
| }; |
| assert( v < 6 ); |
| return ((t & ~Truth6[v]) << (1 << v)) | ((t & Truth6[v]) >> (1 << v)); |
| } |
| word Extra_Truth6MinimumExact( word t, int * pComp, int * pPerm ) |
| { |
| word tMin = ~(word)0; |
| word tCur, tTemp1, tTemp2; |
| int i, p, c; |
| for ( i = 0; i < 2; i++ ) |
| { |
| tCur = i ? ~t : t; |
| tTemp1 = tCur; |
| for ( p = 0; p < 720; p++ ) |
| { |
| // printf( "Trying perm %d:\n", p ); |
| // Kit_DsdPrintFromTruth( &tCur, 6 ), printf( "\n" );; |
| tTemp2 = tCur; |
| for ( c = 0; c < 64; c++ ) |
| { |
| tMin = Abc_MinWord( tMin, tCur ); |
| tCur = Extra_Truth6ChangePhase( tCur, pComp[c] ); |
| } |
| assert( tTemp2 == tCur ); |
| tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] ); |
| } |
| assert( tTemp1 == tCur ); |
| } |
| return tMin; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Perform heuristic TT minimization.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| static inline int Extra_Truth6Ones( word t ) |
| { |
| t = (t & ABC_CONST(0x5555555555555555)) + ((t>> 1) & ABC_CONST(0x5555555555555555)); |
| t = (t & ABC_CONST(0x3333333333333333)) + ((t>> 2) & ABC_CONST(0x3333333333333333)); |
| t = (t & ABC_CONST(0x0F0F0F0F0F0F0F0F)) + ((t>> 4) & ABC_CONST(0x0F0F0F0F0F0F0F0F)); |
| t = (t & ABC_CONST(0x00FF00FF00FF00FF)) + ((t>> 8) & ABC_CONST(0x00FF00FF00FF00FF)); |
| t = (t & ABC_CONST(0x0000FFFF0000FFFF)) + ((t>>16) & ABC_CONST(0x0000FFFF0000FFFF)); |
| return (t & ABC_CONST(0x00000000FFFFFFFF)) + (t>>32); |
| } |
| static inline word Extra_Truth6MinimumRoundOne( word t, int v ) |
| { |
| word tCur, tMin = t; // ab |
| assert( v >= 0 && v < 5 ); |
| |
| tCur = Extra_Truth6ChangePhase( t, v ); // !ab |
| tMin = Abc_MinWord( tMin, tCur ); |
| tCur = Extra_Truth6ChangePhase( t, v+1 ); // a!b |
| tMin = Abc_MinWord( tMin, tCur ); |
| tCur = Extra_Truth6ChangePhase( tCur, v ); // !a!b |
| tMin = Abc_MinWord( tMin, tCur ); |
| |
| t = Extra_Truth6SwapAdjacent( t, v ); // ba |
| tMin = Abc_MinWord( tMin, t ); |
| |
| tCur = Extra_Truth6ChangePhase( t, v ); // !ba |
| tMin = Abc_MinWord( tMin, tCur ); |
| tCur = Extra_Truth6ChangePhase( t, v+1 ); // b!a |
| tMin = Abc_MinWord( tMin, tCur ); |
| tCur = Extra_Truth6ChangePhase( tCur, v ); // !b!a |
| tMin = Abc_MinWord( tMin, tCur ); |
| |
| return tMin; |
| } |
| static inline word Extra_Truth6MinimumRoundMany( word t ) |
| { |
| int i, k, Limit = 10; |
| word tCur, tMin = t; |
| for ( i = 0; i < Limit; i++ ) |
| { |
| word tMin0 = tMin; |
| for ( k = 4; k >= 0; k-- ) |
| { |
| tCur = Extra_Truth6MinimumRoundOne( tMin, k ); |
| tMin = Abc_MinWord( tMin, tCur ); |
| } |
| if ( tMin0 == tMin ) |
| break; |
| } |
| return tMin; |
| } |
| word Extra_Truth6MinimumHeuristic( word t ) |
| { |
| word tMin1, tMin2; |
| int nOnes = Extra_Truth6Ones( t ); |
| if ( nOnes < 32 ) |
| return Extra_Truth6MinimumRoundMany( t ); |
| if ( nOnes > 32 ) |
| return Extra_Truth6MinimumRoundMany( ~t ); |
| tMin1 = Extra_Truth6MinimumRoundMany( t ); |
| tMin2 = Extra_Truth6MinimumRoundMany( ~t ); |
| return Abc_MinWord( tMin1, tMin2 ); |
| } |
| void Extra_Truth6MinimumHeuristicTest() |
| { |
| word t = ABC_CONST(0x5555555555555555) & ~(ABC_CONST(0x3333333333333333) & ABC_CONST(0x0F0F0F0F0F0F0F0F)); |
| Extra_Truth6MinimumRoundMany( t ); |
| t = 0; |
| } |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [Reads functions from file.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| word * Extra_NpnRead( char * pFileName, int nFuncs ) |
| { |
| FILE * pFile; |
| word * pFuncs; |
| char pBuffer[100]; |
| int i = 0; |
| pFuncs = ABC_CALLOC( word, nFuncs ); |
| pFile = fopen( pFileName, "rb" ); |
| while ( fgets( pBuffer, 100, pFile ) ) |
| Extra_ReadHex( (unsigned *)(pFuncs + i++), (pBuffer[1] == 'x' ? pBuffer+2 : pBuffer), 16 ); |
| fclose( pFile ); |
| assert( i == nFuncs ); |
| for ( i = 0; i < Abc_MinInt(nFuncs, 10); i++ ) |
| { |
