| /**CFile**************************************************************** |
| |
| FileName [bdcSpfd.c] |
| |
| SystemName [ABC: Logic synthesis and verification system.] |
| |
| PackageName [Truth-table-based bi-decomposition engine.] |
| |
| Synopsis [The gateway to bi-decomposition.] |
| |
| Author [Alan Mishchenko] |
| |
| Affiliation [UC Berkeley] |
| |
| Date [Ver. 1.0. Started - January 30, 2007.] |
| |
| Revision [$Id: bdcSpfd.c,v 1.00 2007/01/30 00:00:00 alanmi Exp $] |
| |
| ***********************************************************************/ |
| |
| #include "bdcInt.h" |
| #include "aig/aig/aig.h" |
| #include "misc/extra/extra.h" |
| |
| ABC_NAMESPACE_IMPL_START |
| |
| |
| //////////////////////////////////////////////////////////////////////// |
| /// DECLARATIONS /// |
| //////////////////////////////////////////////////////////////////////// |
| |
| typedef struct Bdc_Nod_t_ Bdc_Nod_t; |
| struct Bdc_Nod_t_ |
| { |
| unsigned iFan0g : 8; |
| unsigned iFan0n : 12; |
| unsigned Type : 12; // 0-3 = AND; 4 = XOR |
| |
| unsigned iFan1g : 8; |
| unsigned iFan1n : 12; |
| unsigned Weight : 12; |
| |
| word Truth; |
| }; |
| |
| static word Truths[6] = { |
| ABC_CONST(0xAAAAAAAAAAAAAAAA), |
| ABC_CONST(0xCCCCCCCCCCCCCCCC), |
| ABC_CONST(0xF0F0F0F0F0F0F0F0), |
| ABC_CONST(0xFF00FF00FF00FF00), |
| ABC_CONST(0xFFFF0000FFFF0000), |
| ABC_CONST(0xFFFFFFFF00000000) |
| }; |
| |
| static inline int Bdc_CountOnes( word t ) |
| { |
| t = (t & ABC_CONST(0x5555555555555555)) + ((t>> 1) & ABC_CONST(0x5555555555555555)); |
| t = (t & ABC_CONST(0x3333333333333333)) + ((t>> 2) & ABC_CONST(0x3333333333333333)); |
| t = (t & ABC_CONST(0x0F0F0F0F0F0F0F0F)) + ((t>> 4) & ABC_CONST(0x0F0F0F0F0F0F0F0F)); |
| t = (t & ABC_CONST(0x00FF00FF00FF00FF)) + ((t>> 8) & ABC_CONST(0x00FF00FF00FF00FF)); |
| t = (t & ABC_CONST(0x0000FFFF0000FFFF)) + ((t>>16) & ABC_CONST(0x0000FFFF0000FFFF)); |
| return (t & ABC_CONST(0x00000000FFFFFFFF)) + (t>>32); |
| } |
| |
| static inline int Bdc_CountSpfd( word t, word f ) |
| { |
| int n00 = Bdc_CountOnes( ~t & ~f ); |
| int n01 = Bdc_CountOnes( t & ~f ); |
| int n10 = Bdc_CountOnes( ~t & f ); |
| int n11 = Bdc_CountOnes( t & f ); |
| return n00 * n11 + n10 * n01; |
| } |
| |
| static inline word Bdc_Cof6( word t, int iVar, int fCof1 ) |
| { |
| assert( iVar >= 0 && iVar < 6 ); |
| if ( fCof1 ) |
| return (t & Truths[iVar]) | ((t & Truths[iVar]) >> (1<<iVar)); |
| else |
| return (t &~Truths[iVar]) | ((t &~Truths[iVar]) << (1<<iVar)); |
| } |
| |
| int Bdc_SpfdAdjCost( word t ) |
| { |
| word c0, c1; |
| int v, Cost = 0; |
| for ( v = 0; v < 6; v++ ) |
| { |
| c0 = Bdc_Cof6( t, v, 0 ); |
| c1 = Bdc_Cof6( t, v, 1 ); |
| Cost += Bdc_CountOnes( c0 ^ c1 ); |
| } |
| return Cost; |
| } |
| |
| |
| extern void Abc_Show6VarFunc( word F0, word F1 ); |
| |
| //////////////////////////////////////////////////////////////////////// |
| /// FUNCTION DEFINITIONS /// |
| //////////////////////////////////////////////////////////////////////// |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdPrint_rec( Bdc_Nod_t * pNode, int Level, Vec_Ptr_t * vLevels ) |
| { |
| assert( Level > 0 ); |
| printf( "(" ); |
| |
| if ( pNode->Type & 1 ) |
| printf( "!" ); |
| if ( pNode->iFan0g == 0 ) |
| printf( "%c", 'a' + pNode->iFan0n ); |
| else |
| { |
| Bdc_Nod_t * pNode0 = (Bdc_Nod_t *)Vec_PtrEntry(vLevels, pNode->iFan0g); |
| Bdc_SpfdPrint_rec( pNode0 + pNode->iFan0n, pNode->iFan0g, vLevels ); |
| } |
| |
| if ( pNode->Type & 4 ) |
| printf( "+" ); |
| else |
| printf( "*" ); |
| |
| if ( pNode->Type & 2 ) |
| printf( "!" ); |
| if ( pNode->iFan1g == 0 ) |
| printf( "%c", 'a' + pNode->iFan1n ); |
| else |
| { |
| Bdc_Nod_t * pNode1 = (Bdc_Nod_t *)Vec_PtrEntry(vLevels, pNode->iFan1g); |
| Bdc_SpfdPrint_rec( pNode1 + pNode->iFan1n, pNode->iFan1g, vLevels ); |
| } |
| |
| printf( ")" ); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdPrint( Bdc_Nod_t * pNode, int Level, Vec_Ptr_t * vLevels, word Truth ) |
| { |
| word Diff = Truth ^ pNode->Truth; |
| Extra_PrintHex( stdout, (unsigned *)&pNode->Truth, 6 ); printf( " " ); |
| Extra_PrintHex( stdout, (unsigned *)&Diff, 6 ); printf( " " ); |
| Bdc_SpfdPrint_rec( pNode, Level, vLevels ); |
| printf( " %d\n", pNode->Weight ); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdDecompose( word Truth, int nVars, int nCands, int nGatesMax ) |
| { |
| int nSize = nCands * nCands * (nGatesMax + 1) * 5; |
| Vec_Ptr_t * vLevels; |
| Vec_Int_t * vBegs, * vWeight; |
| Bdc_Nod_t * pNode, * pNode0, * pNode1, * pNode2; |
| int Count0, Count1, * pPerm; |
| int i, j, k, c, n; |
| abctime clk; |
| assert( nGatesMax < (1<<8) ); |
| assert( nCands < (1<<12) ); |
| assert( (1<<(nVars-1))*(1<<(nVars-1)) < (1<<12) ); // max SPFD |
| |
| printf( "Storage size = %d (%d * %d * %d * %d).\n", nSize, nCands, nCands, nGatesMax + 1, 5 ); |
| |
| printf( "SPFD = %d.\n", Bdc_CountOnes(Truth) * Bdc_CountOnes(~Truth) ); |
| |
| // consider elementary functions |
| if ( Truth == 0 || Truth == ~0 ) |
| { |
| printf( "Function is a constant.\n" ); |
| return; |
| } |
| for ( i = 0; i < nVars; i++ ) |
| if ( Truth == Truths[i] || Truth == ~Truths[i] ) |
| { |
| printf( "Function is an elementary variable.\n" ); |
| return; |
| } |
| |
| // allocate |
| vLevels = Vec_PtrAlloc( 100 ); |
| vBegs = Vec_IntAlloc( 100 ); |
| vWeight = Vec_IntAlloc( 100 ); |
| |
| // initialize elementary variables |
| pNode = ABC_CALLOC( Bdc_Nod_t, nVars ); |
| for ( i = 0; i < nVars; i++ ) |
| pNode[i].Truth = Truths[i]; |
| for ( i = 0; i < nVars; i++ ) |
| pNode[i].Weight = Bdc_CountSpfd( pNode[i].Truth, Truth ); |
| Vec_PtrPush( vLevels, pNode ); |
| Vec_IntPush( vBegs, nVars ); |
| |
| // the next level |
| clk = Abc_Clock(); |
| pNode0 = pNode; |
| pNode = ABC_CALLOC( Bdc_Nod_t, 5 * nVars * (nVars - 1) / 2 ); |
| for ( c = i = 0; i < nVars; i++ ) |
| for ( j = i+1; j < nVars; j++ ) |
| { |
| pNode[c].Truth = pNode0[i].Truth & pNode0[j].Truth; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 0; |
| pNode[c].Truth = ~pNode0[i].Truth & pNode0[j].Truth; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 1; |
| pNode[c].Truth = pNode0[i].Truth & ~pNode0[j].Truth; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 2; |
| pNode[c].Truth = ~pNode0[i].Truth & ~pNode0[j].Truth; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 3; |
| pNode[c].Truth = pNode0[i].Truth ^ pNode0[j].Truth; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 4; |
| } |
| assert( c == 5 * nVars * (nVars - 1) / 2 ); |
| Vec_PtrPush( vLevels, pNode ); |
| Vec_IntPush( vBegs, c ); |
| for ( i = 0; i < c; i++ ) |
| { |
| pNode[i].Weight = Bdc_CountSpfd( pNode[i].Truth, Truth ); |
| //Bdc_SpfdPrint( pNode + i, 1, vLevels ); |
| if ( Truth == pNode[i].Truth || Truth == ~pNode[i].Truth ) |
| { |
| printf( "Function can be implemented using 1 gate.\n" ); |
| pNode = NULL; |
| goto cleanup; |
| } |
| } |
| printf( "Selected %6d gates on level %2d. ", c, 1 ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| |
| |
| // iterate through levels |
| pNode = ABC_CALLOC( Bdc_Nod_t, nSize ); |
| for ( n = 2; n <= nGatesMax; n++ ) |
| { |
| clk = Abc_Clock(); |
| c = 0; |
| pNode1 = (Bdc_Nod_t *)Vec_PtrEntry( vLevels, n-1 ); |
| Count1 = Vec_IntEntry( vBegs, n-1 ); |
| // go through previous levels |
| for ( k = 0; k < n-1; k++ ) |
| { |