| printf( "Line %d : ", i ); |
| Extra_PrintHex( stdout, (unsigned *)(pFuncs + i), 6 ), printf( "\n" ); |
| } |
| return pFuncs; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Comparison for words.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int CompareWords( void * p1, void * p2 ) |
| { |
| word Word1 = *(word *)p1; |
| word Word2 = *(word *)p2; |
| if ( Word1 < Word2 ) |
| return -1; |
| if ( Word1 > Word2 ) |
| return 1; |
| return 0; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [Computes the permutation table for 8 variables.] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_NpnTest1() |
| { |
| int * pComp; |
| pComp = Extra_PermSchedule( 5 ); |
| // pComp = Extra_GreyCodeSchedule( 5 ); |
| ABC_FREE( pComp ); |
| } |
| void Extra_NpnTest2() |
| { |
| int * pComp, * pPerm; |
| word tMin, t = ABC_CONST(0xa2222aaa08888000); |
| pComp = Extra_GreyCodeSchedule( 6 ); |
| pPerm = Extra_PermSchedule( 6 ); |
| tMin = Extra_Truth6MinimumExact( t, pComp, pPerm ); |
| ABC_FREE( pPerm ); |
| ABC_FREE( pComp ); |
| |
| Extra_PrintHex( stdout, (unsigned *)&t, 6 ), printf( "\n" ); |
| Extra_PrintHex( stdout, (unsigned *)&tMin, 6 ), printf( "\n" ); |
| } |
| void Extra_NpnTest() |
| { |
| // int nFuncs = 5687661; |
| // int nFuncs = 400777; |
| int nFuncs = 10; |
| abctime clk = Abc_Clock(); |
| word * pFuncs; |
| int * pComp, * pPerm; |
| int i;//, k, nUnique = 0; |
| /* |
| // read functions |
| pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\lib6var5M.txt", nFuncs ); |
| // pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\lib6var5M_out_Total_minimal.txt", nFuncs ); |
| qsort( (void *)pFuncs, nFuncs, sizeof(word), (int(*)(const void *,const void *))CompareWords ); |
| |
| // count unique |
| k = 1; |
| for ( i = 1; i < nFuncs; i++ ) |
| if ( pFuncs[i] != pFuncs[i-1] ) |
| pFuncs[k++] = pFuncs[i]; |
| nFuncs = k; |
| printf( "Total number of unique functions = %d\n", nFuncs ); |
| */ |
| // pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\lib6var5M_out_Total_minimal.txt", nFuncs ); |
| pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\test.txt", nFuncs ); |
| pComp = Extra_GreyCodeSchedule( 6 ); |
| pPerm = Extra_PermSchedule( 6 ); |
| // compute minimum forms |
| for ( i = 0; i < nFuncs; i++ ) |
| { |
| pFuncs[i] = Extra_Truth6MinimumExact( pFuncs[i], pComp, pPerm ); |
| if ( i % 10000 == 0 ) |
| printf( "%d\n", i ); |
| } |
| printf( "Finished deriving minimum form\n" ); |
| /* |
| // sort them by value |
| qsort( (void *)pFuncs, nFuncs, sizeof(word), (int(*)(const void *,const void *))CompareWords ); |
| // count unique |
| nUnique = nFuncs; |
| for ( i = 1; i < nFuncs; i++ ) |
| if ( pFuncs[i] == pFuncs[i-1] ) |
| nUnique--; |
| printf( "Total number of unique ones = %d\n", nUnique ); |
| */ |
| for ( i = 0; i < Abc_MinInt(nFuncs, 10); i++ ) |
| { |
| printf( "Line %d : ", i ); |
| Extra_PrintHex( stdout, (unsigned *)(pFuncs + i), 6 ), printf( "\n" ); |
| } |
| ABC_FREE( pPerm ); |
| ABC_FREE( pComp ); |
| ABC_FREE( pFuncs ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| } |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Extra_NtkPrintBin( word * pT, int nBits ) |
| { |
| int i; |
| for ( i = nBits - 1; i >= 0; i-- ) |
| printf( "%d", (int)((*pT >> i) & 1) ); |
| } |
| void Extra_NtkPowerTest() |
| { |
| int i, j, k, n = 4; |
| for ( i = 0; i < (1<<n); i++ ) |
| for ( j = 0; j < (1<<n); j++ ) |
| { |
| word t = (word)i; |
| for ( k = 1; k < j; k++ ) |
| t *= (word)i; |
| Extra_NtkPrintBin( (word *)&i, n ); |
| Extra_NtkPrintBin( (word *)&j, n ); |
| printf( " " ); |
| Extra_NtkPrintBin( (word *)&t, 64 ); |
| printf( "\n" ); |
| } |
| } |
| |
| //////////////////////////////////////////////////////////////////////// |
| /// END OF FILE /// |
| //////////////////////////////////////////////////////////////////////// |
| |
| |
| ABC_NAMESPACE_IMPL_END |
| |