| pNode0 = (Bdc_Nod_t *)Vec_PtrEntry( vLevels, k ); |
| Count0 = Vec_IntEntry( vBegs, k ); |
| for ( i = 0; i < Count0; i++ ) |
| for ( j = 0; j < Count1; j++ ) |
| { |
| pNode[c].Truth = pNode0[i].Truth & pNode1[j].Truth; pNode[c].iFan0g = k; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 0; |
| pNode[c].Truth = ~pNode0[i].Truth & pNode1[j].Truth; pNode[c].iFan0g = k; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 1; |
| pNode[c].Truth = pNode0[i].Truth & ~pNode1[j].Truth; pNode[c].iFan0g = k; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 2; |
| pNode[c].Truth = ~pNode0[i].Truth & ~pNode1[j].Truth; pNode[c].iFan0g = k; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 3; |
| pNode[c].Truth = pNode0[i].Truth ^ pNode1[j].Truth; pNode[c].iFan0g = k; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 4; |
| } |
| assert( c < nSize ); |
| } |
| // go through current level |
| for ( i = 0; i < Count1; i++ ) |
| for ( j = i+1; j < Count1; j++ ) |
| { |
| pNode[c].Truth = pNode1[i].Truth & pNode1[j].Truth; pNode[c].iFan0g = n-1; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 0; |
| pNode[c].Truth = ~pNode1[i].Truth & pNode1[j].Truth; pNode[c].iFan0g = n-1; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 1; |
| pNode[c].Truth = pNode1[i].Truth & ~pNode1[j].Truth; pNode[c].iFan0g = n-1; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 2; |
| pNode[c].Truth = ~pNode1[i].Truth & ~pNode1[j].Truth; pNode[c].iFan0g = n-1; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 3; |
| pNode[c].Truth = pNode1[i].Truth ^ pNode1[j].Truth; pNode[c].iFan0g = n-1; pNode[c].iFan1g = n-1; pNode[c].iFan0n = i; pNode[c].iFan1n = j; pNode[c++].Type = 4; |
| } |
| assert( c < nSize ); |
| // sort |
| Vec_IntClear( vWeight ); |
| for ( i = 0; i < c; i++ ) |
| { |
| pNode[i].Weight = Bdc_CountSpfd( pNode[i].Truth, Truth ); |
| if ( pNode[i].Weight > 300 ) |
| Bdc_SpfdPrint( pNode + i, 1, vLevels, Truth ); |
| Vec_IntPush( vWeight, pNode[i].Weight ); |
| |
| if ( Truth == pNode[i].Truth || Truth == ~pNode[i].Truth ) |
| { |
| printf( "Function can be implemented using %d gates.\n", n ); |
| Bdc_SpfdPrint( pNode + i, n, vLevels, Truth ); |
| goto cleanup; |
| } |
| } |
| pPerm = Abc_MergeSortCost( Vec_IntArray(vWeight), c ); |
| assert( Vec_IntEntry(vWeight, pPerm[0]) <= Vec_IntEntry(vWeight, pPerm[c-1]) ); |
| |
| printf( "Best SPFD = %d.\n", Vec_IntEntry(vWeight, pPerm[c-1]) ); |
| // for ( i = 0; i < c; i++ ) |
| //printf( "%d ", Vec_IntEntry(vWeight, pPerm[i]) ); |
| |
| // choose the best ones |
| pNode2 = ABC_CALLOC( Bdc_Nod_t, nCands ); |
| for ( j = 0, i = c-1; i >= 0; i-- ) |
| { |
| pNode2[j++] = pNode[pPerm[i]]; |
| if ( j == nCands ) |
| break; |
| } |
| ABC_FREE( pPerm ); |
| Vec_PtrPush( vLevels, pNode2 ); |
| Vec_IntPush( vBegs, j ); |
| |
| printf( "Selected %6d gates (out of %6d) on level %2d. ", j, c, n ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| |
| for ( i = 0; i < 10; i++ ) |
| Bdc_SpfdPrint( pNode2 + i, n, vLevels, Truth ); |
| } |
| |
| cleanup: |
| ABC_FREE( pNode ); |
| Vec_PtrForEachEntry( Bdc_Nod_t *, vLevels, pNode, i ) |
| ABC_FREE( pNode ); |
| Vec_PtrFree( vLevels ); |
| Vec_IntFree( vBegs ); |
| Vec_IntFree( vWeight ); |
| } |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdDecomposeTest_() |
| { |
| int fTry = 0; |
| // word T[17]; |
| // int i; |
| |
| // word Truth = Truths[0] & ~Truths[3]; |
| // word Truth = (Truths[0] & Truths[1]) | (Truths[2] & Truths[3]) | (Truths[4] & Truths[5]); |
| // word Truth = (Truths[0] & Truths[1]) | ((Truths[2] & ~Truths[3]) ^ (Truths[4] & ~Truths[5])); |
| // word Truth = (Truths[0] & Truths[1]) | (Truths[2] & Truths[3]); |
| // word Truth = 0x9ef7a8d9c7193a0f; // AAFFAAFF0A0F0A0F |
| // word Truth = 0x34080226CD163000; |
| word Truth = ABC_CONST(0x5052585a0002080a); |
| int nVars = 6; |
| int nCands = 200;// 75; |
| int nGatesMax = 20; |
| |
| if ( fTry ) |
| Bdc_SpfdDecompose( Truth, nVars, nCands, nGatesMax ); |
| /* |
| for ( i = 0; i < 6; i++ ) |
| T[i] = Truths[i]; |
| T[7] = 0; |
| T[8] = ~T[1] & T[3]; |
| T[9] = ~T[8] & T[0]; |
| T[10] = T[1] & T[4]; |
| T[11] = T[10] & T[2]; |
| T[12] = T[11] & T[9]; |
| T[13] = ~T[0] & T[5]; |
| T[14] = T[2] & T[13]; |
| T[15] = ~T[12] & ~T[14]; |
| T[16] = ~T[15]; |
| // if ( T[16] != Truth ) |
| // printf( "Failed\n" ); |
| |
| for ( i = 0; i < 17; i++ ) |
| { |
| // printf( "%2d = %3d ", i, Bdc_CountSpfd(T[i], Truth) ); |
| printf( "%2d = %3d ", i, Bdc_CountSpfd(T[i], T[16]) ); |
| Extra_PrintBinary( stdout, (unsigned *)&T[i], 64 ); printf( "\n" ); |
| } |
| // Extra_PrintBinary( stdout, (unsigned *)&Truth, 64 ); printf( "\n" ); |
| */ |
| } |
| |
| |
| |
| |
| typedef struct Bdc_Ent_t_ Bdc_Ent_t; // 24 bytes |
| struct Bdc_Ent_t_ |
| { |
| unsigned iFan0 : 29; |
| unsigned fCompl0 : 1; |
| unsigned fCompl : 1; |
| unsigned fMark0 : 1; |
| unsigned iFan1 : 29; |
| unsigned fCompl1 : 1; |
| unsigned fExor : 1; |
| unsigned fMark1 : 1; |
| int iNext; |
| int iList; |
| word Truth; |
| }; |
| |
| #define BDC_TERM 0x1FFFFFFF |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int Bdc_SpfdMark0( Bdc_Ent_t * p, Bdc_Ent_t * pEnt ) |
| { |
| if ( pEnt->iFan0 == BDC_TERM ) |
| return 0; |
| if ( pEnt->fMark0 ) |
| return 0; |
| pEnt->fMark0 = 1; |
| return pEnt->fMark1 + |
| Bdc_SpfdMark0(p, p + pEnt->iFan0) + |
| Bdc_SpfdMark0(p, p + pEnt->iFan1); |
| } |
| int Bdc_SpfdMark1( Bdc_Ent_t * p, Bdc_Ent_t * pEnt ) |
| { |
| if ( pEnt->iFan0 == BDC_TERM ) |
| return 0; |
| if ( pEnt->fMark1 ) |
| return 0; |
| pEnt->fMark1 = 1; |
| return pEnt->fMark0 + |
| Bdc_SpfdMark1(p, p + pEnt->iFan0) + |
| Bdc_SpfdMark1(p, p + pEnt->iFan1); |
| } |
| void Bdc_SpfdUnmark0( Bdc_Ent_t * p, Bdc_Ent_t * pEnt ) |
| { |
| if ( pEnt->iFan0 == BDC_TERM ) |
| return; |
| pEnt->fMark0 = 0; |
| Bdc_SpfdUnmark0( p, p + pEnt->iFan0 ); |
| Bdc_SpfdUnmark0( p, p + pEnt->iFan1 ); |
| } |
| void Bdc_SpfdUnmark1( Bdc_Ent_t * p, Bdc_Ent_t * pEnt ) |
| { |
| if ( pEnt->iFan0 == BDC_TERM ) |
| return; |
| pEnt->fMark1 = 0; |
| Bdc_SpfdUnmark1( p, p + pEnt->iFan0 ); |
| Bdc_SpfdUnmark1( p, p + pEnt->iFan1 ); |
| } |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int Bdc_SpfdCheckOverlap( Bdc_Ent_t * p, Bdc_Ent_t * pEnt0, Bdc_Ent_t * pEnt1 ) |
| { |
| int RetValue; |
| RetValue = Bdc_SpfdMark0( p, pEnt0 ); |
| assert( RetValue == 0 ); |
| RetValue = Bdc_SpfdMark1( p, pEnt1 ); |
| Bdc_SpfdUnmark0( p, pEnt0 ); |
| Bdc_SpfdUnmark1( p, pEnt1 ); |
| return RetValue; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int Bdc_SpfdHashValue( word t, int Size ) |
| { |
| // http://planetmath.org/encyclopedia/GoodHashTablePrimes.html |
| // 53, |
| // 97, |
| // 193, |
| // 389, |
| // 769, |
| // 1543, |
| // 3079, |
| // 6151, |
| // 12289, |
| // 24593, |
| // 49157, |
| // 98317, |
| // 196613, |
| // 393241, |
| // 786433, |
| // 1572869, |
| // 3145739, |
| // 6291469, |
| // 12582917, |
| // 25165843, |
| // 50331653, |
| // 100663319, |
| // 201326611, |
| // 402653189, |
| // 805306457, |
| // 1610612741, |
| static unsigned BigPrimes[8] = {12582917, 25165843, 50331653, 100663319, 201326611, 402653189, 805306457, 1610612741}; |
| unsigned char * s = (unsigned char *)&t; |
| unsigned i, Value = 0; |
| for ( i = 0; i < 8; i++ ) |
| Value ^= BigPrimes[i] * s[i]; |
| return Value % Size; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int * Bdc_SpfdHashLookup( Bdc_Ent_t * p, int Size, word t ) |
| { |
| Bdc_Ent_t * pBin = p + Bdc_SpfdHashValue( t, Size ); |
| if ( pBin->iList == 0 ) |
| return &pBin->iList; |
| for ( pBin = p + pBin->iList; ; pBin = p + pBin->iNext ) |
| { |
| if ( pBin->Truth == t ) |
| return NULL; |
| if ( pBin->iNext == 0 ) |
| return &pBin->iNext; |
| } |
| assert( 0 ); |
| return NULL; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| Vec_Wrd_t * Bdc_SpfdDecomposeTest__( Vec_Int_t ** pvWeights ) |
| { |
| // int nFuncs = 8000000; // the number of functions to compute |
| // int nSize = 2777111; // the hash table size to use |
| // int Limit = 6; |
| |
| // int nFuncs = 51000000; // the number of functions to compute |
| // int nSize = 50331653; // the hash table size to use |
| // int Limit = 6; |
| |
| int nFuncs = 250000000; // the number of functions to compute |
| int nSize = 201326611; // the hash table size to use |
| int Limit = 6; |
| |
| int * pPlace, i, n, m, k, s, fCompl; |
| abctime clk = Abc_Clock(), clk2; |
| Vec_Int_t * vStops; |
| Vec_Wrd_t * vTruths; |
| Vec_Int_t * vWeights; |
| Bdc_Ent_t * p, * q, * pBeg0, * pEnd0, * pBeg1, * pEnd1, * pThis0, * pThis1; |
| word t0, t1, t; |
| assert( nSize <= nFuncs ); |
| |
| printf( "Allocating %.2f MB of internal memory.\n", 1.0*sizeof(Bdc_Ent_t)*nFuncs/(1<<20) ); |
| |
| p = (Bdc_Ent_t *)calloc( nFuncs, sizeof(Bdc_Ent_t) ); |
| memset( p, 255, sizeof(Bdc_Ent_t) ); |
| p->iList = 0; |
| for ( q = p; q < p+nFuncs; q++ ) |
| q->iList = 0; |
| q = p + 1; |
| printf( "Added %d + %d + 0 = %d. Total = %8d.\n", 0, 0, 0, (int)(q-p) ); |
| |
| vTruths = Vec_WrdStart( nFuncs ); |
| vWeights = Vec_IntStart( nFuncs ); |
| Vec_WrdClear( vTruths ); |
| Vec_IntClear( vWeights ); |
| |
| // create elementary vars |
| vStops = Vec_IntAlloc( 10 ); |
| Vec_IntPush( vStops, 1 ); |
| for ( i = 0; i < 6; i++ ) |
| { |
| q->iFan0 = BDC_TERM; |
| q->iFan1 = i; |
| q->Truth = Truths[i]; |
| pPlace = Bdc_SpfdHashLookup( p, nSize, q->Truth ); |
| *pPlace = q-p; |
| q++; |
| Vec_WrdPush( vTruths, Truths[i] ); |
| Vec_IntPush( vWeights, 0 ); |
| } |
| Vec_IntPush( vStops, 7 ); |
| printf( "Added %d + %d + 0 = %d. Total = %8d.\n", 0, 0, 0, (int)(q-p) ); |
| |
| // create gates |
| for ( n = 0; n < Limit; n++ ) |
| { |
| // try previous |
| for ( k = 0; k < Limit; k++ ) |
| for ( m = 0; m < Limit; m++ ) |
| { |
| if ( k + m != n || k > m ) |
| continue; |
| // set the start and stop |
| pBeg0 = p + Vec_IntEntry( vStops, k ); |
| pEnd0 = p + Vec_IntEntry( vStops, k+1 ); |
| // set the start and stop |
| pBeg1 = p + Vec_IntEntry( vStops, m ); |
| pEnd1 = p + Vec_IntEntry( vStops, m+1 ); |
| |
| clk2 = Abc_Clock(); |
| printf( "Trying %7d x %7d. ", (int)(pEnd0-pBeg0), (int)(pEnd1-pBeg1) ); |
| for ( pThis0 = pBeg0; pThis0 < pEnd0; pThis0++ ) |
| for ( pThis1 = pBeg1; pThis1 < pEnd1; pThis1++ ) |
| if ( k < m || pThis1 > pThis0 ) |
| // if ( n < 5 || Bdc_SpfdCheckOverlap(p, pThis0, pThis1) ) |
| for ( s = 0; s < 5; s++ ) |
| { |
| t0 = (s&1) ? ~pThis0->Truth : pThis0->Truth; |
| t1 = ((s>>1)&1) ? ~pThis1->Truth : pThis1->Truth; |
| t = ((s>>2)&1) ? t0 ^ t1 : t0 & t1; |
| fCompl = t & 1; |
| if ( fCompl ) |
| t = ~t; |
| if ( t == 0 ) |
| continue; |
| pPlace = Bdc_SpfdHashLookup( p, nSize, t ); |
| if ( pPlace == NULL ) |
| continue; |
| q->iFan0 = pThis0-p; |
| q->fCompl0 = s&1; |
| q->iFan1 = pThis1-p; |
| q->fCompl1 = (s>>1)&1; |
| q->fExor = (s>>2)&1; |
| q->Truth = t; |
| q->fCompl = fCompl; |
| *pPlace = q-p; |
| q++; |
| Vec_WrdPush( vTruths, t ); |
| // Vec_IntPush( vWeights, n == 5 ? n : n+1 ); |
| Vec_IntPush( vWeights, n+1 ); |
| if ( q-p == nFuncs ) |
| { |
| printf( "Reached limit of %d functions.\n", nFuncs ); |
| goto finish; |
| } |
| } |
| printf( "Added %d + %d + 1 = %d. Total = %8d. ", k, m, n+1, (int)(q-p) ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk2 ); |
| } |
| Vec_IntPush( vStops, q-p ); |
| } |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| |
| |
| { |
| FILE * pFile = fopen( "func6v6n_bin.txt", "wb" ); |
| fwrite( Vec_WrdArray(vTruths), sizeof(word), Vec_WrdSize(vTruths), pFile ); |
| fclose( pFile ); |
| } |
| { |
| FILE * pFile = fopen( "func6v6nW_bin.txt", "wb" ); |
| fwrite( Vec_IntArray(vWeights), sizeof(int), Vec_IntSize(vWeights), pFile ); |
| fclose( pFile ); |
| } |
| |
| |
| finish: |
| Vec_IntFree( vStops ); |
| free( p ); |
| |
| *pvWeights = vWeights; |
| // Vec_WrdFree( vTruths ); |
| return vTruths; |
| } |
| |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| Vec_Wrd_t * Bdc_SpfdReadFiles5( Vec_Int_t ** pvWeights ) |
| { |
| Vec_Int_t * vWeights; |
| Vec_Wrd_t * vDivs; |
| FILE * pFile; |
| int RetValue; |
| |
| vDivs = Vec_WrdStart( 3863759 ); |
| pFile = fopen( "func6v5n_bin.txt", "rb" ); |
| RetValue = fread( Vec_WrdArray(vDivs), sizeof(word), Vec_WrdSize(vDivs), pFile ); |
| fclose( pFile ); |
| |
| vWeights = Vec_IntStart( 3863759 ); |
| pFile = fopen( "func6v5nW_bin.txt", "rb" ); |
| RetValue = fread( Vec_IntArray(vWeights), sizeof(int), Vec_IntSize(vWeights), pFile ); |
| fclose( pFile ); |
| |
| *pvWeights = vWeights; |
| return vDivs; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| Vec_Wrd_t * Bdc_SpfdReadFiles6( Vec_Int_t ** pvWeights ) |
| { |
| Vec_Int_t * vWeights; |
| Vec_Wrd_t * vDivs = Vec_WrdStart( 12776759 ); |
| FILE * pFile = fopen( "func6v6n_bin.txt", "rb" ); |
| int RetValue; |
| RetValue = fread( Vec_WrdArray(vDivs), sizeof(word), Vec_WrdSize(vDivs), pFile ); |
| fclose( pFile ); |
| |
| vWeights = Vec_IntStart( 12776759 ); |
| pFile = fopen( "func6v6nW_bin.txt", "rb" ); |
| RetValue = fread( Vec_IntArray(vWeights), sizeof(int), Vec_IntSize(vWeights), pFile ); |
| fclose( pFile ); |
| |
| *pvWeights = vWeights; |
| return vDivs; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int Bdc_SpfdComputeCost( word f, int i, Vec_Int_t * vWeights ) |
| { |
| int Ones = Bdc_CountOnes(f); |
| if ( Ones == 0 ) |
| return -1; |
| return 7*Ones + 10*(8 - Vec_IntEntry(vWeights, i)); |
| // return Bdc_CountOnes(f); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| word Bdc_SpfdFindBest( Vec_Wrd_t * vDivs, Vec_Int_t * vWeights, word F0, word F1, int * pCost ) |
| { |
| word Func, FuncBest; |
| int i, Cost, CostBest = -1, NumBest = -1; |
| Vec_WrdForEachEntry( vDivs, Func, i ) |
| { |
| if ( (Func & F0) == 0 ) |
| { |
| Cost = Bdc_SpfdComputeCost(Func & F1, i, vWeights); |
| if ( CostBest < Cost ) |
| { |
| CostBest = Cost; |
| FuncBest = Func; |
| NumBest = i; |
| } |
| } |
| if ( (Func & F1) == 0 ) |
| { |
| Cost = Bdc_SpfdComputeCost(Func & F0, i, vWeights); |
| if ( CostBest < Cost ) |
| { |
| CostBest = Cost; |
| FuncBest = Func; |
| NumBest = i; |
| } |
| } |
| if ( (~Func & F0) == 0 ) |
| { |
| Cost = Bdc_SpfdComputeCost(~Func & F1, i, vWeights); |
| if ( CostBest < Cost ) |
| { |
| CostBest = Cost; |
| FuncBest = ~Func; |
| NumBest = i; |
| } |
| } |
| if ( (~Func & F1) == 0 ) |
| { |
| Cost = Bdc_SpfdComputeCost(~Func & F0, i, vWeights); |
| if ( CostBest < Cost ) |
| { |
| CostBest = Cost; |
| FuncBest = ~Func; |
| NumBest = i; |
| } |
| } |
| } |
| (*pCost) += Vec_IntEntry(vWeights, NumBest); |
| assert( CostBest > 0 ); |
| printf( "Selected %8d with cost %2d and weight %d: ", NumBest, 0, Vec_IntEntry(vWeights, NumBest) ); |
| Extra_PrintHex( stdout, (unsigned *)&FuncBest, 6 ); printf( "\n" ); |
| return FuncBest; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| int Bdc_SpfdDecomposeTestOne( word t, Vec_Wrd_t * vDivs, Vec_Int_t * vWeights ) |
| { |
| word F1 = t; |
| word F0 = ~F1; |
| word Func; |
| int i, Cost = 0; |
| printf( "Trying: " ); |
| Extra_PrintHex( stdout, (unsigned *)&t, 6 ); printf( "\n" ); |
| // Abc_Show6VarFunc( F0, F1 ); |
| for ( i = 0; F0 && F1; i++ ) |
| { |
| printf( "*** ITER %2d ", i ); |
| Func = Bdc_SpfdFindBest( vDivs, vWeights, F0, F1, &Cost ); |
| F0 &= ~Func; |
| F1 &= ~Func; |
| // Abc_Show6VarFunc( F0, F1 ); |
| } |
| Cost += (i-1); |
| printf( "Produce solution with cost %2d (with adj cost %4d).\n", Cost, Bdc_SpfdAdjCost(t) ); |
| return Cost; |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdDecomposeTest44() |
| { |
| // word t = 0x5052585a0002080a; |
| |
| word t = ABC_CONST(0x9ef7a8d9c7193a0f); |
| // word t = 0x6BFDA276C7193A0F; |
| // word t = 0xA3756AFE0B1DF60B; |
| |
| // word t = 0xFEF7AEBFCE80AA0F; |
| // word t = 0x9EF7FDBFC77F6F0F; |
| // word t = 0xDEF7FDFF377F6FFF; |
| |
| // word t = 0x345D02736DB390A5; // xor with var 0 |
| |
| // word t = 0x3EFDA2736D139A0F; // best solution after changes |
| |
| Vec_Int_t * vWeights; |
| Vec_Wrd_t * vDivs; |
| word c0, c1, s, tt, tbest; |
| int i, j, Cost, CostBest = 100000; |
| abctime clk = Abc_Clock(); |
| |
| return; |
| |
| // printf( "%d\n", RAND_MAX ); |
| |
| vDivs = Bdc_SpfdDecomposeTest__( &vWeights ); |
| // vDivs = Bdc_SpfdReadFiles5( &vWeights ); |
| |
| // Abc_Show6VarFunc( ~t, t ); |
| |
| // try function |
| tt = t; |
| Cost = Bdc_SpfdDecomposeTestOne( tt, vDivs, vWeights ); |
| if ( CostBest > Cost ) |
| { |
| CostBest = Cost; |
| tbest = tt; |
| } |
| printf( "\n" ); |
| |
| // try complemented output |
| for ( i = 0; i < 6; i++ ) |
| { |
| tt = t ^ Truths[i]; |
| Cost = Bdc_SpfdDecomposeTestOne( tt, vDivs, vWeights ); |
| if ( CostBest > Cost ) |
| { |
| CostBest = Cost; |
| tbest = tt; |
| } |
| } |
| printf( "\n" ); |
| |
| // try complemented input |
| for ( i = 0; i < 6; i++ ) |
| for ( j = 0; j < 6; j++ ) |
| { |
| if ( i == j ) |
| continue; |
| c0 = Bdc_Cof6( t, i, 0 ); |
| c1 = Bdc_Cof6( t, i, 1 ); |
| s = Truths[i] ^ Truths[j]; |
| tt = (~s & c0) | (s & c1); |
| |
| Cost = Bdc_SpfdDecomposeTestOne( tt, vDivs, vWeights ); |
| if ( CostBest > Cost ) |
| { |
| CostBest = Cost; |
| tbest = tt; |
| } |
| } |
| |
| /* |
| for ( i = 0; i < 6; i++ ) |
| for ( j = 0; j < 6; j++ ) |
| { |
| if ( i == j ) |
| continue; |
| c0 = Bdc_Cof6( t, i, 0 ); |
| c1 = Bdc_Cof6( t, i, 1 ); |
| s = Truths[i] ^ Truths[j]; |
| tt = (~s & c0) | (s & c1); |
| |
| for ( k = 0; k < 6; k++ ) |
| for ( n = 0; n < 6; n++ ) |
| { |
| if ( k == n ) |
| continue; |
| c0 = Bdc_Cof6( tt, k, 0 ); |
| c1 = Bdc_Cof6( tt, k, 1 ); |
| s = Truths[k] ^ Truths[n]; |
| ttt= (~s & c0) | (s & c1); |
| |
| Cost = Bdc_SpfdDecomposeTestOne( ttt, vDivs, vWeights ); |
| if ( CostBest > Cost ) |
| { |
| CostBest = Cost; |
| tbest = ttt; |
| } |
| } |
| } |
| */ |
| |
| printf( "Best solution found with cost %d. ", CostBest ); |
| Extra_PrintHex( stdout, (unsigned *)&tbest, 6 ); //printf( "\n" ); |
| Abc_PrintTime( 1, " Time", Abc_Clock() - clk ); |
| |
| Vec_WrdFree( vDivs ); |
| Vec_IntFree( vWeights ); |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdDecomposeTest3() |
| { |
| int nSizeM = (1 << 26); |
| int nSizeK = (1 << 3); |
| Vec_Wrd_t * v1M; |
| Vec_Wrd_t * v1K; |
| int i, k, Counter; |
| abctime clk; |
| // int EntryM, EntryK; |
| Aig_ManRandom64( 1 ); |
| |
| v1M = Vec_WrdAlloc( nSizeM ); |
| for ( i = 0; i < nSizeM; i++ ) |
| Vec_WrdPush( v1M, Aig_ManRandom64(0) ); |
| |
| v1K = Vec_WrdAlloc( nSizeK ); |
| for ( i = 0; i < nSizeK; i++ ) |
| Vec_WrdPush( v1K, Aig_ManRandom64(0) ); |
| |
| clk = Abc_Clock(); |
| Counter = 0; |
| for ( i = 0; i < nSizeM; i++ ) |
| for ( k = 0; k < nSizeK; k++ ) |
| Counter += ((v1M->pArray[i] & v1K->pArray[k]) == v1K->pArray[k]); |
| // Vec_WrdForEachEntry( v1M, EntryM, i ) |
| // Vec_WrdForEachEntry( v1K, EntryK, k ) |
| // Counter += ((EntryM & EntryK) == EntryK); |
| |
| printf( "Total = %8d. ", Counter ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| |
| clk = Abc_Clock(); |
| Counter = 0; |
| for ( k = 0; k < nSizeK; k++ ) |
| for ( i = 0; i < nSizeM; i++ ) |
| Counter += ((v1M->pArray[i] & v1K->pArray[k]) == v1K->pArray[k]); |
| printf( "Total = %8d. ", Counter ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdDecomposeTest8() |
| { |
| // word t = 0x9ef7a8d9c7193a0f; |
| // word t = 0x9EF7FDBFC77F6F0F; |
| word t = ABC_CONST(0x513B57150819050F); |
| |
| Vec_Int_t * vWeights; |
| Vec_Wrd_t * vDivs; |
| word Func, FuncBest; |
| int Cost, CostBest = ABC_INFINITY; |
| int i; |
| abctime clk = Abc_Clock(); |
| |
| // return; |
| |
| vDivs = Bdc_SpfdReadFiles5( &vWeights ); |
| |
| printf( "Best init = %4d. ", Bdc_SpfdAdjCost(t) ); |
| Extra_PrintHex( stdout, (unsigned *)&t, 6 ); //printf( "\n" ); |
| Abc_PrintTime( 1, " Time", Abc_Clock() - clk ); |
| |
| Vec_WrdForEachEntry( vDivs, Func, i ) |
| { |
| Cost = Bdc_SpfdAdjCost( t ^ Func ); |
| if ( CostBest > Cost ) |
| { |
| CostBest = Cost; |
| FuncBest = Func; |
| } |
| } |
| |
| printf( "Best cost = %4d. ", CostBest ); |
| Extra_PrintHex( stdout, (unsigned *)&FuncBest, 6 ); //printf( "\n" ); |
| Abc_PrintTime( 1, " Time", Abc_Clock() - clk ); |
| |
| Abc_Show6VarFunc( 0, t ); |
| Abc_Show6VarFunc( 0, FuncBest ); |
| Abc_Show6VarFunc( 0, (FuncBest ^ t) ); |
| |
| FuncBest ^= t; |
| Extra_PrintHex( stdout, (unsigned *)&FuncBest, 6 ); printf( "\n" ); |
| |
| } |
| |
| /**Function************************************************************* |
| |
| Synopsis [] |
| |
| Description [] |
| |
| SideEffects [] |
| |
| SeeAlso [] |
| |
| ***********************************************************************/ |
| void Bdc_SpfdDecomposeTest() |
| { |
| int nSizeM = (1 << 26); // big array size |
| int nSizeK = (1 << 3); // small array size |
| Vec_Wrd_t * v1M, * v1K; |
| int EntryM, EntryK; |
| int i, k, Counter; |
| abctime clk; |
| |
| Aig_ManRandom64( 1 ); |
| |
| v1M = Vec_WrdAlloc( nSizeM ); |
| for ( i = 0; i < nSizeM; i++ ) |
| Vec_WrdPush( v1M, Aig_ManRandom64(0) ); |
| |
| v1K = Vec_WrdAlloc( nSizeK ); |
| for ( i = 0; i < nSizeK; i++ ) |
| Vec_WrdPush( v1K, Aig_ManRandom64(0) ); |
| |
| clk = Abc_Clock(); |
| Counter = 0; |
| // for ( i = 0; i < nSizeM; i++ ) |
| // for ( k = 0; k < nSizeK; k++ ) |
| // Counter += ((v1M->pArray[i] & v1K->pArray[k]) == v1K->pArray[k]); |
| Vec_WrdForEachEntry( v1M, EntryM, i ) |
| Vec_WrdForEachEntry( v1K, EntryK, k ) |
| Counter += ((EntryM & EntryK) == EntryK); |
| printf( "Total = %8d. ", Counter ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| |
| clk = Abc_Clock(); |
| Counter = 0; |
| // for ( k = 0; k < nSizeK; k++ ) |
| // for ( i = 0; i < nSizeM; i++ ) |
| // Counter += ((v1M->pArray[i] & v1K->pArray[k]) == v1K->pArray[k]); |
| Vec_WrdForEachEntry( v1K, EntryK, k ) |
| Vec_WrdForEachEntry( v1M, EntryM, i ) |
| Counter += ((EntryM & EntryK) == EntryK); |
| printf( "Total = %8d. ", Counter ); |
| Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); |
| } |
| |
| |
| //////////////////////////////////////////////////////////////////////// |
| /// END OF FILE /// |
| //////////////////////////////////////////////////////////////////////// |
| |
| |
| ABC_NAMESPACE_IMPL_END |
| |
